1.0 2010-04-08 22:14:36 UTC 2025-11-19 02:25:38 UTC FDB019825 Nicotinamide ascorbate It is used as a food additive L-Ascorbic acid, compd. with 3-pyridinecarboxamide (9CI) L-Ascorbic acid, compd. with nicotinamide (8CI) L-Ascorbic acid, mixt. with 3-pyridinecarboxamide Merpress Niacinamide ascorbate Nicastubin Nicastubine Nicoscorbine Nicotinamide ascorbate C12H14N2O7 298.2488 298.080100812 5-(1,2-dihydroxyethyl)-3,4-dihydroxy-2,5-dihydrofuran-2-one; pyridine-3-carboxamide C-level; nicotinamide 1987-71-9 NC(=O)C1=CC=CN=C1.OCC(O)C1OC(=O)C(O)=C1O InChI=1S/C6H6N2O.C6H8O6/c7-6(9)5-2-1-3-8-4-5;7-1-2(8)5-3(9)4(10)6(11)12-5/h1-4H,(H2,7,9);2,5,7-10H,1H2 JMORAWFVNMGOKQ-UHFFFAOYSA-N belongs to the class of organic compounds known as nicotinamides. These are heterocyclic aromatic compounds containing a pyridine ring substituted at position 3 by a carboxamide group. Nicotinamides Organic compounds Organoheterocyclic compounds Pyridines and derivatives Pyridinecarboxylic acids and derivatives 1,2-diols Azacyclic compounds Butenolides Carbonyl compounds Enediols Enoate esters Heteroaromatic compounds Hydrocarbon derivatives Lactones Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Primary alcohols Primary carboxylic acid amides Secondary alcohols Vinylogous acids 1,2-diol 2-furanone Alcohol Alpha,beta-unsaturated carboxylic ester Aromatic heteromonocyclic compound Azacycle Carbonyl group Carboxamide group Carboxylic acid derivative Carboxylic acid ester Dihydrofuran Enediol Enoate ester Heteroaromatic compound Hydrocarbon derivative Lactone Monocarboxylic acid or derivatives Nicotinamide Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Primary alcohol Primary carboxylic acid amide Secondary alcohol Vinylogous acid melting_point Mp 141-145° logp -1.9 ChemAxon pka_strongest_acidic 4.36 ChemAxon pka_strongest_basic -3 ChemAxon iupac 5-(1,2-dihydroxyethyl)-3,4-dihydroxy-2,5-dihydrofuran-2-one; pyridine-3-carboxamide ChemAxon average_mass 298.2488 ChemAxon mono_mass 298.080100812 ChemAxon smiles NC(=O)C1=CC=CN=C1.OCC(O)C1OC(=O)C(O)=C1O ChemAxon formula C12H14N2O7 ChemAxon inchi InChI=1S/C6H6N2O.C6H8O6/c7-6(9)5-2-1-3-8-4-5;7-1-2(8)5-3(9)4(10)6(11)12-5/h1-4H,(H2,7,9);2,5,7-10H,1H2 ChemAxon inchikey JMORAWFVNMGOKQ-UHFFFAOYSA-N ChemAxon polar_surface_area 107.22 ChemAxon refractivity 37.03 ChemAxon polarizability 15.04 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 5 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon 38290