1.0 2010-04-08 22:14:33 UTC 2025-11-19 02:24:15 UTC FDB019731 2-(5-Methyl-2-furanyl)pyrrolidine Putative proline-derived Maillard product formed in model reactions with 1-pyrroline and ascorbic acid 2-Methyl-5-(2-pyrrolidinyl)furan C9H13NO 151.2056 151.099714043 2-(5-methylfuran-2-yl)pyrrolidine 2-(5-methylfuran-2-yl)pyrrolidine 118248-27-4 CC1=CC=C(O1)C1CCCN1 InChI=1S/C9H13NO/c1-7-4-5-9(11-7)8-3-2-6-10-8/h4-5,8,10H,2-3,6H2,1H3 LGGXPKQFJZIICN-UHFFFAOYSA-N belongs to the class of organic compounds known as aralkylamines. These are alkylamines in which the alkyl group is substituted at one carbon atom by an aromatic hydrocarbyl group. Aralkylamines Organic compounds Organic nitrogen compounds Organonitrogen compounds Amines Aromatic heteromonocyclic compounds Azacyclic compounds Dialkylamines Furans Heteroaromatic compounds Hydrocarbon derivatives Organooxygen compounds Organopnictogen compounds Oxacyclic compounds Pyrrolidines Aralkylamine Aromatic heteromonocyclic compound Azacycle Furan Heteroaromatic compound Hydrocarbon derivative Organic oxygen compound Organoheterocyclic compound Organooxygen compound Organopnictogen compound Oxacycle Pyrrolidine Secondary aliphatic amine Secondary amine logp 1.26 ALOGPS logs -2.02 ALOGPS solubility 1.45e+00 g/l ALOGPS logp 1.26 ChemAxon pka_strongest_basic 9.42 ChemAxon iupac 2-(5-methylfuran-2-yl)pyrrolidine ChemAxon average_mass 151.2056 ChemAxon mono_mass 151.099714043 ChemAxon smiles CC1=CC=C(O1)C1CCCN1 ChemAxon formula C9H13NO ChemAxon inchi InChI=1S/C9H13NO/c1-7-4-5-9(11-7)8-3-2-6-10-8/h4-5,8,10H,2-3,6H2,1H3 ChemAxon inchikey LGGXPKQFJZIICN-UHFFFAOYSA-N ChemAxon polar_surface_area 25.17 ChemAxon refractivity 44.06 ChemAxon polarizability 17.58 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 8540 Specdb::MsIr 8541 Specdb::MsIr 8542 Specdb::CMs 9471 Specdb::CMs 153045 Specdb::MsMs 286891 Specdb::MsMs 286892 Specdb::MsMs 286893 Specdb::MsMs 325621 Specdb::MsMs 325622 Specdb::MsMs 325623 Specdb::MsMs 3060867 Specdb::MsMs 3060868 Specdb::MsMs 3060869 Specdb::MsMs 3108879 Specdb::MsMs 3108880 Specdb::MsMs 3108881 HMDB40044 #<Reference:0x000055ce32ae46a0>