1.0 2011-09-21 00:14:09 UTC 2015-10-09 22:31:14 UTC FDB022447 N-Acetylglutamic acid N-Acetylglutamic acid (abbreviated NAcGlu) is biosynthesized from glutamic acid and acetyl-CoA by the enzyme NAGS. The reverse reaction, hydrolysis of the acetyl group, is catalyzed by a specific hydrolase. [HMDB] 2-acetamido-L-Glutaraldehydate 2-acetamido-L-Glutaraldehydic acid Ac-Glu-OH acetyl-glutamate Acetyl-L-glutamate Acetyl-L-glutamic acid acetylglutamate acetylglutamic acid DL-Acetylglutamate DL-Acetylglutamic acid N-Ac-Glu-OH N-acetyl L-glutamate N-acetyl L-glutamic acid N-Acetyl-DL-glutamate N-Acetyl-DL-glutamic acid N-acetyl-Glutamate N-acetyl-Glutamic acid N-Acetyl-L-glutamate N-Acetyl-L-glutamic acid N-Acetyl-L-glutamic acid-gamma-semialdehyde N-Acetylglutamate N-Acetylglutamic acid N-Acetylglutamic gamma-semialdehyde C7H11NO5 189.1659 189.063722467 2-acetamidopentanedioic acid acetylglutamate 1188-37-0 CC(=O)NC(CCC(O)=O)C(O)=O InChI=1S/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13) RFMMMVDNIPUKGG-UHFFFAOYSA-N belongs to the class of organic compounds known as glutamic acid and derivatives. Glutamic acid and derivatives are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Glutamic acid and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Acetamides Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Fatty acids and conjugates Hydrocarbon derivatives N-acyl-alpha amino acids Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Acetamide Aliphatic acyclic compound Carbonyl group Carboxamide group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Glutamic acid or derivatives Hydrocarbon derivative N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide Solid logp -0.48 ALOGPS logs -1.55 ALOGPS solubility 5.30e+00 g/l ALOGPS logp -1.1 ChemAxon pka_strongest_acidic 3.43 ChemAxon pka_strongest_basic -1.8 ChemAxon iupac 2-acetamidopentanedioic acid ChemAxon average_mass 189.1659 ChemAxon mono_mass 189.063722467 ChemAxon smiles CC(=O)NC(CCC(O)=O)C(O)=O ChemAxon formula C7H11NO5 ChemAxon inchi InChI=1S/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13) ChemAxon inchikey RFMMMVDNIPUKGG-UHFFFAOYSA-N ChemAxon polar_surface_area 103.7 ChemAxon refractivity 40.73 ChemAxon polarizability 17.28 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1589 Specdb::CMs 19690 Specdb::CMs 37943 Specdb::MsMs 1430 Specdb::MsMs 1431 Specdb::MsMs 1432 Specdb::MsMs 5047 Specdb::MsMs 5048 Specdb::MsMs 309811 Specdb::MsMs 309812 Specdb::MsMs 309813 Specdb::MsMs 354343 Specdb::MsMs 354344 Specdb::MsMs 354345 Specdb::MsMs 439260 Specdb::MsMs 448198 Specdb::NmrOneD 1292 Specdb::NmrOneD 1648 Specdb::NmrOneD 4443 Specdb::NmrOneD 4562 Specdb::NmrOneD 298765 Specdb::NmrOneD 298766 Specdb::NmrOneD 298767 Specdb::NmrOneD 298768 Specdb::NmrOneD 298769 Specdb::NmrOneD 298770 Specdb::NmrOneD 298771 Specdb::NmrOneD 298772 Specdb::NmrOneD 298773 Specdb::NmrOneD 298774 Specdb::NmrOneD 298775 Specdb::NmrOneD 298776 Specdb::NmrOneD 298777 Specdb::NmrOneD 298778 Specdb::NmrOneD 298779 Specdb::NmrOneD 298780 Specdb::NmrOneD 298781 Specdb::NmrOneD 298782 Specdb::NmrOneD 298783 Specdb::NmrOneD 298784 HMDB01138 12575 1GS5 #<Reference:0x000055ce31eb6928> #<Reference:0x000055ce31eb6748> #<Reference:0x000055ce31eb6540> #<Reference:0x000055ce31eb6360> #<Reference:0x000055ce31eb6180> Carbamoyl-phosphate synthase [ammonia], mitochondrial P31327 CPS1 Glycine N-acyltransferase Q6IB77 GLYAT Glycine N-acyltransferase-like protein 1 Q969I3 GLYATL1 Glycine N-acyltransferase-like protein 2 Q8WU03 GLYATL2 N-acetylglutamate synthase, mitochondrial Q8N159 NAGS