1.0 2011-03-17 23:28:57 UTC 2025-11-19 02:39:26 UTC FDB021752 cis-Ferulic acid Ferulic acid, also known as ferulate, is a member of the class of compounds known as hydroxycinnamic acids. Hydroxycinnamic acids are compounds containing an cinnamic acid where the benzene ring is hydroxylated. Ferulic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Ferulic acid can be synthesized from cis-cinnamic acid. Ferulic acid is also a parent compound for other transformation products, including but not limited to, (2S,3S)-cis-fertaric acid, (2R,3R)-cis-fertaric acid, and (Z)-4-hydroxy-3-methoxycinnamoylagmatine. Ferulic acid can be found in a number of food items such as rape, ginger, redcurrant, and spinach, which makes ferulic acid a potential biomarker for the consumption of these food products. Ferulic acid is a hydroxycinnamic acid, a type of organic compound. It is an abundant phenolic phytochemical found in plant cell walls, covalently bonded as side chains to molecules such as arabinoxylans. As a component of lignin, ferulic acid is a precursor in the manufacture of other aromatic compounds. The name is derived from the genus Ferula, referring to the giant fennel (Ferula communis) . (Z)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic acid (Z)-Ferulic acid cis-Ferulic acid C10H10O4 194.184 194.057908808 (2Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid (2Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid 1014-83-1 [H]\C(=C(/[H])C1=CC(OC)=C(O)C=C1)C(O)=O InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3- KSEBMYQBYZTDHS-HYXAFXHYSA-N belongs to the class of organic compounds known as hydroxycinnamic acids. Hydroxycinnamic acids are compounds containing an cinnamic acid where the benzene ring is hydroxylated. Hydroxycinnamic acids Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids and derivatives Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds Styrenes 1-hydroxy-2-unsubstituted benzenoid Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Coumaric acid or derivatives Ether Hydrocarbon derivative Hydroxycinnamic acid Methoxybenzene Methoxyphenol Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Phenol ether Phenoxy compound Styrene ferulic acids logp 1.58 ALOGPS logs -2.33 ALOGPS solubility 9.06e-01 g/l ALOGPS logp 1.67 ChemAxon pka_strongest_acidic 3.27 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac (2Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid ChemAxon average_mass 194.184 ChemAxon mono_mass 194.057908808 ChemAxon smiles [H]\C(=C(/[H])C1=CC(OC)=C(O)C=C1)C(O)=O ChemAxon formula C10H10O4 ChemAxon inchi InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3- ChemAxon inchikey KSEBMYQBYZTDHS-HYXAFXHYSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 51.5 ChemAxon polarizability 18.8 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 1643 Specdb::CMs 76870 Specdb::CMs 155675 Specdb::MsMs 984488 Specdb::MsMs 984489 Specdb::MsMs 984490 Specdb::MsMs 1108907 Specdb::MsMs 1108908 Specdb::MsMs 1108909 Specdb::MsMs 2355162 Specdb::MsMs 2355163 Specdb::MsMs 2355164 Specdb::MsMs 2606608 Specdb::MsMs 2606609 Specdb::MsMs 2606610 Carrot Type 1 specific Daucus carota ssp. sativus 79200 Coriander Type 1 specific Coriandrum sativum 4047 91.35 136.0 46.7 mg/100 g