1.0 2011-02-09 00:33:13 UTC 2025-11-19 02:38:43 UTC FDB021621 C18:1, n-9 Elaidic acid, also known as trans-9-octadecenoic acid or elaidate, is a member of the class of compounds known as long-chain fatty acids. Long-chain fatty acids are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Thus, elaidic acid is considered to be a fatty acid lipid molecule. Elaidic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Elaidic acid can be synthesized from trans-octadec-9-ene. Elaidic acid is also a parent compound for other transformation products, including but not limited to, ricinelaidic acid, hexadecyl elaidate, and cystodytin H. Elaidic acid can be found in fats and oils and pomegranate, which makes elaidic acid a potential biomarker for the consumption of these food products. Elaidic acid can be found primarily in blood and feces, as well as in human adipose tissue and fibroblasts tissues. Elaidic acid is the organic compound with the formula CH3(CH2)7CHCH(CH2)7CO2H. Classified as an unsaturated trans fatty acid, it is a colorless oily solid. This compound has attracted attention because it is a major trans fat found in hydrogenated vegetable oils, and trans fats are implicated in heart disease . C18H34O2 282.4614 282.255880332 (9E)-octadec-9-enoic acid elaidic acid CCCCCCCC\C=C\CCCCCCCC(O)=O InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ ZQPPMHVWECSIRJ-MDZDMXLPSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Monounsaturated fatty acids Unsaturated fatty acids Unsaturated fatty acids octadec-9-enoic acid logp 7.68 ALOGPS logs -6.37 ALOGPS solubility 1.21e-04 g/l ALOGPS logp 6.78 ChemAxon pka_strongest_acidic 4.99 ChemAxon iupac (9E)-octadec-9-enoic acid ChemAxon average_mass 282.4614 ChemAxon mono_mass 282.255880332 ChemAxon smiles CCCCCCCC\C=C\CCCCCCCC(O)=O ChemAxon formula C18H34O2 ChemAxon inchi InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ ChemAxon inchikey ZQPPMHVWECSIRJ-MDZDMXLPSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 87.4 ChemAxon polarizability 37.64 ChemAxon rotatable_bond_count 15 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1370 Specdb::NmrOneD 1425 Specdb::NmrOneD 2163 Specdb::NmrOneD 2851 Specdb::EiMs 809 Specdb::CMs 1881 Specdb::CMs 23176 Specdb::CMs 31169 Specdb::CMs 32369 Specdb::CMs 37631 Specdb::CMs 151247 Specdb::CMs 1066884 Specdb::MsMs 84009 Specdb::MsMs 84010 Specdb::MsMs 84011 Specdb::MsMs 145758 Specdb::MsMs 145759 Specdb::MsMs 145760 Specdb::MsMs 2235923 Specdb::MsMs 2237470 Specdb::MsMs 2239502 Specdb::MsMs 2469820 Specdb::MsMs 2469821 Specdb::MsMs 2469822 Specdb::MsMs 2492333 Specdb::MsMs 2492334 Specdb::MsMs 2492335 HMDB0000573 Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 56.0 56.0 56.0 mg/100 g Allium Type 1 specific Allium 4678 16.0 28.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 26700.0 26700.0 26700.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 4822.75 16700.0 650.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 2070.0 2070.0 2070.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 7770.0 7850.0 7690.0 mg/100 g Apple Type 1 specific Malus pumila 283210 11.833333 21.0 6.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 254.0 610.0 22.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 2.5 15.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 4.0 5.0 2.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 317.0 317.0 317.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 469.0 469.0 469.0 mg/100 g Avocado Type 1 specific Persea americana 3435 11300.0 11300.0 11300.0 mg/100 g Baby food Type 2 specific 0.0 0.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 32.0 32.0 32.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 229.5 255.0 204.0 mg/100 g Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 4438.333333 7070.0 0.0 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 38.0 84.0 25.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 19500.0 19500.0 19500.0 mg/100 g Breakfast cereal Type 2 specific 837.666667 1890.0 259.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 11.333333 33.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 14.25 15.0 14.0 mg/100 g Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Butter Type 2 specific 19450.0 20200.0 18700.0 mg/100 g Buttermilk Type 2 specific 111.0 111.0 111.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 5.166667 7.0 2.0 mg/100 g Casein Type 2 specific 320.0 320.0 320.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 26850.0 26900.0 26800.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 74.0 74.0 74.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 853.0 853.0 853.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 4271.638298 11900.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 23.5 26.0 19.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 13.0 13.0 13.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 13.0 13.0 13.0 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 5118.216667 9790.0 89.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 884.0 884.0 884.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 4.5 5.0 4.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 20.0 20.0 20.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 7.0 7.0 7.0 mg/100 g Chocolate Type 2 specific 9244.0 11300.0 5230.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 380.0 380.0 380.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 192.666667 205.0 178.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 2498.888889 12800.0 0.0 mg/100 g Cocoa butter Type 2 specific 32600.0 32600.0 32600.0 mg/100 g Cocoa powder Type 2 specific 3223.333333 7280.0 1130.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 4420.0 5800.0 1960.0 mg/100 g Coffee Type 1 generic Coffea 13442 2.5 15.