1.0 2010-04-08 22:14:40 UTC 2015-07-21 06:40:12 UTC FDB019918 Allyl 3-cyclohexylpropionate Pineapple flavourant 2-Propenyl 3-cyclohexylpropanoate 2-Propenyl 3-cyclohexylpropanoic acid 2-Propenyl cyclohexanepropanoate 3-Allylcyclohexyl propionate Allyl 3-cyclohexylpropanoate Allyl 3-cyclohexylpropionate Allyl beta-cyclohexylpropionate Allyl cyclohexanepropionate Allyl cyclohexylpropanoate Allyl cyclohexylpropionate Allyl hexahydrophenylpropionate Ananolide FEMA 2026 C12H20O2 196.286 196.146329884 prop-2-en-1-yl 3-cyclohexylpropanoate allyl cyclohexylpropionate 2705-87-5 C=CCOC(=O)CCC1CCCCC1 InChI=1S/C12H20O2/c1-2-10-14-12(13)9-8-11-6-4-3-5-7-11/h2,11H,1,3-10H2 TWXUTZNBHUWMKJ-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty acid esters. These are carboxylic ester derivatives of a fatty acid. Fatty acid esters Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acid esters Aliphatic homomonocyclic compounds Carbonyl compounds Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic homomonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid ester Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound fatty acid ester logp 4.14 ALOGPS logs -4.38 ALOGPS solubility 8.15e-03 g/l ALOGPS logp 3.4 ChemAxon pka_strongest_basic -7 ChemAxon iupac prop-2-en-1-yl 3-cyclohexylpropanoate ChemAxon average_mass 196.286 ChemAxon mono_mass 196.146329884 ChemAxon smiles C=CCOC(=O)CCC1CCCCC1 ChemAxon formula C12H20O2 ChemAxon inchi InChI=1S/C12H20O2/c1-2-10-14-12(13)9-8-11-6-4-3-5-7-11/h2,11H,1,3-10H2 ChemAxon inchikey TWXUTZNBHUWMKJ-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 56.95 ChemAxon polarizability 23.48 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 22513 Specdb::CMs 28350 Specdb::CMs 102064 Specdb::CMs 132997 Specdb::CMs 140731 Specdb::MsMs 72486 Specdb::MsMs 72487 Specdb::MsMs 72488 Specdb::MsMs 131430 Specdb::MsMs 131431 Specdb::MsMs 131432 Specdb::MsMs 2765207 Specdb::MsMs 2765208 Specdb::MsMs 2765209 Specdb::MsMs 2944066 Specdb::MsMs 2944067 Specdb::MsMs 2944068 Specdb::MsIr 8774 Specdb::MsIr 8775 HMDB40206 #<Reference:0x000055ce2d95efb0> candy fruity pineapple sweet tropical waxy