1.0 2010-04-08 22:15:01 UTC 2025-11-19 02:31:43 UTC FDB020431 (xi)-(Z)-5-(3-Hexenyl)dihydro-2(3H)-furanone Constituent of peppermint oil. (xi)-(Z)-5-(3-Hexenyl)dihydro-2(3H)-furanone is found in herbs and spices. C10H16O2 168.2328 168.115029756 5-[(3Z)-hex-3-en-1-yl]oxolan-2-one 5-[(3Z)-hex-3-en-1-yl]oxolan-2-one CC\C=C/CCC1CCC(=O)O1 InChI=1S/C10H16O2/c1-2-3-4-5-6-9-7-8-10(11)12-9/h3-4,9H,2,5-8H2,1H3/b4-3- NKNGVPNCSFZRSM-ARJAWSKDSA-N belongs to the class of organic compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. Gamma butyrolactones Organic compounds Organoheterocyclic compounds Lactones Gamma butyrolactones Aliphatic heteromonocyclic compounds Carbonyl compounds Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Tetrahydrofurans Aliphatic heteromonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Gamma butyrolactone Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Tetrahydrofuran logp 2.99 ALOGPS logs -2.69 ALOGPS solubility 3.40e-01 g/l ALOGPS logp 2.51 ChemAxon pka_strongest_basic -7 ChemAxon iupac 5-[(3Z)-hex-3-en-1-yl]oxolan-2-one ChemAxon average_mass 168.2328 ChemAxon mono_mass 168.115029756 ChemAxon smiles CC\C=C/CCC1CCC(=O)O1 ChemAxon formula C10H16O2 ChemAxon inchi InChI=1S/C10H16O2/c1-2-3-4-5-6-9-7-8-10(11)12-9/h3-4,9H,2,5-8H2,1H3/b4-3- ChemAxon inchikey NKNGVPNCSFZRSM-ARJAWSKDSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 48.77 ChemAxon polarizability 19.13 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 309031 Specdb::MsMs 309032 Specdb::MsMs 309033 Specdb::MsMs 353362 Specdb::MsMs 353363 Specdb::MsMs 353364 Specdb::MsMs 2427517 Specdb::MsMs 2427518 Specdb::MsMs 2427519 Specdb::MsMs 2510797 Specdb::MsMs 2510798 Specdb::MsMs 2510799 Specdb::CMs 19362 Specdb::CMs 161730 Specdb::MsIr 9055 Specdb::MsIr 9056 HMDB0040639 Herbs and Spices Unknown generic