1.0 2010-04-08 22:14:43 UTC 2025-11-19 02:27:08 UTC FDB019974 Sodium (±)-2-(4-methoxyphenoxy)propionate Sweet taste inhibitor for foodstuffs FEMA 3773 Sodium (±)-2-(4-methoxyphenoxy)propionate C10H11NaO4 218.1817 218.055503515 sodium 2-(4-methoxyphenoxy)propanoate sodium 2-(4-methoxyphenoxy)propanoate 150436-68-3 [Na+].COC1=CC=C(OC(C)C([O-])=O)C=C1 InChI=1S/C10H12O4.Na/c1-7(10(11)12)14-9-5-3-8(13-2)4-6-9;/h3-7H,1-2H3,(H,11,12);/q;+1/p-1 SKORRGYRKQDXRS-UHFFFAOYSA-M belongs to the class of organic compounds known as alkyloxyphenoxypropionic acids. These are aromatic compounds containing a phenoxypropionic acid that is para-substituted with an alkyl group. Alkyloxyphenoxypropionic acids Organic compounds Benzenoids Benzene and substituted derivatives 2-phenoxypropionic acids Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acid salts Carboxylic acids Hydrocarbon derivatives Methoxybenzenes Monocarboxylic acids and derivatives Organic oxides Organic sodium salts Phenoxy compounds Phenoxyacetic acid derivatives Alkyl aryl ether Alkyloxyphenoxypropionic acid Anisole Aromatic homomonocyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid salt Ether Hydrocarbon derivative Methoxybenzene Monocarboxylic acid or derivatives Organic alkali metal salt Organic oxide Organic oxygen compound Organic salt Organic sodium salt Organooxygen compound Phenol ether Phenoxy compound Phenoxyacetate logp 1.86 ALOGPS logs -1.74 ALOGPS solubility 4.00e+00 g/l ALOGPS melting_point Mp 190° logp 1.7 ChemAxon pka_strongest_acidic 3.48 ChemAxon pka_strongest_basic -4.5 ChemAxon iupac sodium 2-(4-methoxyphenoxy)propanoate ChemAxon average_mass 218.1817 ChemAxon mono_mass 218.055503515 ChemAxon smiles [Na+].COC1=CC=C(OC(C)C([O-])=O)C=C1 ChemAxon formula C10H11NaO4 ChemAxon inchi InChI=1S/C10H12O4.Na/c1-7(10(11)12)14-9-5-3-8(13-2)4-6-9;/h3-7H,1-2H3,(H,11,12);/q;+1/p-1 ChemAxon inchikey SKORRGYRKQDXRS-UHFFFAOYSA-M ChemAxon polar_surface_area 58.59 ChemAxon refractivity 60.4 ChemAxon polarizability 19.11 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 0 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 299143 Specdb::MsMs 299144 Specdb::MsMs 299145 Specdb::MsMs 341068 Specdb::MsMs 341069 Specdb::MsMs 341070 Specdb::CMs 14961 HMDB40257 bland