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 11.666667 48.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 7.6 18.0 0.0 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 4.0 5.0 3.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 78.75 158.0 48.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 5807.666667 13500.0 273.0 mg/100 g Corn Type 1 specific Zea mays 4577 4115.666667 27400.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 17000.0 17000.0 17000.0 mg/100 g Crab Type 1 specific Brachyura 6752 352.666667 618.0 220.0 mg/100 g Cracker Type 2 specific 0.0 0.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 4201.111111 8770.0 2000.0 mg/100 g Crisp bread Type 2 specific 573.6 2280.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.6 3.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 8.0 15.0 2.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 13.0 16.0 10.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.0 0.0 0.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 373.5 747.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 4631.604938 20900.0 0.0 mg/100 g Dried milk Type 2 specific 3060.5 5950.0 171.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 6340.0 19500.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 31.666667 33.0 29.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 4.0 4.0 4.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 33.5 50.0 17.0 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 4955.0 9910.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 574.0 1490.0 51.0 mg/100 g Fish oil Type 1 8140.0 8140.0 8140.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 266.0 266.0 266.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 12785.0 20200.0 5370.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.0 0.0 0.0 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 5519.928571 33100.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 30.0 30.0 30.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 16.0 16.0 16.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 107.75 558.0 6.0 mg/100 g Garfish Type 1 specific Belone belone 129037 410.0 410.0 410.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 14.5 18.0 11.0 mg/100 g Gelatin Type 2 specific 34.0 34.0 34.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 124.0 124.0 124.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 61.0 61.0 61.0 mg/100 g Grape Type 1 specific Vitis 3603 4576.5 18200.0 3.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 32.0 48.0 16.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 8.333333 9.0 7.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 8.5 9.0 8.0 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 14.0 15.0 13.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 2943.333333 3690.0 2560.0 mg/100 g Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 43.0 43.0 43.0 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 43.0 129.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 37800.0 37800.0 37800.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 62.0 62.0 62.0 mg/100 g Hot chocolate Type 2 specific 248.25 393.0 111.0 mg/100 g Ice cream Type 2 specific 1485.0 2250.0 0.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 12.0 12.0 12.0 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 15.0 15.0 15.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 12.0 12.0 12.0 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 799.0 799.0 799.0 mg/100 g Ketchup Type 2 specific 134.5 269.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 7.0 7.0 7.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 337.0 337.0 337.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 38400.0 38400.0 38400.0 mg/100 g Leavening agent Type 2 specific 144.0 576.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 14.0 14.0 14.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 24.0 61.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 126.0 126.0 126.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 58.0 116.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 6.0 9.0 3.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 18.0 18.0 18.0 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 77.5 133.0 22.0 mg/100 g Liquor Type 2 specific 486.571429 3370.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 8.0 8.0 8.0 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 4695.0 6650.0 2740.0 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 16.0 16.0 16.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 62.0 77.0 47.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 99.0 99.0 99.0 mg/100 g Margarine Type 2 specific 17220.0 25900.0 6920.0 mg/100 g Margarine-like spread Type 2 specific 26000.0 26000.0 26000.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 173.333333 390.0 0.0 mg/100 g Marzipan Type 2 specific 17800.0 17800.0 17800.0 mg/100 g Meat bouillon Type 2 specific 705.4 3110.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 386.375 769.0 67.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 1070.0 1070.0 1070.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.0 0.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 325.0 325.0 325.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 94.5 165.0 24.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 19.666667 22.0 16.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 178.0 178.0 178.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 2233.333333 2340.0 2180.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 24000.0 36600.0 11400.