1.0 2010-04-08 22:14:44 UTC 2025-11-19 02:27:26 UTC FDB020007 Benzyl cinnamate Benzyl cinnamate is isolated from various plant spp.. It is found in Sumatra and Penang benzoin, Peru and tolu balsams, main constituent of copaiba balsam. Can be used as a flavouring agent. 2-Propenoic acid, 3-phenyl-, phenylmethyl ester 3-Phenyl-2-propenoic acid phenylmethyl ester Benzyl (2E)-3-phenyl-2-propenoate Benzyl 3-phenylpropenoate Benzyl alcohol cinnamic ester Benzyl alcohol, cinnamate Benzyl cinnamate Benzyl laquo gammaraquo -phenylacrylate Benzylcinnamate Benzylester kyseliny skoricove Cinnamein Cinnamic acid, benzyl ester FEMA 2142 trans-Cinnamic acid benzyl ester C16H14O2 238.2812 238.099379692 benzyl (2Z)-3-phenylprop-2-enoate benzyl (2Z)-3-phenylprop-2-enoate 103-41-3 O=C(OCC1=CC=CC=C1)\C=C/C1=CC=CC=C1 InChI=1S/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11- NGHOLYJTSCBCGC-QXMHVHEDSA-N belongs to the class of organic compounds known as cinnamic acid esters. These are compound containing an ester derivative of cinnamic acid. Cinnamic acid esters Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Cinnamic acid esters Aromatic homomonocyclic compounds Benzyloxycarbonyls Carbonyl compounds Enoate esters Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Styrenes Alpha,beta-unsaturated carboxylic ester Aromatic homomonocyclic compound Benzenoid Benzyloxycarbonyl Carbonyl group Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Enoate ester Fatty acid ester Fatty acyl Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Styrene logp 4.03 ALOGPS logs -4.85 ALOGPS solubility 3.35e-03 g/l ALOGPS melting_point Mp 37-39° logp 4.24 ChemAxon pka_strongest_basic -6.8 ChemAxon iupac benzyl (2Z)-3-phenylprop-2-enoate ChemAxon average_mass 238.2812 ChemAxon mono_mass 238.099379692 ChemAxon smiles O=C(OCC1=CC=CC=C1)\C=C/C1=CC=CC=C1 ChemAxon formula C16H14O2 ChemAxon inchi InChI=1S/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11- ChemAxon inchikey NGHOLYJTSCBCGC-QXMHVHEDSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 72.44 ChemAxon polarizability 26.73 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 9752 Specdb::CMs 133800 Specdb::CMs 141534 Specdb::MsMs 59457 Specdb::MsMs 59458 Specdb::MsMs 59459 Specdb::MsMs 115596 Specdb::MsMs 115597 Specdb::MsMs 115598 Specdb::MsMs 2312477 Specdb::MsMs 2312478 Specdb::MsMs 2312479 Specdb::MsMs 2652743 Specdb::MsMs 2652744 Specdb::MsMs 2652745 HMDB40286 #<Reference:0x000055ce31ea5150> Cumin Type 1 specific Cuminum cyminum 52462 134.1 134.1 134.1 mg/100 g apricot balsam cherry chocolate floral fruity peach pineapple sweet Allergenic 43 A chemical compound which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. Irritant 1055 Name 936 A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. Perfumery 1206 A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell.