1.0 2010-04-08 22:14:58 UTC 2025-11-19 02:30:10 UTC FDB020356 (±)-5-Heptyldihydro-2(3H)-furanone Flavouring ingredient C11H20O2 184.2753 184.146329884 5-heptyloxolan-2-one 5-heptyldihydro-2(3H)-furanone CCCCCCCC1CCC(=O)O1 InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3 PHXATPHONSXBIL-UHFFFAOYSA-N belongs to the class of organic compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. Gamma butyrolactones Organic compounds Organoheterocyclic compounds Lactones Gamma butyrolactones Aliphatic heteromonocyclic compounds Carbonyl compounds Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Tetrahydrofurans Aliphatic heteromonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Gamma butyrolactone Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Tetrahydrofuran Lactones logp 3.74 ALOGPS logs -3.58 ALOGPS solubility 4.80e-02 g/l ALOGPS logp 3.31 ChemAxon pka_strongest_basic -7 ChemAxon iupac 5-heptyloxolan-2-one ChemAxon average_mass 184.2753 ChemAxon mono_mass 184.146329884 ChemAxon smiles CCCCCCCC1CCC(=O)O1 ChemAxon formula C11H20O2 ChemAxon inchi InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3 ChemAxon inchikey PHXATPHONSXBIL-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 52.26 ChemAxon polarizability 22.5 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 7892 Specdb::MsIr 7893 Specdb::CMs 3019 Specdb::CMs 27364 Specdb::CMs 29061 Specdb::CMs 29263 Specdb::CMs 29333 Specdb::CMs 101956 Specdb::CMs 101957 Specdb::CMs 101958 Specdb::CMs 101959 Specdb::CMs 137840 Specdb::CMs 145574 Specdb::MsMs 11483 Specdb::MsMs 11484 Specdb::MsMs 11485 Specdb::MsMs 18155 Specdb::MsMs 18156 Specdb::MsMs 18157 Specdb::MsMs 3059344 Specdb::MsMs 3059345 Specdb::MsMs 3059346 Specdb::MsMs 3107078 Specdb::MsMs 3107079 Specdb::MsMs 3107080 HMDB38311 #<Reference:0x000055ce327b80a8>