1.0 2010-04-08 22:14:58 UTC 2025-11-19 02:30:02 UTC FDB020352 Urea phosphate salt It is used in animal feeds Calmuril Carbamido-orthophosphat Nubral Phosphoric acid urea salt Rea-lo Urea orthophosphate Urea phosphate Urea phosphate (1:1) Urea phosphate salt Urea phosphoric acid Urea rock phosphate Urea, phosphate (1:1) CH7N2O5P 158.0504 158.009257856 phosphoric acid; urea phosphoric acid; urea 4861-19-2 NC(N)=O.OP(O)(O)=O InChI=1S/CH4N2O.H3O4P/c2-1(3)4;1-5(2,3)4/h(H4,2,3,4);(H3,1,2,3,4) DZHMRSPXDUUJER-UHFFFAOYSA-N belongs to the class of organic compounds known as organic phosphoric acids and derivatives. These are organic compounds containing phosphoric acid or a derivative thereof. Organic phosphoric acids and derivatives Organic compounds Organic acids and derivatives Organic phosphoric acids and derivatives Aliphatic acyclic compounds Carbonyl compounds Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Ureas Aliphatic acyclic compound Carbonic acid derivative Carbonyl group Hydrocarbon derivative Organic nitrogen compound Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organonitrogen compound Organooxygen compound Organopnictogen compound Urea melting_point Mp 118-121° logp -1 ChemAxon pka_strongest_acidic 1.8 ChemAxon iupac phosphoric acid; urea ChemAxon average_mass 158.0504 ChemAxon mono_mass 158.009257856 ChemAxon smiles NC(N)=O.OP(O)(O)=O ChemAxon formula CH7N2O5P ChemAxon inchi InChI=1S/CH4N2O.H3O4P/c2-1(3)4;1-5(2,3)4/h(H4,2,3,4);(H3,1,2,3,4) ChemAxon inchikey DZHMRSPXDUUJER-UHFFFAOYSA-N ChemAxon polar_surface_area 77.76 ChemAxon refractivity 14.65 ChemAxon polarizability 5.81 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon HMDB40574