1.0 2011-09-21 00:06:50 UTC 2015-07-21 06:56:56 UTC FDB022004 3b,16a-Dihydroxyandrostenone sulfate 3b,16a-Dihydroxyandrostenone sulfate (DHEAS) is a normal human metabolite identified in pregnant women in placenta, in breast milk, and the size of the neonate's adrenal glands is in direct relation to the levels of DHEAS in pregnancy. (PMIDs 2963083, 2974194, 6216072, 6220027, 6220952, 6445373) [HMDB] 16a-Hydroxydehydroepiandrosterone 3-sulfate 16a-Hydroxydehydroepiandrosterone 3-sulphate 16a-Hydroxydehydroisoandrosterone sulfate 16a-Hydroxydehydroisoandrosterone sulphate 3b,16a-Dihydroxy-5-androsten-17-one 3-sulfate 3b,16a-Dihydroxy-5-androsten-17-one 3-sulphate 3b,16a-Dihydroxy-androstenone sulfate 3b,16a-Dihydroxy-androstenone sulphate 3b,16a-Dihydroxyandrostenone sulfate 3b,16a-Dihydroxyandrostenone sulfic acid 3b,16a-Dihydroxyandrostenone sulphate C19H28O6S 384.487 384.160659318 [(1S,2S,10S,11S,13R,15R)-5-hydroxy-2,15-dimethyl-3-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-4-en-13-yl]oxidanesulfonic acid [(1S,2S,10S,11S,13R,15R)-5-hydroxy-2,15-dimethyl-3-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-4-en-13-yl]oxidanesulfonic acid 4873-65-8 [H][C@@]12C[C@H](C[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2CC(O)=CC(=O)[C@]12C)OS(O)(=O)=O InChI=1S/C19H28O6S/c1-18-6-5-15-14(16(18)9-13(10-18)25-26(22,23)24)4-3-11-7-12(20)8-17(21)19(11,15)2/h8,11,13-16,20H,3-7,9-10H2,1-2H3,(H,22,23,24)/t11?,13-,14-,15+,16+,18-,19+/m1/s1 AWUIWQRSWWITFQ-LZRZFMTJSA-N belongs to the class of organic compounds known as sulfated steroids. These are sterol lipids containing a sulfate group attached to the steroid skeleton. Sulfated steroids Organic compounds Lipids and lipid-like molecules Steroids and steroid derivatives Sulfated steroids Aliphatic homopolycyclic compounds 3-hydroxysteroids Alkyl sulfates Androgens and derivatives Cyclohexenones Enols Hydrocarbon derivatives Organic oxides Oxosteroids Sulfuric acid monoesters Vinylogous acids 1-oxosteroid 3-hydroxysteroid Aliphatic homopolycyclic compound Alkyl sulfate Androgen-skeleton Androstane-skeleton Carbonyl group Cyclohexenone Enol Hydrocarbon derivative Hydroxysteroid Ketone Organic oxide Organic oxygen compound Organic sulfuric acid or derivatives Organooxygen compound Oxosteroid Sulfate-ester Sulfated steroid skeleton Sulfuric acid ester Sulfuric acid monoester Vinylogous acid Solid logp -0.08 ALOGPS logs -3.92 ALOGPS solubility 4.59e-02 g/l ALOGPS logp 2.99 ChemAxon pka_strongest_acidic -1.4 ChemAxon pka_strongest_basic -5.5 ChemAxon iupac [(1S,2S,10S,11S,13R,15R)-5-hydroxy-2,15-dimethyl-3-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-4-en-13-yl]oxidanesulfonic acid ChemAxon average_mass 384.487 ChemAxon mono_mass 384.160659318 ChemAxon smiles [H][C@@]12C[C@H](C[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2CC(O)=CC(=O)[C@]12C)OS(O)(=O)=O ChemAxon formula C19H28O6S ChemAxon inchi InChI=1S/C19H28O6S/c1-18-6-5-15-14(16(18)9-13(10-18)25-26(22,23)24)4-3-11-7-12(20)8-17(21)19(11,15)2/h8,11,13-16,20H,3-7,9-10H2,1-2H3,(H,22,23,24)/t11?,13-,14-,15+,16+,18-,19+/m1/s1 ChemAxon inchikey AWUIWQRSWWITFQ-LZRZFMTJSA-N ChemAxon polar_surface_area 100.9 ChemAxon refractivity 96.94 ChemAxon polarizability 40.66 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 5 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 25849 Specdb::CMs 37487 Specdb::MsMs 323305 Specdb::MsMs 323306 Specdb::MsMs 323307 Specdb::MsMs 371428 Specdb::MsMs 371429 Specdb::MsMs 371430 HMDB00386 #<Reference:0x000055ce305af6c8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823