1.0 2011-09-21 00:12:14 UTC 2015-07-21 06:57:09 UTC FDB022329 Cholest-5-ene Cholestenes are derivatives of cholestanes which have a double bond. One of the most significant cholestenes is cholecalciferol. If there are two double bonds, the molecule is known as a "cholestadienes". Examples include fusidic acid, lanosterol, and stigmasterol.--Wikipedia [HMDB] 5-Cholestene Cholest-5-ene D5-Cholestene C27H46 370.6541 370.359951472 (1S,2R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-ene cholest-5-ene 570-74-1 [H][C@@]12CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2CCCC[C@]12C InChI=1S/C27H46/c1-19(2)9-8-10-20(3)23-14-15-24-22-13-12-21-11-6-7-17-26(21,4)25(22)16-18-27(23,24)5/h12,19-20,22-25H,6-11,13-18H2,1-5H3/t20-,22+,23-,24+,25+,26+,27-/m1/s1 DTGDZMYNKLTSKC-HKQCOZBKSA-N belongs to the class of organic compounds known as cholestane steroids. These are steroids with a structure containing the 27-carbon cholestane skeleton. Cholestane steroids Organic compounds Lipids and lipid-like molecules Steroids and steroid derivatives Cholestane steroids Aliphatic homopolycyclic compounds Cyclic olefins Delta-5-steroids Polycyclic hydrocarbons Unsaturated aliphatic hydrocarbons Aliphatic homopolycyclic compound Cholestane-skeleton Cyclic olefin Delta-5-steroid Hydrocarbon Olefin Polycyclic hydrocarbon Unsaturated aliphatic hydrocarbon Unsaturated hydrocarbon Cholesterol and derivatives cholestanoid Solid logp 7.87 ALOGPS logs -7.50 ALOGPS solubility 1.17e-05 g/l ALOGPS logp 8.5 ChemAxon iupac (1S,2R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-ene ChemAxon average_mass 370.6541 ChemAxon mono_mass 370.359951472 ChemAxon smiles [H][C@@]12CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2CCCC[C@]12C ChemAxon formula C27H46 ChemAxon inchi InChI=1S/C27H46/c1-19(2)9-8-10-20(3)23-14-15-24-22-13-12-21-11-6-7-17-26(21,4)25(22)16-18-27(23,24)5/h12,19-20,22-25H,6-11,13-18H2,1-5H3/t20-,22+,23-,24+,25+,26+,27-/m1/s1 ChemAxon inchikey DTGDZMYNKLTSKC-HKQCOZBKSA-N ChemAxon polar_surface_area 0 ChemAxon refractivity 118.95 ChemAxon polarizability 49.73 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 18961 Specdb::CMs 154195 Specdb::MsMs 308125 Specdb::MsMs 308126 Specdb::MsMs 308127 Specdb::MsMs 352237 Specdb::MsMs 352238 Specdb::MsMs 352239 Specdb::MsMs 2377565 Specdb::MsMs 2377566 Specdb::MsMs 2377567 Specdb::MsMs 2561568 Specdb::MsMs 2561569 Specdb::MsMs 2561570 HMDB00941 #<Reference:0x000055ce3235d5a8> #<Reference:0x000055ce3235d3f0> #<Reference:0x000055ce3235d238> #<Reference:0x000055ce3235d080> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823