1.0 2011-03-17 23:27:49 UTC 2025-11-19 02:39:16 UTC FDB021719 7-Epijasmonic acid 7-epijasmonic acid, also known as (+)-epijasmonate, is a member of the class of compounds known as jasmonic acids. Jasmonic acids are lipids containing or derived from a jasmonic acid, with a structure characterized by the presence of an alkene chain linked to a 2-(3-oxocyclopentyl)acetic acid moiety. Thus, 7-epijasmonic acid is considered to be an octadecanoid lipid molecule. 7-epijasmonic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). 7-epijasmonic acid can be found in a number of food items such as broad bean, flaxseed, corn, and eggplant, which makes 7-epijasmonic acid a potential biomarker for the consumption of these food products. (+)-7-Epijasmonic acid (+)-7-Isojasmonic acid 7-Epijasmonic acid 7-Iso-jasmonic acid 7-Isojasmonic acid Jasmonic acid; 7-Epimer C12H18O3 210.2695 210.125594442 2-[(1R,2S)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl]acetic acid (+)-7-iso-jasmonic acid CC\C=C/C[C@H]1[C@@H](CC(O)=O)CCC1=O InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10+/m1/s1 ZNJFBWYDHIGLCU-QKMQQOOLSA-N belongs to the class of organic compounds known as jasmonic acids. These are lipids containing or derived from a jasmonic acid, with a structure characterized by the presence of an alkene chain linked to a 2-(3-oxocyclopentyl)acetic acid moiety. Jasmonic acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Lineolic acids and derivatives Aliphatic homomonocyclic compounds Carboxylic acids Cyclic ketones Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic homomonocyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Cyclic ketone Hydrocarbon derivative Jasmonic acid Ketone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Jasmonic acids Jasmonic acids oxo carboxylic acid oxylipin liquid logp 2.36 ALOGPS logs -2.36 ALOGPS solubility 9.20e-01 g/l ALOGPS logp 2.41 ChemAxon pka_strongest_acidic 4.71 ChemAxon pka_strongest_basic -7.4 ChemAxon iupac 2-[(1R,2S)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl]acetic acid ChemAxon average_mass 210.2695 ChemAxon mono_mass 210.125594442 ChemAxon smiles CC\C=C/C[C@H]1[C@@H](CC(O)=O)CCC1=O ChemAxon formula C12H18O3 ChemAxon inchi InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10+/m1/s1 ChemAxon inchikey ZNJFBWYDHIGLCU-QKMQQOOLSA-N ChemAxon polar_surface_area 54.37 ChemAxon refractivity 58.56 ChemAxon polarizability 23.25 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1247509 Specdb::MsMs 1247510 Specdb::MsMs 1247511 Specdb::MsMs 1362838 Specdb::MsMs 1362839 Specdb::MsMs 1362840 Specdb::MsMs 3606811 Specdb::MsMs 3606812 Specdb::MsMs 3606813 Specdb::MsMs 3606814 Specdb::MsMs 3606815 Specdb::MsMs 3606816 18435 Broad bean Type 1 specific Vicia faba 3906 Common wheat Type 1 specific Triticum aestivum 4565 Corn Type 1 specific Zea mays 4577 Eggplant Type 1 specific Solanum melongena 4111 Flaxseed Type 1 specific Linum usitatissimum 4006