1.0 2010-04-08 22:14:47 UTC 2025-11-19 02:28:04 UTC FDB020094 (±)-Glycerol 1-monophosphate Mn salt (1:1) Dietary supplement Glycerol, Dihydrogen Phosphate, Manganese(2+) Salt (1:1) Manganese glycerophosphate Manganese(2+) glycerol dihydrogen phosphate (1:1) C3H7MnO6P 224.9959 224.936074104 manganese(2+) ion 3-(phosphonatooxy)propane-1,2-diol manganese(2+) ion glycerol 1-phosphate 1320-46-3 [Mn++].OCC(O)COP([O-])([O-])=O InChI=1S/C3H9O6P.Mn/c4-1-3(5)2-9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2 CQQGLXZHXDHSJD-UHFFFAOYSA-L belongs to the class of organic compounds known as glycerophosphates. Glycerophosphates are compounds containing a glycerol linked to a phosphate group. Glycerophosphates Organic compounds Lipids and lipid-like molecules Glycerophospholipids Glycerophosphates Aliphatic acyclic compounds 1,2-diols Alkyl phosphates Hydrocarbon derivatives Organic oxides Organic transition metal salts Primary alcohols Secondary alcohols 1,2-diol Alcohol Aliphatic acyclic compound Alkyl phosphate Hydrocarbon derivative Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organic salt Organic transition metal salt Organooxygen compound Phosphoric acid ester Primary alcohol Secondary alcohol Sn-glycerol-3-phosphate logp -1.15 ALOGPS logs -0.69 ALOGPS solubility 5.63e+01 g/l ALOGPS logp -2 ChemAxon pka_strongest_acidic 1.51 ChemAxon pka_strongest_basic -3 ChemAxon iupac manganese(2+) ion 3-(phosphonatooxy)propane-1,2-diol ChemAxon average_mass 224.9959 ChemAxon mono_mass 224.936074104 ChemAxon smiles [Mn++].OCC(O)COP([O-])([O-])=O ChemAxon formula C3H7MnO6P ChemAxon inchi InChI=1S/C3H9O6P.Mn/c4-1-3(5)2-9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2 ChemAxon inchikey CQQGLXZHXDHSJD-UHFFFAOYSA-L ChemAxon polar_surface_area 112.88 ChemAxon refractivity 29.15 ChemAxon polarizability 12.93 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 5 ChemAxon donor_count 2 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 11935 Specdb::MsMs 292279 Specdb::MsMs 292280 Specdb::MsMs 292281 Specdb::MsMs 332434 Specdb::MsMs 332435 Specdb::MsMs 332436 HMDB40364