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 16.0 16.0 16.0 mg/100 g Olive Type 1 specific Olea europaea 4146 35450.0 73700.0 8050.0 mg/100 g Other animal fat Type 2 specific 39500.0 53500.0 25500.0 mg/100 g Other bread Type 2 specific 854.777778 1480.0 0.0 mg/100 g Other bread product Type 2 specific 130.0 260.0 0.0 mg/100 g Other candy Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 983.333333 2950.0 0.0 mg/100 g Other fermented milk Type 2 specific 788.0 799.0 777.0 mg/100 g Other fish product Type 2 specific 8140.0 8140.0 8140.0 mg/100 g Other fruit product Type 2 specific 1940.0 1940.0 1940.0 mg/100 g Other snack food Type 2 specific 8026.666667 9980.0 6920.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 138.0 138.0 138.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 14.0 14.0 14.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 38.0 38.0 38.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 28.5 57.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 28.0 28.0 28.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 178.333333 304.0 42.0 mg/100 g Pastry Type 2 specific 7936.666667 13200.0 2680.0 mg/100 g Pate Type 2 specific 8600.0 8600.0 8600.0 mg/100 g Peach Type 1 specific Prunus persica 3760 163.0 308.0 60.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 28875.0 44500.0 20000.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 23.5 27.0 20.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 41233.333333 43300.0 40200.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 7.5 12.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Pine nut Type 1 specific Pinus 3337 19500.0 19500.0 19500.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 4.0 12.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 23050.0 23500.0 22600.0 mg/100 g Pizza Type 2 specific 0.0 0.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 119.666667 249.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 6170.0 6170.0 6170.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 2802.5 13100.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 89.0 119.0 27.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 27.0 27.0 27.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 710.0 710.0 710.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 12.0 12.0 12.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 851.0 851.0 851.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 55950.0 58100.0 53800.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 24.0 31.0 15.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 10.5 12.0 9.0 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 97.75 248.0 15.0 mg/100 g Remoulade Type 2 specific 15050.0 19000.0 11100.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 274.428571 705.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 2.5 15.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 9.0 9.0 9.0 mg/100 g Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 45.428571 103.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 154.0 231.0 0.0 mg/100 g Rye bread Type 2 specific 655.117647 1480.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 44650.0 75000.0 14300.0 mg/100 g Salad dressing Type 2 specific 14855.714286 41900.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 1226.666667 2570.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 26.333333 79.0 0.0 mg/100 g Sausage Type 2 specific 8838.235294 20600.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 7.0 7.0 7.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 2270.0 3370.0 1470.0 mg/100 g Semolina Type 2 specific 147.0 147.0 147.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 25666.666667 39300.0 18700.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 109.333333 120.0 98.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 328.0 328.0 328.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 6194.0 21300.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 7.0 7.0 7.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 20.0 21.0 19.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 51.25 83.0 14.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 442.5 885.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 15.0 15.0 15.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 19850.0 22000.0 17700.0 mg/100 g Swede Type 1 specific Brassica napus 3708 12.0 12.0 12.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 47.0 110.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 6.0 6.0 6.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 34300.0 34300.0 34300.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 160.0 160.0 160.0 mg/100 g Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 14300.0 14300.0 14300.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 897.5 2260.0 0.0 mg/100 g Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 65.0 65.0 65.0 mg/100 g True sole Type 1 specific Soleidae 30948 122.0 122.0 122.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 32.0 32.0 32.0 mg/100 g Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 16900.0 22200.0 11600.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 11.0 11.0 11.0 mg/100 g Wheat Type 1 specific Triticum 4564 2050.444444 12500.0 161.0 mg/100 g Wheat bread Type 2 specific 501.388889 1040.0 0.0 mg/100 g Whey Type 2 specific 2118.333333 6000.0 89.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 1380.0 1380.0 1380.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.0 0.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 27.0 27.0 27.0 mg/100 g Yam Type 1 specific Dioscorea 4672 6.0 6.0 6.0 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 9.0 9.0 9.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 14.0 15.0 13.0 mg/100 g Ymer Type 2 specific 616.5 833.0 400.0 mg/100 g Yogurt Type 2 specific 715.6 1710.0 9.0 mg/100 g