1.0 2011-03-17 23:26:01 UTC 2025-11-19 02:38:55 UTC FDB021663 Ukonan D Acetaminophen, also known as tylenol or paracetamol, is a member of the class of compounds known as 1-hydroxy-2-unsubstituted benzenoids. 1-hydroxy-2-unsubstituted benzenoids are phenols that a unsubstituted at the 2-position. Acetaminophen is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Acetaminophen can be synthesized from 4-aminophenol. Acetaminophen is also a parent compound for other transformation products, including but not limited to, acetaminophen glutathione conjugate, 2-methoxyacetaminophen glucuronide, and S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine. Acetaminophen has a bitter taste. Acetaminophen can be found primarily in most biofluids, including urine, saliva, feces, and cerebrospinal fluid (CSF), as well as throughout all human tissues. In humans, acetaminophen is involved in a couple of metabolic pathways, which include acetaminophen action pathway and acetaminophen metabolism pathway. Acetaminophen is formally rated as an unfounded non-carcinogenic (IARC 3) potentially toxic compound. Acetaminophen is a drug which is used for temporary relief of fever, minor aches, and pains. Ukonans; Ukonan D C8H9NO2 151.1626 151.063328537 N-(4-hydroxyphenyl)acetamide acetaminophen 141490-48-4 CC(=O)NC1=CC=C(O)C=C1 InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10) RZVAJINKPMORJF-UHFFFAOYSA-N belongs to the class of organic compounds known as 1-hydroxy-2-unsubstituted benzenoids. These are phenols that are unsubstituted at the 2-position. 1-hydroxy-2-unsubstituted benzenoids Organic compounds Benzenoids Phenols 1-hydroxy-2-unsubstituted benzenoids Aromatic homomonocyclic compounds Benzene and substituted derivatives Carboximidic acids Hydrocarbon derivatives Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds 1-hydroxy-2-unsubstituted benzenoid Aromatic homomonocyclic compound Carboximidic acid Carboximidic acid derivative Hydrocarbon derivative Monocyclic benzene moiety Organic 1,3-dipolar compound Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Propargyl-type 1,3-dipolar organic compound a small molecule acetamides phenols logp 0.51 ALOGPS logs -1.56 ALOGPS solubility 4.15e+00 g/l ALOGPS logp 0.91 ChemAxon pka_strongest_acidic 9.46 ChemAxon pka_strongest_basic -4.4 ChemAxon iupac N-(4-hydroxyphenyl)acetamide ChemAxon average_mass 151.1626 ChemAxon mono_mass 151.063328537 ChemAxon smiles CC(=O)NC1=CC=C(O)C=C1 ChemAxon formula C8H9NO2 ChemAxon inchi InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10) ChemAxon inchikey RZVAJINKPMORJF-UHFFFAOYSA-N ChemAxon polar_surface_area 49.33 ChemAxon refractivity 42.9 ChemAxon polarizability 15.52 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 731 Specdb::MsIr 1381 Specdb::MsIr 1382 Specdb::MsIr 1383 Specdb::NmrTwoD 1701 Specdb::CMs 1301 Specdb::CMs 8768 Specdb::CMs 26864 Specdb::CMs 27405 Specdb::CMs 27419 Specdb::CMs 31356 Specdb::CMs 38150 Specdb::CMs 165569 Specdb::NmrOneD 1761 Specdb::NmrOneD 2079 Specdb::NmrOneD 2773 Specdb::NmrOneD 9702 Specdb::NmrOneD 9703 Specdb::NmrOneD 9704 Specdb::NmrOneD 9705 Specdb::NmrOneD 9706 Specdb::NmrOneD 9707 Specdb::NmrOneD 9708 Specdb::NmrOneD 9709 Specdb::NmrOneD 9710 Specdb::NmrOneD 9711 Specdb::NmrOneD 9712 Specdb::NmrOneD 9713 Specdb::NmrOneD 9714 Specdb::NmrOneD 9715 Specdb::NmrOneD 9716 Specdb::NmrOneD 9717 Specdb::NmrOneD 9718 Specdb::NmrOneD 9719 Specdb::NmrOneD 9720 Specdb::NmrOneD 9721 Specdb::MsMs 1732 Specdb::MsMs 1733 Specdb::MsMs 1734 Specdb::MsMs 5497 Specdb::MsMs 5498 Specdb::MsMs 5499 Specdb::MsMs 261696 Specdb::MsMs 261697 Specdb::MsMs 261698 Specdb::MsMs 281628 Specdb::MsMs 281629 Specdb::MsMs 281630 Specdb::MsMs 435677 Specdb::MsMs 435678 Specdb::MsMs 435679 Specdb::MsMs 435680 Specdb::MsMs 435681 Specdb::MsMs 435682 Specdb::MsMs 435683 Specdb::MsMs 435684 Specdb::MsMs 435685 Specdb::MsMs 435686 Specdb::MsMs 435687 Specdb::MsMs 435688 Specdb::MsMs 435689 HMDB0001859 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Turmeric Type 1 specific Curcuma longa 136217 4.1 4.1 4.1 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823