1.0 2011-09-21 00:08:16 UTC 2024-11-29 22:27:12 UTC FDB022084 N-Acetyl-L-phenylalanine Acetylphenylalanine is a hazardous amphipathic metabolite of phenylalanine. It appears in large amount in urine of patients with phenylketonuria which is a human genetic disorder due to the lack of phenylalanine hydroxylase, the enzyme necessary to metabolize phenylalanine to tyrosine. Acetylphenylalanine is a product of enzyme phenylalanine N-acetyltransferase [EC 2.3.1.53] in the pathway phenylalanine metabolism. (KEGG; Wikipedia) [HMDB] Acetyl-L-phenylalanine Acetylphenylalanine L-N-Acetylphenylalanine N-acetyl-3-phenyl-L-Alanine N-Acetyl-l-phenalanine N-Acetyl-L-phenylalanine N-Acetylphenylalanine C11H13NO3 207.2258 207.089543287 (2S)-2-acetamido-3-phenylpropanoic acid acetyl-L-phenylalanine 2018-61-3 CC(=O)N[C@@H](CC1=CC=CC=C1)C(O)=O InChI=1S/C11H13NO3/c1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 CBQJSKKFNMDLON-JTQLQIEISA-N belongs to the class of organic compounds known as phenylalanine and derivatives. Phenylalanine and derivatives are compounds containing phenylalanine or a derivative thereof resulting from reaction of phenylalanine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Phenylalanine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds Amphetamines and derivatives Carbonyl compounds Carboximidic acids Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives N-acyl-alpha amino acids Organic oxides Organonitrogen compounds Organopnictogen compounds Phenylpropanoic acids Propargyl-type 1,3-dipolar organic compounds 3-phenylpropanoic-acid Amphetamine or derivatives Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboximidic acid Carboximidic acid derivative Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylalanine or derivatives Propargyl-type 1,3-dipolar organic compound N-acetyl-L-amino acid N-acetylphenylalanine N-acyl-L-phenylalanine Solid logp 1.11 ALOGPS logs -2.33 ALOGPS solubility 9.67e-01 g/l ALOGPS logp 0.9 ChemAxon pka_strongest_acidic 4.02 ChemAxon pka_strongest_basic -2 ChemAxon iupac (2S)-2-acetamido-3-phenylpropanoic acid ChemAxon average_mass 207.2258 ChemAxon mono_mass 207.089543287 ChemAxon smiles CC(=O)N[C@@H](CC1=CC=CC=C1)C(O)=O ChemAxon formula C11H13NO3 ChemAxon inchi InChI=1S/C11H13NO3/c1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 ChemAxon inchikey CBQJSKKFNMDLON-JTQLQIEISA-N ChemAxon polar_surface_area 66.4 ChemAxon refractivity 54.56 ChemAxon polarizability 21.21 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Metabolism and Physiological Effects of N-Acetylphenylalanine SMP0126720 Specdb::NmrTwoD 1347 Specdb::CMs 1450 Specdb::CMs 1482 Specdb::CMs 2362 Specdb::CMs 31158 Specdb::CMs 31159 Specdb::CMs 31717 Specdb::CMs 31718 Specdb::CMs 31719 Specdb::CMs 37584 Specdb::CMs 146305 Specdb::CMs 1064573 Specdb::CMs 1064575 Specdb::CMs 1064577 Specdb::NmrOneD 1403 Specdb::MsIr 5 Specdb::MsIr 31 Specdb::MsIr 53 Specdb::MsIr 587 Specdb::MsIr 588 Specdb::MsIr 589 Specdb::MsMs 737 Specdb::MsMs 738 Specdb::MsMs 739 Specdb::MsMs 4143 Specdb::MsMs 4144 Specdb::MsMs 4145 Specdb::MsMs 4146 Specdb::MsMs 4147 Specdb::MsMs 4148 Specdb::MsMs 4149 Specdb::MsMs 4150 Specdb::MsMs 4151 Specdb::MsMs 4152 Specdb::MsMs 4153 Specdb::MsMs 4154 Specdb::MsMs 4155 Specdb::MsMs 4156 Specdb::MsMs 178005 Specdb::MsMs 178006 Specdb::MsMs 178007 Specdb::MsMs 180318 Specdb::MsMs 180319 Specdb::MsMs 180320 Specdb::MsMs 437188 Specdb::MsMs 437189 HMDB00512 16259 #<Reference:0x000055ce3048d1a0> #<Reference:0x000055ce3048cfe8> #<Reference:0x000055ce3048ce30> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Glycine N-acyltransferase Q6IB77 GLYAT Glycine N-acyltransferase-like protein 1 Q969I3 GLYATL1 Glycine N-acyltransferase-like protein 2 Q8WU03 GLYATL2