1.0 2010-04-08 22:15:16 UTC 2025-11-19 02:33:47 UTC FDB020791 gamma-Eudesmol Gamma-eudesmol, also known as γ-eudesmol, is a member of the class of compounds known as eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids. Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids are sesquiterpenoids with a structure based on the eudesmane skeleton. Gamma-eudesmol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). Gamma-eudesmol is a sweet and waxy tasting compound and can be found in a number of food items such as rosemary, ginkgo nuts, mango, and common thyme, which makes gamma-eudesmol a potential biomarker for the consumption of these food products. «gamma»-eudesmol «gamma»-eudesmole 1,8-naphthalenedicarboxylic Acid, Dipotassium Salt g-Eudesmol Uncineol C15H26O 222.3663 222.198365454 2-(4a,8-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-2-yl)propan-2-ol 2-(4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)propan-2-ol 1209-71-8 CC1=C2CC(CCC2(C)CCC1)C(C)(C)O InChI=1S/C15H26O/c1-11-6-5-8-15(4)9-7-12(10-13(11)15)14(2,3)16/h12,16H,5-10H2,1-4H3 WMOPMQRJLLIEJV-UHFFFAOYSA-N belongs to the class of organic compounds known as eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids. These are sesquiterpenoids with a structure based on the eudesmane skeleton. Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Sesquiterpenoids Aliphatic homopolycyclic compounds Hydrocarbon derivatives Tertiary alcohols Alcohol Aliphatic homopolycyclic compound Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoid Hydrocarbon derivative Organic oxygen compound Organooxygen compound Tertiary alcohol a sesquiterpenoid logp 4.55 ALOGPS logs -3.43 ALOGPS solubility 8.19e-02 g/l ALOGPS logp 3.43 ChemAxon pka_strongest_acidic 19.35 ChemAxon pka_strongest_basic -0.9 ChemAxon iupac 2-(4a,8-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-2-yl)propan-2-ol ChemAxon average_mass 222.3663 ChemAxon mono_mass 222.198365454 ChemAxon smiles CC1=C2CC(CCC2(C)CCC1)C(C)(C)O ChemAxon formula C15H26O ChemAxon inchi InChI=1S/C15H26O/c1-11-6-5-8-15(4)9-7-12(10-13(11)15)14(2,3)16/h12,16H,5-10H2,1-4H3 ChemAxon inchikey WMOPMQRJLLIEJV-UHFFFAOYSA-N ChemAxon polar_surface_area 20.23 ChemAxon refractivity 69.17 ChemAxon polarizability 27.61 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 3606598 Specdb::MsMs 3606599 Specdb::MsMs 3606600 Specdb::MsMs 3606601 Specdb::MsMs 3606602 Specdb::MsMs 3606603 Common thyme Type 1 specific Thymus vulgaris 49992 Ginger Type 1 specific Zingiber officinale 94328 5.85 5.85 5.85 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 Mango Type 1 specific Mangifera indica 29780 Pineapple Type 1 specific Ananas comosus 4615 Rosemary Type 1 specific Rosmarinus officinalis 39367 1.95 1.95 1.95 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 sweet wax waxy