1.0 2011-09-21 00:07:51 UTC 2015-07-21 06:56:57 UTC FDB022064 7Z,10Z-Hexadecadienoic acid 7Z,10Z-Hexadecadienoic acid is a conjugated dienoic fatty acid metabolite of conjugated linoleic acid (CLA). CLAs are a naturally occurring group of positional and geometric isomers of linoleic acid, with potential beneficial effects on atherosclerosis, carcinogenesis or obesity in human. Although the molecular mechanisms are largely unknown, it has been proposed that the anti-atherogenic actions comprise reduction of membrane-bound arachidonic acid and peroxisome proliferator-activated receptor (PPAR)-&#947;-dependent inhibition of Nuclear Factor kappa B (NF-&#954;B) activation and subsequently reduced prostanoid release. (PMID 16275160) [HMDB] (Z,Z)-7,10-Hexadecadienoate (Z,Z)-7,10-Hexadecadienoic acid 7Z,10Z-Hexadecadienoate 7Z,10Z-Hexadecadienoic acid C16H28O2 252.3923 252.20893014 hexadeca-7,10-dienoic acid hexadeca-7,10-dienoic acid 28290-73-5 CCCCCC=CCC=CCCCCCC(O)=O InChI=1S/C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h6-7,9-10H,2-5,8,11-15H2,1H3,(H,17,18) WPJGPAAPSBVXNU-UHFFFAOYSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Solid logp 6.23 ALOGPS logs -5.58 ALOGPS solubility 6.67e-04 g/l ALOGPS logp 5.53 ChemAxon pka_strongest_acidic 4.96 ChemAxon iupac hexadeca-7,10-dienoic acid ChemAxon average_mass 252.3923 ChemAxon mono_mass 252.20893014 ChemAxon smiles CCCCCC=CCC=CCCCCCC(O)=O ChemAxon formula C16H28O2 ChemAxon inchi InChI=1S/C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h6-7,9-10H,2-5,8,11-15H2,1H3,(H,17,18) ChemAxon inchikey WPJGPAAPSBVXNU-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 79.32 ChemAxon polarizability 31.24 ChemAxon rotatable_bond_count 12 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon HMDB00477 #<Reference:0x000055ce32a90208> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823