1.0 2010-04-08 22:14:47 UTC 2025-11-19 02:28:02 UTC FDB020089 Calcium galactarate Potential cause of turbidity in mucic acid rich wines. Calcium galactarate is found in alcoholic beverages. Calcium galactarate Calcium mucate C6H8CaO8 248.2 247.9845081 calcium (2R,3S,4R,5S)-2,3,4,5-tetrahydroxyhexanedioate calcium galactarate 28380-80-5 [Ca++].[H]C(O)(C([O-])=O)C([H])(O)C([H])(O)C([H])(O)C([O-])=O InChI=1S/C6H10O8.Ca/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h1-4,7-10H,(H,11,12)(H,13,14);/q;+2/p-2 UGZVNIRNPPEDHM-UHFFFAOYSA-L belongs to the class of organic compounds known as glucuronic acid derivatives. Glucuronic acid derivatives are compounds containing a glucuronic acid moiety (or a derivative), which consists of a glucose moiety with the C6 carbon oxidized to a carboxylic acid. Glucuronic acid derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic acyclic compounds Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acid salts Carboxylic acids Dicarboxylic acids and derivatives Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Medium-chain hydroxy acids and derivatives Monosaccharides Organic calcium salts Organic oxides Polyols Secondary alcohols Alcohol Aliphatic acyclic compound Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid salt Dicarboxylic acid or derivatives Fatty acid Fatty acyl Glucuronic acid or derivatives Hydrocarbon derivative Hydroxy acid Hydroxy fatty acid Medium-chain fatty acid Medium-chain hydroxy acid Monosaccharide Organic calcium salt Organic oxide Organic salt Polyol Secondary alcohol logp -0.78 ALOGPS logs -0.53 ALOGPS solubility 9.01e+01 g/l ALOGPS melting_point Mp 213° logp -3.1 ChemAxon pka_strongest_acidic 2.83 ChemAxon pka_strongest_basic -3.7 ChemAxon iupac calcium (2R,3S,4R,5S)-2,3,4,5-tetrahydroxyhexanedioate ChemAxon average_mass 248.2 ChemAxon mono_mass 247.9845081 ChemAxon smiles [Ca++].[H]C(O)(C([O-])=O)C([H])(O)C([H])(O)C([H])(O)C([O-])=O ChemAxon formula C6H8CaO8 ChemAxon inchi InChI=1S/C6H10O8.Ca/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h1-4,7-10H,(H,11,12)(H,13,14);/q;+2/p-2 ChemAxon inchikey UGZVNIRNPPEDHM-UHFFFAOYSA-L ChemAxon polar_surface_area 161.18 ChemAxon refractivity 59.81 ChemAxon polarizability 16.18 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 8 ChemAxon donor_count 4 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1320853 Specdb::MsMs 1320854 Specdb::MsMs 1320855 Specdb::MsMs 1435276 Specdb::MsMs 1435277 Specdb::MsMs 1435278 Alcoholic beverages Unknown generic