1.0 2011-09-21 00:13:46 UTC 2015-07-21 06:57:12 UTC FDB022422 5a-Cholesta-8,24-dien-3-one 5a-Cholesta-8,24-dien-3-one is an intermediate in the cholesterol synthesis pathway, the by-product of the Sterol-4-alpha-carboxylate 3-dehydrogenase enzyme [EC 1.1.1.70], and the substrate of the 3-keto-steroid reductase enzyme [EC 1.1.1.270]. (BioCyc, ExPASy) [HMDB] 5alpha-cholesta-8,24-dien-3-one C27H42O 382.6218 382.323565966 (2S,11R,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylhept-5-en-2-yl]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-5-one 5a-cholesta-8,24-dien-3-one [H][C@@]12CC[C@H]([C@H](C)CCC=C(C)C)[C@@]1(C)CCC1=C2CCC2CC(=O)CC[C@]12C InChI=1S/C27H42O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-20,23-24H,6,8-17H2,1-5H3/t19-,20?,23-,24+,26+,27-/m1/s1 AUNLIRXIJAVBNM-YBXLEUBGSA-N belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. Cholesterols and derivatives Organic compounds Lipids and lipid-like molecules Steroids and steroid derivatives Cholestane steroids Aliphatic homopolycyclic compounds 3-oxosteroids Cyclic ketones Hydrocarbon derivatives Organic oxides 3-oxosteroid Aliphatic homopolycyclic compound Carbonyl group Cholesterol-skeleton Cyclic ketone Hydrocarbon derivative Ketone Organic oxide Organic oxygen compound Organooxygen compound Oxosteroid Solid logp 6.92 ALOGPS logs -5.73 ALOGPS solubility 7.11e-04 g/l ALOGPS logp 6.87 ChemAxon pka_strongest_acidic 19.96 ChemAxon pka_strongest_basic -7.4 ChemAxon iupac (2S,11R,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylhept-5-en-2-yl]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-5-one ChemAxon average_mass 382.6218 ChemAxon mono_mass 382.323565966 ChemAxon smiles [H][C@@]12CC[C@H]([C@H](C)CCC=C(C)C)[C@@]1(C)CCC1=C2CCC2CC(=O)CC[C@]12C ChemAxon formula C27H42O ChemAxon inchi InChI=1S/C27H42O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-20,23-24H,6,8-17H2,1-5H3/t19-,20?,23-,24+,26+,27-/m1/s1 ChemAxon inchikey AUNLIRXIJAVBNM-YBXLEUBGSA-N ChemAxon polar_surface_area 17.07 ChemAxon refractivity 120.17 ChemAxon polarizability 48.85 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 14522 Specdb::CMs 133288 Specdb::CMs 141022 Specdb::MsMs 298054 Specdb::MsMs 298055 Specdb::MsMs 298056 Specdb::MsMs 339745 Specdb::MsMs 339746 Specdb::MsMs 339747 Specdb::MsMs 2780578 Specdb::MsMs 2780579 Specdb::MsMs 2780580 Specdb::MsMs 2925736 Specdb::MsMs 2925737 Specdb::MsMs 2925738 HMDB01093 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823