1.0 2011-09-21 00:13:48 UTC 2020-04-21 18:02:13 UTC FDB022426 N-Acetyl-beta-glucosaminylamine N-Acetyl-b-glucosaminylamine is the product of a reaction catalyzed vy the enzyme N(4)-(beta-N-acetylglucosaminyl)-L-asparaginase [EC 3.5.1.26, Aspartylglucosaminidase, AGA]. AGA is a key enzyme in the catabolism of N-linked oligosaccharides of glycoproteins. It cleaves the asparagine from the residual N-acetylglucosamines as one of the final steps in the lysosomal breakdown of glycoproteins. Aspartylglucosaminuria (AGU) is a lysosomal disease caused by deficiency of N-aspartyl-beta-glucosaminidase. AGU is the only known lysosomal storage disease caused by an amidase deficiency. (OMIM208400) [HMDB] N-[2-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]ethanamide N-acetyl-b-D-glucosaminylamine N-Acetyl-b-glucosaminylamine N-acetyl-beta-D-glucosaminylamine N-acetyl-beta-delta-glucosaminylamine N-acetyl-beta-glucosaminylamine N-Acetyl-β-D-glucosaminylamine C8H16N2O5 220.223 220.105921632 N-[(2R,3R,4R,5S,6R)-2-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide N-acetyl-β-D-glucosaminylamine CC(=O)N[C@H]1[C@H](N)O[C@H](CO)[C@@H](O)[C@@H]1O InChI=1S/C8H16N2O5/c1-3(12)10-5-7(14)6(13)4(2-11)15-8(5)9/h4-8,11,13-14H,2,9H2,1H3,(H,10,12)/t4-,5-,6-,7-,8-/m1/s1 MCGXOCXFFNKASF-FMDGEEDCSA-N belongs to the class of organic compounds known as hexoses. These are monosaccharides in which the sugar unit is a is a six-carbon containing moeity. Hexoses Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Acetamides Carbonyl compounds Hemiaminals Hydrocarbon derivatives Monoalkylamines Organic oxides Organopnictogen compounds Oxacyclic compounds Oxanes Primary alcohols Secondary alcohols Secondary carboxylic acid amides Acetamide Alcohol Aliphatic heteromonocyclic compound Carbonyl group Carboxamide group Carboxylic acid derivative Hemiaminal Hexose monosaccharide Hydrocarbon derivative Organic nitrogen compound Organic oxide Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Oxacycle Oxane Primary alcohol Primary aliphatic amine Secondary alcohol Secondary carboxylic acid amide glucosaminylamine Solid logp -2.52 ALOGPS logs 0.01 ALOGPS solubility 2.24e+02 g/l ALOGPS logp -3.3 ChemAxon pka_strongest_acidic 12.51 ChemAxon pka_strongest_basic 6.96 ChemAxon iupac N-[(2R,3R,4R,5S,6R)-2-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide ChemAxon average_mass 220.223 ChemAxon mono_mass 220.105921632 ChemAxon smiles CC(=O)N[C@H]1[C@H](N)O[C@H](CO)[C@@H](O)[C@@H]1O ChemAxon formula C8H16N2O5 ChemAxon inchi InChI=1S/C8H16N2O5/c1-3(12)10-5-7(14)6(13)4(2-11)15-8(5)9/h4-8,11,13-14H,2,9H2,1H3,(H,10,12)/t4-,5-,6-,7-,8-/m1/s1 ChemAxon inchikey MCGXOCXFFNKASF-FMDGEEDCSA-N ChemAxon polar_surface_area 125.04 ChemAxon refractivity 48.68 ChemAxon polarizability 21.58 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 6 ChemAxon donor_count 5 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 21222 Specdb::NmrOneD 21223 Specdb::NmrOneD 21224 Specdb::NmrOneD 21225 Specdb::NmrOneD 21226 Specdb::NmrOneD 21227 Specdb::NmrOneD 21228 Specdb::NmrOneD 21229 Specdb::NmrOneD 21230 Specdb::NmrOneD 21231 Specdb::NmrOneD 21232 Specdb::NmrOneD 21233 Specdb::NmrOneD 21234 Specdb::NmrOneD 21235 Specdb::NmrOneD 21236 Specdb::NmrOneD 21237 Specdb::NmrOneD 21238 Specdb::NmrOneD 21239 Specdb::NmrOneD 21240 Specdb::NmrOneD 21241 Specdb::CMs 13960 Specdb::CMs 37927 Specdb::CMs 156738 Specdb::MsMs 28070 Specdb::MsMs 28071 Specdb::MsMs 28072 Specdb::MsMs 34628 Specdb::MsMs 34629 Specdb::MsMs 34630 Specdb::MsMs 2231809 Specdb::MsMs 2234247 Specdb::MsMs 2234713 Specdb::MsMs 2694957 Specdb::MsMs 2694958 Specdb::MsMs 2694959 Specdb::MsMs 2987729 Specdb::MsMs 2987730 Specdb::MsMs 2987731 HMDB01104 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 N(4)-(beta-N-acetylglucosaminyl)-L-asparaginase P20933 AGA