1.0 2010-04-08 22:15:04 UTC 2025-11-19 02:32:16 UTC FDB020508 7-Epi-12-hydroxyjasmonic acid 7-epi-12-hydroxyjasmonic acid, also known as (+)-12-hydroxy-7-isojasmonate, is a member of the class of compounds known as jasmonic acids. Jasmonic acids are lipids containing or derived from a jasmonic acid, with a structure characterized by the presence of an alkene chain linked to a 2-(3-oxocyclopentyl)acetic acid moiety. Thus, 7-epi-12-hydroxyjasmonic acid is considered to be an octadecanoid lipid molecule. 7-epi-12-hydroxyjasmonic acid is slightly soluble (in water) and a weakly acidic compound (based on its pKa). 7-epi-12-hydroxyjasmonic acid can be synthesized from (+)-7-isojasmonic acid. 7-epi-12-hydroxyjasmonic acid can also be synthesized into N-[(+)-12-hydroxy-7-isojasmonyl]-L-isoleucine and methyl tuberonate. 7-epi-12-hydroxyjasmonic acid can be found in potato, which makes 7-epi-12-hydroxyjasmonic acid a potential biomarker for the consumption of this food product. 7-Epi-12-hydroxyjasmonic acid Tuberonic acid C12H18O4 226.2689 226.120509064 2-[(1R,2S)-2-[(2Z)-5-hydroxypent-2-en-1-yl]-3-oxocyclopentyl]acetic acid tuberonic acid 124649-26-9 OCC\C=C/C[C@H]1[C@@H](CC(O)=O)CCC1=O InChI=1S/C12H18O4/c13-7-3-1-2-4-10-9(8-12(15)16)5-6-11(10)14/h1-2,9-10,13H,3-8H2,(H,15,16)/b2-1-/t9-,10+/m1/s1 RZGFUGXQKMEMOO-SZXTZRQCSA-N belongs to the class of organic compounds known as jasmonic acids. These are lipids containing or derived from a jasmonic acid, with a structure characterized by the presence of an alkene chain linked to a 2-(3-oxocyclopentyl)acetic acid moiety. Jasmonic acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Lineolic acids and derivatives Aliphatic homomonocyclic compounds Carboxylic acids Cyclic ketones Fatty alcohols Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Primary alcohols Alcohol Aliphatic homomonocyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Cyclic ketone Fatty alcohol Hydrocarbon derivative Jasmonic acid Ketone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Primary alcohol Jasmonic acids logp 0.87 ALOGPS logs -2.25 ALOGPS solubility 1.28e+00 g/l ALOGPS logp 0.98 ChemAxon pka_strongest_acidic 4.46 ChemAxon pka_strongest_basic -2 ChemAxon iupac 2-[(1R,2S)-2-[(2Z)-5-hydroxypent-2-en-1-yl]-3-oxocyclopentyl]acetic acid ChemAxon average_mass 226.2689 ChemAxon mono_mass 226.120509064 ChemAxon smiles OCC\C=C/C[C@H]1[C@@H](CC(O)=O)CCC1=O ChemAxon formula C12H18O4 ChemAxon inchi InChI=1S/C12H18O4/c13-7-3-1-2-4-10-9(8-12(15)16)5-6-11(10)14/h1-2,9-10,13H,3-8H2,(H,15,16)/b2-1-/t9-,10+/m1/s1 ChemAxon inchikey RZGFUGXQKMEMOO-SZXTZRQCSA-N ChemAxon polar_surface_area 74.6 ChemAxon refractivity 60.49 ChemAxon polarizability 23.9 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1309360 Specdb::MsMs 1309361 Specdb::MsMs 1309362 Specdb::MsMs 1423861 Specdb::MsMs 1423862 Specdb::MsMs 1423863 Specdb::MsMs 3606553 Specdb::MsMs 3606554 Specdb::MsMs 3606555 Specdb::MsMs 3606556 Specdb::MsMs 3606557 Specdb::MsMs 3606558 Potato Type 1 specific Solanum tuberosum 4113