1.0 2011-09-21 00:10:37 UTC 2015-07-21 06:57:04 UTC FDB022232 N-Acetyl-9-O-lactoylneuraminic acid A sialic acid produced by sialate 9-O-lactoyltransferases. Lactoylation of CMP-N-acetylneuraminic acid, N-acetylneuramimic acid and glycoconjugate-bound N-acetylneuramimic acid has been observed, with the glycoconjugate form being the best substrate. [HMDB] 5-(acetylamino)-3,5-dideoxy-9-(2-hydroxypropanoate 5-(acetylamino)-3,5-dideoxy-9-(2-hydroxypropanoate) D-glycero-D-galacto-2-Nonulosonate 5-(acetylamino)-3,5-dideoxy-9-(2-hydroxypropanoate) D-glycero-D-galacto-2-Nonulosonic acid 5-(acetylamino)-3,5-dideoxy-9-(2-hydroxypropanoic acid 9-O-lactoyl-N-acetylneuraminic acid N-Acetyl-9-O-lactoylneuraminate N-Acetyl-9-O-lactoylneuraminic acid Neu5,8Ac29 C14H23NO11 381.3325 381.127110583 (2S,4S,5R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-[(2-hydroxypropanoyl)oxy]propyl]-5-acetamido-2,4-dihydroxyoxane-2-carboxylic acid (2S,4S,5R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-[(2-hydroxypropanoyl)oxy]propyl]-5-acetamido-2,4-dihydroxyoxane-2-carboxylic acid 92935-30-3 CC(O)C(=O)OC[C@@H](O)[C@@H](O)[C@@H]1O[C@@](O)(C[C@H](O)[C@H]1NC(C)=O)C(O)=O InChI=1S/C14H23NO11/c1-5(16)12(21)25-4-8(19)10(20)11-9(15-6(2)17)7(18)3-14(24,26-11)13(22)23/h5,7-11,16,18-20,24H,3-4H2,1-2H3,(H,15,17)(H,22,23)/t5?,7-,8+,9+,10+,11+,14-/m0/s1 XXNWSGSWDRDYLR-NVZZXFSUSA-N belongs to the class of organic compounds known as n-acylneuraminic acids. These are neuraminic acids carrying an N-acyl substituent. N-acylneuraminic acids Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Acetamides Alpha hydroxy acids and derivatives C-glucuronides C-glycosyl compounds Carbonyl compounds Carboxylic acid esters Carboxylic acids Dicarboxylic acids and derivatives Hemiacetals Hydrocarbon derivatives Neuraminic acids Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Oxanes Pyrans Secondary alcohols Secondary carboxylic acid amides Acetamide Alcohol Aliphatic heteromonocyclic compound Alpha-hydroxy acid C-glucuronide C-glycosyl compound Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Dicarboxylic acid or derivatives Glycosyl compound Hemiacetal Hydrocarbon derivative Hydroxy acid N-acylneuraminic acid Neuraminic acid Organic nitrogen compound Organic oxide Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Oxacycle Oxane Pyran Secondary alcohol Secondary carboxylic acid amide Solid logp -2.44 ALOGPS logs -0.69 ALOGPS solubility 7.73e+01 g/l ALOGPS logp -3.4 ChemAxon pka_strongest_acidic 2.84 ChemAxon pka_strongest_basic -1.3 ChemAxon iupac (2S,4S,5R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-[(2-hydroxypropanoyl)oxy]propyl]-5-acetamido-2,4-dihydroxyoxane-2-carboxylic acid ChemAxon average_mass 381.3325 ChemAxon mono_mass 381.127110583 ChemAxon smiles CC(O)C(=O)OC[C@@H](O)[C@@H](O)[C@@H]1O[C@@](O)(C[C@H](O)[C@H]1NC(C)=O)C(O)=O ChemAxon formula C14H23NO11 ChemAxon inchi InChI=1S/C14H23NO11/c1-5(16)12(21)25-4-8(19)10(20)11-9(15-6(2)17)7(18)3-14(24,26-11)13(22)23/h5,7-11,16,18-20,24H,3-4H2,1-2H3,(H,15,17)(H,22,23)/t5?,7-,8+,9+,10+,11+,14-/m0/s1 ChemAxon inchikey XXNWSGSWDRDYLR-NVZZXFSUSA-N ChemAxon polar_surface_area 203.08 ChemAxon refractivity 79.13 ChemAxon polarizability 34.59 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 10 ChemAxon donor_count 7 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 302269 Specdb::MsMs 302270 Specdb::MsMs 302271 Specdb::MsMs 344956 Specdb::MsMs 344957 Specdb::MsMs 344958 Specdb::MsMs 2784835 Specdb::MsMs 2784836 Specdb::MsMs 2784837 Specdb::MsMs 2923570 Specdb::MsMs 2923571 Specdb::MsMs 2923572 Specdb::NmrOneD 145310 Specdb::NmrOneD 145311 Specdb::NmrOneD 145312 Specdb::NmrOneD 145313 Specdb::NmrOneD 145314 Specdb::NmrOneD 145315 Specdb::NmrOneD 145316 Specdb::NmrOneD 145317 Specdb::NmrOneD 145318 Specdb::NmrOneD 145319 Specdb::NmrOneD 145320 Specdb::NmrOneD 145321 Specdb::NmrOneD 145322 Specdb::NmrOneD 145323 Specdb::NmrOneD 145324 Specdb::NmrOneD 145325 Specdb::NmrOneD 145326 Specdb::NmrOneD 145327 Specdb::NmrOneD 145328 Specdb::NmrOneD 145329 Specdb::CMs 16399 Specdb::CMs 37755 Specdb::CMs 131544 Specdb::CMs 139278 Specdb::CMs 151155 Specdb::CMs 279823 Specdb::CMs 1075077 Specdb::CMs 1075079 Specdb::CMs 1075081 Specdb::CMs 1075083 Specdb::CMs 1075085 Specdb::CMs 1075087 Specdb::CMs 1075089 Specdb::CMs 1075090 Specdb::CMs 1075092 Specdb::CMs 1075094 Specdb::CMs 1075096 Specdb::CMs 1075098 Specdb::CMs 1075100 Specdb::CMs 1075102 Specdb::CMs 1075104 Specdb::CMs 1075106 Specdb::CMs 1075108 Specdb::CMs 1075110 Specdb::CMs 1075112 HMDB00768 #<Reference:0x000055ce31dc1888> #<Reference:0x000055ce31dc16d0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823