1.0 2011-09-21 00:13:21 UTC 2025-11-19 02:41:35 UTC FDB022395 Dihydrofolic acid Dihydrofolic acid is a folic acid derivative acted upon by dihydrofolate reductase to produce tetrahydrofolic acid. It interacts with bacteria during cell division. It can be targeted with drug analogs to prevent nucleic acid synthesis. Dihydrofolic acid is also known by the name Dihydrofolate - more commonly Vitamin B9. [HMDB] 7,8-Dihydro-L-folic acid 7,8-dihydrofolate 7,8-Dihydrofolic acid 7,8-Dihydropteroylglutamate 7,8-Dihydropteroylglutamic acid dihydrofolate H2PteGlu H2PteGlu1 L-N-[p-[[(2-amino-7,8-dihydro-4-hydroxy-6-pteridinyl)methyl]amino]benzoyl]-Glutamic acid N-(4-(((2-amino-1,4,7,8-tetrahydro-4-oxo-6-pteridinyl)methyl)amino)benzoyl)-L-Glutamic acid N-(4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid N-(7,8-Dihydropteroyl)-L-glutamate N-(7,8-dihydropteroyl)-L-glutamic acid N-[4-[[(2-amino-1,4,7,8-tetrahydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-Glutamic acid N-[4-[[(2-amino-3,4,7,8-tetrahydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-Glutamic acid C19H21N7O6 443.4133 443.155331439 (2S)-2-[(4-{[(2-amino-4-oxo-1,4,7,8-tetrahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid dihydrofolic acid 4033-27-6 NC1=NC2=C(N=C(CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)CN2)C(=O)N1 InChI=1S/C19H21N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,12,21H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/t12-/m0/s1 OZRNSSUDZOLUSN-LBPRGKRZSA-N belongs to the class of organic compounds known as glutamic acid and derivatives. Glutamic acid and derivatives are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Glutamic acid and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic heteropolycyclic compounds Amino acids Aminobenzamides Aniline and substituted anilines Azacyclic compounds Benzoyl derivatives Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Heteroaromatic compounds Hippuric acids Hydrocarbon derivatives Hydroxypyrimidines Ketimines N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Phenylalkylamines Propargyl-type 1,3-dipolar organic compounds Pterins and derivatives Secondary alkylarylamines Secondary carboxylic acid amides Amine Amino acid Aminobenzamide Aminobenzoic acid or derivatives Aniline or substituted anilines Aromatic heteropolycyclic compound Azacycle Benzamide Benzenoid Benzoic acid or derivatives Benzoyl Carbonyl group Carboxamide group Carboxylic acid Dicarboxylic acid or derivatives Glutamic acid or derivatives Heteroaromatic compound Hippuric acid Hippuric acid or derivatives Hydrocarbon derivative Hydroxypyrimidine Imine Ketimine Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylalkylamine Propargyl-type 1,3-dipolar organic compound Pteridine Pterin Pyrimidine Secondary aliphatic/aromatic amine Secondary amine Secondary carboxylic acid amide dihydrofolic acids Solid logp -0.93 ALOGPS logs -3.50 ALOGPS solubility 1.41e-01 g/l ALOGPS logp -1.8 ChemAxon pka_strongest_acidic 3.37 ChemAxon pka_strongest_basic 2.09 ChemAxon iupac (2S)-2-[(4-{[(2-amino-4-oxo-1,4,7,8-tetrahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid ChemAxon average_mass 443.4133 ChemAxon mono_mass 443.155331439 ChemAxon smiles NC1=NC2=C(N=C(CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)CN2)C(=O)N1 ChemAxon formula C19H21N7O6 ChemAxon inchi InChI=1S/C19H21N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,12,21H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/t12-/m0/s1 ChemAxon inchikey OZRNSSUDZOLUSN-LBPRGKRZSA-N ChemAxon polar_surface_area 207.6 ChemAxon refractivity 120.99 ChemAxon polarizability 44.31 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 12 ChemAxon donor_count 7 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Folate Metabolism SMP00053 map00670 Pterine Biosynthesis SMP00005 map00790 Specdb::MsMs 22988 Specdb::MsMs 22989 Specdb::MsMs 22990 Specdb::MsMs 29786 Specdb::MsMs 29787 Specdb::MsMs 29788 Specdb::MsMs 2256358 Specdb::MsMs 2837874 Specdb::MsMs 2837875 Specdb::MsMs 2837876 Specdb::MsMs 2867313 Specdb::MsMs 2867314 Specdb::MsMs 2867315 Specdb::NmrOneD 8422 Specdb::NmrOneD 8423 Specdb::NmrOneD 8424 Specdb::NmrOneD 8425 Specdb::NmrOneD 8426 Specdb::NmrOneD 8427 Specdb::NmrOneD 8428 Specdb::NmrOneD 8429 Specdb::NmrOneD 8430 Specdb::NmrOneD 8431 Specdb::NmrOneD 8432 Specdb::NmrOneD 8433 Specdb::NmrOneD 8434 Specdb::NmrOneD 8435 Specdb::NmrOneD 8436 Specdb::NmrOneD 8437 Specdb::NmrOneD 8438 Specdb::NmrOneD 8439 Specdb::NmrOneD 8440 Specdb::NmrOneD 8441 Specdb::CMs 23814 Specdb::CMs 37907 Specdb::CMs 130632 Specdb::CMs 138366 HMDB01056 15633 DHF #<Reference:0x000055ce32505428> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Dihydrofolate reductase P00374 DHFR Folylpolyglutamate synthase, mitochondrial Q05932 FPGS Thymidylate synthase P04818 TYMS