1.0 2011-09-21 00:08:02 UTC 2015-10-09 22:30:52 UTC FDB022073 5a-Androstane-3b,17b-diol Androstane-3,17-diol is a metabolite of dihydrotestosterone. It doesn't bind androgen receptors, but efficiently binds the estrogen receptor beta and inhibits prostate cancer cell migration through the activation of estrogen receptor beta. (PMID 15958594) [HMDB] (3b,5a,17b)-Androstane-3,17-diol (3beta,5alpha,17beta)-Androstane-3,17-diol (3β,5α,17β)-androstane-3,17-diol 3b,17b-Androstanediol 3b,17b-Dihydroxy-5a-androstane 3beta,17beta-Dihydroxy-5alpha-androstane 3β,17β-dihydroxy-5α-androstane 5-a-ANDROSTANE-3-b,17b-diol 5-ALPHA-ANDROSTANE-3-BETA,17BETA-diol 5-α-androstane-3-β,17β-diol 5a-Androstan-3b,17b-diol 5alpha-Androstan-3beta,17beta-diol 5alpha-Androstane-3beta,17beta-diol 5α-androstan-3β,17β-diol C19H32O2 292.4562 292.240230268 (1S,2S,5S,7S,10R,11S,14S,15S)-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecane-5,14-diol (1S,2S,5S,7S,10R,11S,14S,15S)-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecane-5,14-diol 571-20-0 [H][C@]1(O)CC[C@@]2([H])[C@]3([H])CC[C@@]4([H])C[C@@]([H])(O)CC[C@]4(C)[C@@]3([H])CC[C@]12C InChI=1S/C19H32O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-17,20-21H,3-11H2,1-2H3/t12-,13-,14-,15-,16-,17-,18-,19-/m0/s1 CBMYJHIOYJEBSB-YSZCXEEOSA-N belongs to the class of organic compounds known as androgens and derivatives. These are 3-hydroxylated C19 steroid hormones. They are known to favor the development of masculine characteristics. They also show profound effects on scalp and body hair in humans. Androgens and derivatives Organic compounds Lipids and lipid-like molecules Steroids and steroid derivatives Androstane steroids Aliphatic homopolycyclic compounds 17-hydroxysteroids 3-beta-hydroxysteroids Cyclic alcohols and derivatives Hydrocarbon derivatives Secondary alcohols 17-hydroxysteroid 3-beta-hydroxysteroid 3-hydroxysteroid Alcohol Aliphatic homopolycyclic compound Androgen-skeleton Cyclic alcohol Hydrocarbon derivative Hydroxysteroid Organic oxygen compound Organooxygen compound Secondary alcohol 17beta-hydroxy steroid 3beta-hydroxy steroid C19 steroids (androgens) and derivatives C19 steroids (androgens) and derivatives androstane-3,17-diol Solid logp 3.56 ALOGPS logs -4.18 ALOGPS solubility 1.93e-02 g/l ALOGPS logp 3.2 ChemAxon pka_strongest_acidic 18.3 ChemAxon pka_strongest_basic -0.76 ChemAxon iupac (1S,2S,5S,7S,10R,11S,14S,15S)-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecane-5,14-diol ChemAxon average_mass 292.4562 ChemAxon mono_mass 292.240230268 ChemAxon smiles [H][C@]1(O)CC[C@@]2([H])[C@]3([H])CC[C@@]4([H])C[C@@]([H])(O)CC[C@]4(C)[C@@]3([H])CC[C@]12C ChemAxon formula C19H32O2 ChemAxon inchi InChI=1S/C19H32O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-17,20-21H,3-11H2,1-2H3/t12-,13-,14-,15-,16-,17-,18-,19-/m0/s1 ChemAxon inchikey CBMYJHIOYJEBSB-YSZCXEEOSA-N ChemAxon polar_surface_area 40.46 ChemAxon refractivity 84.63 ChemAxon polarizability 35.56 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 1393 Specdb::NmrTwoD 1337 Specdb::CMs 21004 Specdb::CMs 37567 Specdb::CMs 153934 Specdb::CMs 1063866 Specdb::CMs 1063868 Specdb::CMs 1063870 Specdb::CMs 1063872 Specdb::CMs 1063874 Specdb::MsMs 713 Specdb::MsMs 714 Specdb::MsMs 715 Specdb::MsMs 248136 Specdb::MsMs 248137 Specdb::MsMs 248138 Specdb::MsMs 268077 Specdb::MsMs 268078 Specdb::MsMs 268079 Specdb::MsMs 2674966 Specdb::MsMs 2674967 Specdb::MsMs 2674968 Specdb::MsMs 3033350 Specdb::MsMs 3033351 Specdb::MsMs 3033352 HMDB00493 18329 AOM #<Reference:0x000055ce321b7730> #<Reference:0x000055ce321b7578> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823