1.0 2011-09-21 00:10:34 UTC 2019-11-26 03:21:01 UTC FDB022228 Glycyl-L-leucine A dipeptide that appears to be a common substrate for glycyl-leucine dipeptidase. [HMDB] G-L GL Gly-L-leu Glycyl-L-leucine Glycyl-leucine Glycylleucine N-Glycyl-L-leucine C8H16N2O3 188.2242 188.116092388 (2S)-2-(2-aminoacetamido)-4-methylpentanoic acid glycyl-L-leucine 869-19-2 CC(C)C[C@H](NC(=O)CN)C(O)=O InChI=1S/C8H16N2O3/c1-5(2)3-6(8(12)13)10-7(11)4-9/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)/t6-/m0/s1 DKEXFJVMVGETOO-LURJTMIESA-N belongs to the class of organic compounds known as peptides. Peptides are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another. Peptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboximidic acids Carboxylic acids Hydrocarbon derivatives Leucine and derivatives Methyl-branched fatty acids Monoalkylamines Monocarboxylic acids and derivatives N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Aliphatic acyclic compound Alpha peptide Alpha-amino acid or derivatives Amine Amino acid Amino acid or derivatives Branched fatty acid Carbonyl group Carboximidic acid Carboximidic acid derivative Carboxylic acid Fatty acid Fatty acyl Hydrocarbon derivative Leucine or derivatives Methyl-branched fatty acid Monocarboxylic acid or derivatives N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Propargyl-type 1,3-dipolar organic compound dipeptide Solid logp -2.08 ALOGPS logs -1.09 ALOGPS solubility 1.52e+01 g/l ALOGPS logp -2.7 ChemAxon pka_strongest_acidic 3.89 ChemAxon pka_strongest_basic 8.14 ChemAxon iupac (2S)-2-(2-aminoacetamido)-4-methylpentanoic acid ChemAxon average_mass 188.2242 ChemAxon mono_mass 188.116092388 ChemAxon smiles CC(C)C[C@H](NC(=O)CN)C(O)=O ChemAxon formula C8H16N2O3 ChemAxon inchi InChI=1S/C8H16N2O3/c1-5(2)3-6(8(12)13)10-7(11)4-9/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)/t6-/m0/s1 ChemAxon inchikey DKEXFJVMVGETOO-LURJTMIESA-N ChemAxon polar_surface_area 92.42 ChemAxon refractivity 46.97 ChemAxon polarizability 19.4 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1038 Specdb::NmrTwoD 1473 Specdb::NmrOneD 1269 Specdb::NmrOneD 1527 Specdb::NmrOneD 166450 Specdb::MsIr 837 Specdb::MsIr 838 Specdb::MsIr 839 Specdb::CMs 22134 Specdb::CMs 37747 Specdb::CMs 173500 Specdb::CMs 1074757 Specdb::CMs 1074758 Specdb::CMs 1074760 Specdb::CMs 1074762 Specdb::CMs 1074764 Specdb::MsMs 1089 Specdb::MsMs 1090 Specdb::MsMs 1091 Specdb::MsMs 4626 Specdb::MsMs 4627 Specdb::MsMs 4628 Specdb::MsMs 4629 Specdb::MsMs 4630 Specdb::MsMs 4631 Specdb::MsMs 4632 Specdb::MsMs 4633 Specdb::MsMs 4634 Specdb::MsMs 4635 Specdb::MsMs 315154 Specdb::MsMs 315155 Specdb::MsMs 315156 Specdb::MsMs 361057 Specdb::MsMs 361058 Specdb::MsMs 361059 Specdb::MsMs 437746 Specdb::MsMs 437747 Specdb::MsMs 437748 Specdb::MsMs 437749 Specdb::MsMs 437750 Specdb::MsMs 446236 HMDB00759 #<Reference:0x000055ce333c4ae0> #<Reference:0x000055ce333c48d8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823