1.0 2010-04-08 22:14:51 UTC 2018-05-29 01:45:14 UTC FDB020167 Metatartaric acid It is used to stabilise fine wines by inhibiting potassium bitartrate crystal formn. E 353 C4H6O6 150.0868 150.016437924 2-{5-[carboxy(hydroxy)methyl]-3,6-dioxo-1,4-dioxan-2-yl}-2-hydroxyacetic acid {5-[carboxy(hydroxy)methyl]-3,6-dioxo-1,4-dioxan-2-yl}(hydroxy)acetic acid 39469-81-3 O[C@H]([C@@H](O)C(O)=O)C(O)=O InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 FEWJPZIEWOKRBE-JCYAYHJZSA-N belongs to the class of organic compounds known as tetracarboxylic acids and derivatives. These are carboxylic acids containing exactly four carboxyl groups. Tetracarboxylic acids and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Tetracarboxylic acids and derivatives Aliphatic heteromonocyclic compounds 1,4-dioxanes Alpha hydroxy acids and derivatives Carbonyl compounds Carboxylic acid esters Carboxylic acids Hydrocarbon derivatives Lactones Organic oxides Oxacyclic compounds Secondary alcohols Alcohol Aliphatic heteromonocyclic compound Alpha-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid ester Hydrocarbon derivative Hydroxy acid Lactone Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Para-dioxane Secondary alcohol Tetracarboxylic acid or derivatives logp -2.3 ChemAxon pka_strongest_acidic 2.54 ChemAxon pka_strongest_basic -4.3 ChemAxon iupac 2-{5-[carboxy(hydroxy)methyl]-3,6-dioxo-1,4-dioxan-2-yl}-2-hydroxyacetic acid ChemAxon average_mass 150.0868 ChemAxon mono_mass 150.016437924 ChemAxon smiles O[C@H]([C@@H](O)C(O)=O)C(O)=O ChemAxon formula C4H6O6 ChemAxon inchi InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 ChemAxon inchikey FEWJPZIEWOKRBE-JCYAYHJZSA-N ChemAxon polar_surface_area 167.66 ChemAxon refractivity 45.44 ChemAxon polarizability 20.46 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 8 ChemAxon donor_count 4 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon