1.0 2010-04-08 22:15:28 UTC 2025-11-19 02:35:31 UTC FDB021093 2-O-(E-p-Hydroxycinnamoyl)-(x)-glyceric acid Constituent of Eleusine coracana (finger millet). 2-O-(E-p-Hydroxycinnamoyl)-(x)-glyceric acid is found in cereals and cereal products. 2-O-(E-p-Hydroxycinnamoyl)-(x)-2,3-Dihydroxypropanoic acid 2-O-(E-p-Hydroxycinnamoyl)-(x)-glyceric acid C12H12O6 252.2201 252.063388116 3-hydroxy-2-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}propanoic acid 3-hydroxy-2-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}propanoic acid 154639-28-8 OCC(OC(=O)\C=C\C1=CC=C(O)C=C1)C(O)=O InChI=1S/C12H12O6/c13-7-10(12(16)17)18-11(15)6-3-8-1-4-9(14)5-2-8/h1-6,10,13-14H,7H2,(H,16,17)/b6-3+ UYRFKSDZFBCTMU-ZZXKWVIFSA-N belongs to the class of organic compounds known as coumaric acid esters. These are aromatic compounds containing an ester derivative of coumaric acid. Coumaric acid esters Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Cinnamic acid esters Coumaric acids and derivatives Dicarboxylic acids and derivatives Enoate esters Fatty acid esters Hydrocarbon derivatives Monosaccharides Organic oxides Primary alcohols Styrenes Sugar acids and derivatives 1-hydroxy-2-unsubstituted benzenoid Alcohol Alpha,beta-unsaturated carboxylic ester Aromatic homomonocyclic compound Benzenoid Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Coumaric acid ester Coumaric acid or derivatives Dicarboxylic acid or derivatives Enoate ester Fatty acid ester Fatty acyl Glyceric_acid Hydrocarbon derivative Hydroxy acid Monocyclic benzene moiety Monosaccharide Organic oxide Organic oxygen compound Organooxygen compound Phenol Primary alcohol Styrene logp 1.67 ALOGPS logs -2.80 ALOGPS solubility 3.96e-01 g/l ALOGPS logp 1.21 ChemAxon pka_strongest_acidic 3.42 ChemAxon pka_strongest_basic -3.1 ChemAxon iupac 3-hydroxy-2-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}propanoic acid ChemAxon average_mass 252.2201 ChemAxon mono_mass 252.063388116 ChemAxon smiles OCC(OC(=O)\C=C\C1=CC=C(O)C=C1)C(O)=O ChemAxon formula C12H12O6 ChemAxon inchi InChI=1S/C12H12O6/c13-7-10(12(16)17)18-11(15)6-3-8-1-4-9(14)5-2-8/h1-6,10,13-14H,7H2,(H,16,17)/b6-3+ ChemAxon inchikey UYRFKSDZFBCTMU-ZZXKWVIFSA-N ChemAxon polar_surface_area 104.06 ChemAxon refractivity 61.93 ChemAxon polarizability 24.41 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 10426 Specdb::CMs 47171 Specdb::CMs 132726 Specdb::CMs 140460 Specdb::MsMs 288997 Specdb::MsMs 288998 Specdb::MsMs 288999 Specdb::MsMs 328291 Specdb::MsMs 328292 Specdb::MsMs 328293 Specdb::MsMs 2264781 Specdb::MsMs 2264782 Specdb::MsMs 2264783 Specdb::MsMs 3073875 Specdb::MsMs 3073876 Specdb::MsMs 3073877 HMDB0041195 Breakfast cereal Type 2 specific Cereals and cereal products Unknown generic