1.0 2010-04-08 22:14:39 UTC 2019-11-26 03:17:58 UTC FDB019878 xi-5-Hydroxydodecanoic acid Present as triglycerides in milk and butterfat. xi-5-Hydroxydodecanoic acid is found in milk and milk products. 5-hydroxydecanoate 5-hydroxydecanoic acid sodium C12H24O3 216.3172 216.172544634 5-hydroxydodecanoic acid 5-hydroxydodecanoic acid 7779-95-5 CCCCCCCC(O)CCCC(O)=O InChI=1S/C12H24O3/c1-2-3-4-5-6-8-11(13)9-7-10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15) LXNOENXQFNYMGT-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Medium-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Hydroxy fatty acids Monocarboxylic acids and derivatives Organic oxides Secondary alcohols Alcohol Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Hydroxy fatty acid Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Secondary alcohol logp 3.55 ALOGPS logs -2.77 ALOGPS solubility 3.66e-01 g/l ALOGPS logp 3.09 ChemAxon pka_strongest_acidic 4.71 ChemAxon pka_strongest_basic -1.2 ChemAxon iupac 5-hydroxydodecanoic acid ChemAxon average_mass 216.3172 ChemAxon mono_mass 216.172544634 ChemAxon smiles CCCCCCCC(O)CCCC(O)=O ChemAxon formula C12H24O3 ChemAxon inchi InChI=1S/C12H24O3/c1-2-3-4-5-6-8-11(13)9-7-10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15) ChemAxon inchikey LXNOENXQFNYMGT-UHFFFAOYSA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 60.35 ChemAxon polarizability 26.6 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 294424 Specdb::MsMs 294425 Specdb::MsMs 294426 Specdb::MsMs 335140 Specdb::MsMs 335141 Specdb::MsMs 335142 Specdb::MsMs 2276106 Specdb::MsMs 2276107 Specdb::MsMs 2276108 Specdb::MsMs 3092032 Specdb::MsMs 3092033 Specdb::MsMs 3092034 Specdb::CMs 12934 Specdb::CMs 46696 Specdb::CMs 133599 Specdb::CMs 141333 HMDB40169 #<Reference:0x000055ce31bf4870> Milk and milk products Unknown generic