1.0 2011-09-21 00:11:45 UTC 2015-10-09 22:29:17 UTC FDB022300 Undecanedioic acid Undecanedioic acid has been found in parts of human aortas with advanced atherosclerotic lesions associated with intercellular matrix macromolecules and specifically with elastin, and may be the result of an increased hydrolysis of esters and (or) a decreased esterification. (PMID: 131675) Undecanedioic acid has been found (among other unusual dicarboxylic acids) in the urine from patients under hopantenate therapy during episodes of Reye's-like syndrome. (PMID: 2331533) [HMDB] 1,11-Undecanedioate 1,11-Undecanedioic acid 1,9-Nonanedicarboxylate 1,9-Nonanedicarboxylic acid Hendecanedioate Hendecanedioic acid Undecanedioate Undecanedioic acid Undecanedionate Undecanedionic acid C11H20O4 216.2741 216.136159128 undecanedioic acid undecanedioic acid 1852-04-6 OC(=O)CCCCCCCCCC(O)=O InChI=1S/C11H20O4/c12-10(13)8-6-4-2-1-3-5-7-9-11(14)15/h1-9H2,(H,12,13)(H,14,15) LWBHHRRTOZQPDM-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Medium-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Hydrocarbon derivatives Organic oxides Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Dicarboxylic acid or derivatives Hydrocarbon derivative Medium-chain fatty acid Organic oxide Organic oxygen compound Organooxygen compound Dicarboxylic acids alpha,omega-dicarboxylic acid Solid logp 2.41 ALOGPS logs -2.69 ALOGPS solubility 4.45e-01 g/l ALOGPS logp 2.71 ChemAxon pka_strongest_acidic 4.65 ChemAxon iupac undecanedioic acid ChemAxon average_mass 216.2741 ChemAxon mono_mass 216.136159128 ChemAxon smiles OC(=O)CCCCCCCCCC(O)=O ChemAxon formula C11H20O4 ChemAxon inchi InChI=1S/C11H20O4/c12-10(13)8-6-4-2-1-3-5-7-9-11(14)15/h1-9H2,(H,12,13)(H,14,15) ChemAxon inchikey LWBHHRRTOZQPDM-UHFFFAOYSA-N ChemAxon polar_surface_area 74.6 ChemAxon refractivity 55.74 ChemAxon polarizability 24.74 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 14653 Specdb::CMs 37825 Specdb::CMs 130525 Specdb::CMs 138259 Specdb::CMs 1080987 Specdb::CMs 1080989 Specdb::CMs 1080991 Specdb::NmrOneD 1585 Specdb::NmrTwoD 1527 Specdb::MsMs 1250 Specdb::MsMs 1251 Specdb::MsMs 1252 Specdb::MsMs 298369 Specdb::MsMs 298370 Specdb::MsMs 298371 Specdb::MsMs 340114 Specdb::MsMs 340115 Specdb::MsMs 340116 Specdb::MsMs 2226370 Specdb::MsMs 2228360 Specdb::MsMs 2244757 Specdb::MsMs 2245335 Specdb::MsMs 2248802 Specdb::MsMs 2249564 Specdb::MsMs 2250880 Specdb::MsMs 2251548 Specdb::MsMs 2774981 Specdb::MsMs 2774982 Specdb::MsMs 2774983 Specdb::MsMs 2906802 Specdb::MsMs 2906803 Specdb::MsMs 2906804 HMDB00888 #<Reference:0x000055ce31f4fee8> #<Reference:0x000055ce31f4fd30> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823