1.0 2011-09-21 00:07:49 UTC 2015-10-09 22:29:04 UTC FDB022062 6-Dimethylaminopurine 6-Dimethylaminopurine is a serine threonine protein kinase inhibitor. It inhibits the germinal vesicle breakdown and the meiotic maturation of oocytes. (PMID 2540051) 6-Dimethylaminopurine can be used to rtificially lengthen the pre-maturation period of oocyte growth, in vitro, by inhibiting germinal vesicle breakdown in mouse and human oocytes. (PMID: 10655310) [HMDB] 6-(dimethylamino)-Purine 6-(Dimethylamino)purine 6-Dimethyladenine 6-Dimethylamine purine 6-Dimethylaminopurine 6,6-Dimethyladenine Dimethyladenine DMAP N,N-Dimethyl-1H-purin-6-amine N,N-Dimethyl-6-aminopurine N,N-dimethyl-Adenine N,N-Dimethyladenine N(6)-Dimethyladenine N(6),N(6)-Dimethyladenine N6,N6-dimethyl-Adenine N6,N6-Dimethyladenine C7H9N5 163.1799 163.085795313 N,N-dimethyl-7H-purin-6-amine 6-(dimethylamino)-purine 938-55-6 CN(C)C1=NC=NC2=C1NC=N2 InChI=1S/C7H9N5/c1-12(2)7-5-6(9-3-8-5)10-4-11-7/h3-4H,1-2H3,(H,8,9,10,11) BVIAOQMSVZHOJM-UHFFFAOYSA-N belongs to the class of organic compounds known as 6-alkylaminopurines. 6-alkylaminopurines are compounds that contain an alkylamine group attached at the 6-position of a purine. Purine is a bicyclic aromatic compound made up of a pyrimidine ring fused to an imidazole ring. 6-alkylaminopurines Organic compounds Organoheterocyclic compounds Imidazopyrimidines Purines and purine derivatives Aromatic heteropolycyclic compounds Aminopyrimidines and derivatives Azacyclic compounds Dialkylarylamines Heteroaromatic compounds Hydrocarbon derivatives Imidazoles Imidolactams Organopnictogen compounds 6-alkylaminopurine Aminopyrimidine Aromatic heteropolycyclic compound Azacycle Azole Dialkylarylamine Heteroaromatic compound Hydrocarbon derivative Imidazole Imidolactam Organic nitrogen compound Organonitrogen compound Organopnictogen compound Pyrimidine tertiary amine Solid logp 0.53 ALOGPS logs -1.73 ALOGPS solubility 3.07e+00 g/l ALOGPS logp 0.36 ChemAxon pka_strongest_acidic 10.19 ChemAxon pka_strongest_basic 3.35 ChemAxon iupac N,N-dimethyl-7H-purin-6-amine ChemAxon average_mass 163.1799 ChemAxon mono_mass 163.085795313 ChemAxon smiles CN(C)C1=NC=NC2=C1NC=N2 ChemAxon formula C7H9N5 ChemAxon inchi InChI=1S/C7H9N5/c1-12(2)7-5-6(9-3-8-5)10-4-11-7/h3-4H,1-2H3,(H,8,9,10,11) ChemAxon inchikey BVIAOQMSVZHOJM-UHFFFAOYSA-N ChemAxon polar_surface_area 57.7 ChemAxon refractivity 47.95 ChemAxon polarizability 16.32 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 13979 Specdb::CMs 136020 Specdb::CMs 143754 Specdb::MsIr 549 Specdb::MsIr 550 Specdb::MsIr 551 Specdb::NmrTwoD 1330 Specdb::NmrOneD 1386 Specdb::NmrOneD 144130 Specdb::NmrOneD 144131 Specdb::NmrOneD 144132 Specdb::NmrOneD 144133 Specdb::NmrOneD 144134 Specdb::NmrOneD 144135 Specdb::NmrOneD 144136 Specdb::NmrOneD 144137 Specdb::NmrOneD 144138 Specdb::NmrOneD 144139 Specdb::NmrOneD 144140 Specdb::NmrOneD 144141 Specdb::NmrOneD 144142 Specdb::NmrOneD 144143 Specdb::NmrOneD 144144 Specdb::NmrOneD 144145 Specdb::NmrOneD 144146 Specdb::NmrOneD 144147 Specdb::NmrOneD 144148 Specdb::NmrOneD 144149 Specdb::MsMs 689 Specdb::MsMs 690 Specdb::MsMs 691 Specdb::MsMs 7859 Specdb::MsMs 7860 Specdb::MsMs 7861 Specdb::MsMs 14531 Specdb::MsMs 14532 Specdb::MsMs 14533 Specdb::MsMs 2331207 Specdb::MsMs 2331208 Specdb::MsMs 2331209 Specdb::MsMs 2631341 Specdb::MsMs 2631342 Specdb::MsMs 2631343 HMDB00473 42C #<Reference:0x000055ce2f374288> #<Reference:0x000055ce2f374030> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823