1.0 2010-04-08 22:15:36 UTC 2019-11-26 03:20:10 UTC FDB021298 Alectrol Isolated from the roots of Vigna unguiculata (genuine host plant for Alectra subspecies) Strigolactones are plant hormones that have been implicated in inhibition of shoot branching. Strigolactones are carotenoid-derived and trigger germination of parasitic plant seeds (for example striga from which they gained their name) and stimulate symbiotic mycorrhizal fungi. Strigolactones contain a labile ether bond that is easily hydrolysed in the rhizosphere meaning that there is a large concentration gradient between areas near the root and those further away. Alectrol is found in pulses and cowpea. C19H22O6 346.3744 346.141638436 5-{[(3Z)-8a-hydroxy-8,8-dimethyl-2-oxo-2H,3H,3aH,5H,6H,7H,8H,8aH,8bH-indeno[1,2-b]furan-3-ylidene]methoxy}-3-methyl-2,5-dihydrofuran-2-one 5-{[(3Z)-8a-hydroxy-8,8-dimethyl-2-oxo-3aH,5H,6H,7H,8bH-indeno[1,2-b]furan-3-ylidene]methoxy}-3-methyl-5H-furan-2-one 143572-84-3 CC1=CC(O\C=C2\C3C=C4CCCC(C)(C)C4(O)C3OC2=O)OC1=O InChI=1S/C19H22O6/c1-10-7-14(24-16(10)20)23-9-13-12-8-11-5-4-6-18(2,3)19(11,22)15(12)25-17(13)21/h7-9,12,14-15,22H,4-6H2,1-3H3/b13-9- FIKOOQXJBAJJSE-LCYFTJDESA-N belongs to the class of organic compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. Gamma butyrolactones Organic compounds Organoheterocyclic compounds Lactones Gamma butyrolactones Aliphatic heteropolycyclic compounds Acetals Butenolides Carbonyl compounds Cyclic alcohols and derivatives Dicarboxylic acids and derivatives Enoate esters Hydrocarbon derivatives Organic oxides Oxacyclic compounds Tertiary alcohols Tetrahydrofurans Vinylogous esters 2-furanone Acetal Alcohol Aliphatic heteropolycyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Cyclic alcohol Dicarboxylic acid or derivatives Dihydrofuran Enoate ester Gamma butyrolactone Hydrocarbon derivative Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Tertiary alcohol Tetrahydrofuran Vinylogous ester logp 1.90 ALOGPS logs -3.23 ALOGPS solubility 2.03e-01 g/l ALOGPS logp 2.77 ChemAxon pka_strongest_acidic 2.95 ChemAxon pka_strongest_basic -3.7 ChemAxon iupac 5-{[(3Z)-8a-hydroxy-8,8-dimethyl-2-oxo-2H,3H,3aH,5H,6H,7H,8H,8aH,8bH-indeno[1,2-b]furan-3-ylidene]methoxy}-3-methyl-2,5-dihydrofuran-2-one ChemAxon average_mass 346.3744 ChemAxon mono_mass 346.141638436 ChemAxon smiles CC1=CC(O\C=C2\C3C=C4CCCC(C)(C)C4(O)C3OC2=O)OC1=O ChemAxon formula C19H22O6 ChemAxon inchi InChI=1S/C19H22O6/c1-10-7-14(24-16(10)20)23-9-13-12-8-11-5-4-6-18(2,3)19(11,22)15(12)25-17(13)21/h7-9,12,14-15,22H,4-6H2,1-3H3/b13-9- ChemAxon inchikey FIKOOQXJBAJJSE-LCYFTJDESA-N ChemAxon polar_surface_area 82.06 ChemAxon refractivity 88.84 ChemAxon polarizability 35.71 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 17400 Specdb::CMs 47281 Specdb::CMs 160440 Specdb::MsMs 304453 Specdb::MsMs 304454 Specdb::MsMs 304455 Specdb::MsMs 347671 Specdb::MsMs 347672 Specdb::MsMs 347673 Specdb::MsMs 2269606 Specdb::MsMs 2269607 Specdb::MsMs 2269608 Specdb::MsMs 3072066 Specdb::MsMs 3072067 Specdb::MsMs 3072068 HMDB41372 #<Reference:0x000055ce31c1cbe0> Cowpea Type 1 specific Vigna unguiculata 3917 Pulses Unknown generic