1.0 2011-09-21 00:06:26 UTC 2015-10-09 22:33:38 UTC FDB021980 2,4-Dihydroxybutanoic acid 2,4-Dihydroxybutanoic acid or 3-Deoxytetronic acid is usually absent in normal human urine extracts or in only trace constituents in neonates. (PMID 1192581) However, various cases of succinic semialdehyde dehydrogenase deficiency have shown consistently increased amounts of this metabolite. (PMID 3126356) [HMDB] 2,4-dihydroxy-Butyrate 2,4-dihydroxy-Butyric acid 2,4-Dihydroxybutanoate 2,4-Dihydroxybutanoic acid 2,4-Dihydroxybutyrate 2,4-Dihydroxybutyric acid 3-Deoxytetronate 3-Deoxytetronic acid C4H8O4 120.1039 120.042258744 2,4-dihydroxybutanoic acid 2,4-dihydroxybutyric acid 1518-62-3 OCCC(O)C(O)=O InChI=1S/C4H8O4/c5-2-1-3(6)4(7)8/h3,5-6H,1-2H2,(H,7,8) UFYGCFHQAXXBCF-UHFFFAOYSA-N belongs to the class of organic compounds known as short-chain hydroxy acids and derivatives. These are hydroxy acids with an alkyl chain the contains less than 6 carbon atoms. Short-chain hydroxy acids and derivatives Organic compounds Organic acids and derivatives Hydroxy acids and derivatives Short-chain hydroxy acids and derivatives Aliphatic acyclic compounds Alpha hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Fatty acids and conjugates Hydrocarbon derivatives Monocarboxylic acids and derivatives Monosaccharides Organic oxides Primary alcohols Secondary alcohols Alcohol Aliphatic acyclic compound Alpha-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Hydrocarbon derivative Monocarboxylic acid or derivatives Monosaccharide Organic oxide Organic oxygen compound Organooxygen compound Primary alcohol Secondary alcohol Short-chain hydroxy acid Hydroxy fatty acids hydroxybutyric acid omega-hydroxy fatty acid Solid logp -1.46 ALOGPS logs 0.77 ALOGPS solubility 7.00e+02 g/l ALOGPS logp -1.5 ChemAxon pka_strongest_acidic 3.67 ChemAxon pka_strongest_basic -2.4 ChemAxon iupac 2,4-dihydroxybutanoic acid ChemAxon average_mass 120.1039 ChemAxon mono_mass 120.042258744 ChemAxon smiles OCCC(O)C(O)=O ChemAxon formula C4H8O4 ChemAxon inchi InChI=1S/C4H8O4/c5-2-1-3(6)4(7)8/h3,5-6H,1-2H2,(H,7,8) ChemAxon inchikey UFYGCFHQAXXBCF-UHFFFAOYSA-N ChemAxon polar_surface_area 77.76 ChemAxon refractivity 25.25 ChemAxon polarizability 10.93 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 448 Specdb::MsIr 449 Specdb::MsIr 450 Specdb::MsMs 81405 Specdb::MsMs 81406 Specdb::MsMs 81407 Specdb::MsMs 142503 Specdb::MsMs 142504 Specdb::MsMs 142505 Specdb::MsMs 2226714 Specdb::MsMs 2227985 Specdb::MsMs 2231357 Specdb::MsMs 2232830 Specdb::MsMs 2233810 Specdb::MsMs 2235161 Specdb::MsMs 2458505 Specdb::MsMs 2458506 Specdb::MsMs 2458507 Specdb::MsMs 2476379 Specdb::MsMs 2476380 Specdb::MsMs 2476381 Specdb::CMs 1118 Specdb::CMs 11362 Specdb::CMs 31132 Specdb::CMs 37463 Specdb::CMs 159228 Specdb::CMs 1059426 Specdb::CMs 1059428 Specdb::CMs 1059429 Specdb::CMs 1059431 Specdb::CMs 1059432 Specdb::CMs 1059434 Specdb::CMs 1059436 Specdb::CMs 1059437 Specdb::CMs 1059439 Specdb::CMs 1059441 Specdb::CMs 1059443 Specdb::CMs 1059445 Specdb::CMs 1059447 HMDB00360 #<Reference:0x000055ce305482e8> #<Reference:0x000055ce30548130> #<Reference:0x000055ce30547f28> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823