1.0 2011-09-21 00:07:31 UTC 2015-10-09 22:29:51 UTC FDB022046 2-Furoylglycine 2-Furoylglycine is an acyl glycine. Acyl glycines are normally minor metabolites of fatty acids. However, the excretion of certain acyl glycines is increased in several inborn errors of metabolism. In certain cases the measurement of these metabolites in body fluids can be used to diagnose disorders associated with mitochondrial fatty acid beta-oxidation. Acyl glycines are produced through the action of glycine N-acyltransferase (EC 2.3.1.13) which is an enzyme that catalyzes the chemical reaction: acyl-CoA + glycine < -- > CoA + N-acylglycine. Dietary studies show that 2-Furoylglycine precursors are of exogenous origin. Most probably from furan derivatives found in food prepared by strong heating. This may explain the absence of 2-furoylglycine in urine of breastfed children (PMID 4630229) [HMDB] [[(Furan-2-yl)carbonyl]amino]acetate [[(Furan-2-yl)carbonyl]amino]acetic acid 2-Furoylglycine Furfuroylglycine Furoylglycine N-(2-Furanylcarbonyl)glycine N-(2-Furoyl)glycine N-(carboxymethyl)-2-Furancarboxamide N-2-furoyl-Glycine Pyromucurate Pyromucuric acid C7H7NO4 169.1348 169.037507717 2-[(furan-2-yl)formamido]acetic acid furoylglycine 5657-19-2 OC(=O)CNC(=O)C1=CC=CO1 InChI=1S/C7H7NO4/c9-6(10)4-8-7(11)5-2-1-3-12-5/h1-3H,4H2,(H,8,11)(H,9,10) KSPQDMRTZZYQLM-UHFFFAOYSA-N belongs to the class of organic compounds known as n-acyl-alpha amino acids. N-acyl-alpha amino acids are compounds containing an alpha amino acid which bears an acyl group at its terminal nitrogen atom. N-acyl-alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic heteromonocyclic compounds 2-heteroaryl carboxamides Carbonyl compounds Carboxylic acids Furoic acid and derivatives Heteroaromatic compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Secondary carboxylic acid amides 2-heteroaryl carboxamide Aromatic heteromonocyclic compound Carbonyl group Carboxamide group Carboxylic acid Furan Furoic acid or derivatives Heteroaromatic compound Hydrocarbon derivative Monocarboxylic acid or derivatives N-acyl-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Secondary carboxylic acid amide N-acylglycine furans Solid logp 0.10 ALOGPS logs -1.29 ALOGPS solubility 8.76e+00 g/l ALOGPS logp -0.41 ChemAxon pka_strongest_acidic 3.34 ChemAxon pka_strongest_basic -3 ChemAxon iupac 2-[(furan-2-yl)formamido]acetic acid ChemAxon average_mass 169.1348 ChemAxon mono_mass 169.037507717 ChemAxon smiles OC(=O)CNC(=O)C1=CC=CO1 ChemAxon formula C7H7NO4 ChemAxon inchi InChI=1S/C7H7NO4/c9-6(10)4-8-7(11)5-2-1-3-12-5/h1-3H,4H2,(H,8,11)(H,9,10) ChemAxon inchikey KSPQDMRTZZYQLM-UHFFFAOYSA-N ChemAxon polar_surface_area 79.54 ChemAxon refractivity 38.51 ChemAxon polarizability 15.36 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1313 Specdb::MsIr 514 Specdb::MsIr 515 Specdb::MsIr 516 Specdb::CMs 25268 Specdb::CMs 37536 Specdb::CMs 136471 Specdb::CMs 144205 Specdb::CMs 1062731 Specdb::CMs 1062733 Specdb::CMs 1062735 Specdb::MsMs 638 Specdb::MsMs 639 Specdb::MsMs 640 Specdb::MsMs 321958 Specdb::MsMs 321959 Specdb::MsMs 321960 Specdb::MsMs 369724 Specdb::MsMs 369725 Specdb::MsMs 369726 Specdb::MsMs 439959 Specdb::MsMs 450243 Specdb::MsMs 450244 Specdb::MsMs 2253174 Specdb::MsMs 2253272 Specdb::MsMs 2255273 Specdb::MsMs 2255314 Specdb::MsMs 2259392 Specdb::MsMs 2665096 Specdb::MsMs 2665097 Specdb::MsMs 2665098 Specdb::MsMs 3016590 Specdb::MsMs 3016591 Specdb::MsMs 3016592 Specdb::NmrOneD 1369 Specdb::NmrOneD 143870 Specdb::NmrOneD 143871 Specdb::NmrOneD 143872 Specdb::NmrOneD 143873 Specdb::NmrOneD 143874 Specdb::NmrOneD 143875 Specdb::NmrOneD 143876 Specdb::NmrOneD 143877 Specdb::NmrOneD 143878 Specdb::NmrOneD 143879 Specdb::NmrOneD 143880 Specdb::NmrOneD 143881 Specdb::NmrOneD 143882 Specdb::NmrOneD 143883 Specdb::NmrOneD 143884 Specdb::NmrOneD 143885 Specdb::NmrOneD 143886 Specdb::NmrOneD 143887 Specdb::NmrOneD 143888 Specdb::NmrOneD 143889 HMDB00439 #<Reference:0x000055ce305c81f0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Glycine N-acyltransferase Q6IB77 GLYAT Glycine N-acyltransferase-like protein 1 Q969I3 GLYATL1 Glycine N-acyltransferase-like protein 2 Q8WU03 GLYATL2 Glycine N-acyltransferase-like protein 3 Q5SZD4 GLYATL3