1.0 2011-09-21 00:14:14 UTC 2025-11-19 02:41:43 UTC FDB022451 Aminomalonic acid Aminomalonic acid (Ama) was first detected in alkaline hydrolysates of proteins in 1984. Ama has been isolated from proteins of Escherichia coli and human atherosclerotic plaque. The presence of Ama has important biological implications because the malonic acid moiety potentially imparts calcium binding properties to protein. Ama is not formed from any of the 20 major amino acids during the hydrolysis procedure. Furthermore, the amount of Ama found does not depend on the presence of small amounts of O2 during the hydrolysis. No artifactual formation of ama has been demonstrated and may indeed be a constituent of proteins before the hydrolysis procedure. Possible origins of Ama include errors in protein synthesis and oxidative damage to amino acid residues in proteins. (PMID: 1621954, 6366787) [HMDB] 2-Aminomalonate 2-Aminomalonic acid a-aminomalonic acid alpha-aminomalonic acid amino-Malonic acid amino-Propanedioate amino-Propanedioic acid Aminomalonate aminomalonic acid Aminopropanedioate Aminopropanedioic acid C3H5NO4 119.0761 119.021857653 2-aminopropanedioic acid aminomalonic acid 1068-84-4 NC(C(O)=O)C(O)=O InChI=1S/C3H5NO4/c4-1(2(5)6)3(7)8/h1H,4H2,(H,5,6)(H,7,8) JINBYESILADKFW-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds 1,3-dicarbonyl compounds Amino acids Carboxylic acids Dicarboxylic acids and derivatives Hydrocarbon derivatives Monoalkylamines Organic oxides Organopnictogen compounds 1,3-dicarbonyl compound Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Carbonyl group Carboxylic acid Dicarboxylic acid or derivatives Hydrocarbon derivative Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine amino dicarboxylic acid Solid logp -3.50 ALOGPS logs 0.03 ALOGPS solubility 1.26e+02 g/l ALOGPS logp -3.4 ChemAxon pka_strongest_acidic 0.45 ChemAxon pka_strongest_basic 8.5 ChemAxon iupac 2-aminopropanedioic acid ChemAxon average_mass 119.0761 ChemAxon mono_mass 119.021857653 ChemAxon smiles NC(C(O)=O)C(O)=O ChemAxon formula C3H5NO4 ChemAxon inchi InChI=1S/C3H5NO4/c4-1(2(5)6)3(7)8/h1H,4H2,(H,5,6)(H,7,8) ChemAxon inchikey JINBYESILADKFW-UHFFFAOYSA-N ChemAxon polar_surface_area 100.62 ChemAxon refractivity 21.98 ChemAxon polarizability 9.48 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 1033 Specdb::CMs 1107 Specdb::CMs 22533 Specdb::CMs 31279 Specdb::CMs 31280 Specdb::CMs 32362 Specdb::CMs 37947 Specdb::CMs 158171 Specdb::MsIr 1100 Specdb::MsIr 1101 Specdb::MsIr 1102 Specdb::NmrOneD 146610 Specdb::NmrOneD 146611 Specdb::NmrOneD 146612 Specdb::NmrOneD 146613 Specdb::NmrOneD 146614 Specdb::NmrOneD 146615 Specdb::NmrOneD 146616 Specdb::NmrOneD 146617 Specdb::NmrOneD 146618 Specdb::NmrOneD 146619 Specdb::NmrOneD 146620 Specdb::NmrOneD 146621 Specdb::NmrOneD 146622 Specdb::NmrOneD 146623 Specdb::NmrOneD 146624 Specdb::NmrOneD 146625 Specdb::NmrOneD 146626 Specdb::NmrOneD 146627 Specdb::NmrOneD 146628 Specdb::NmrOneD 146629 Specdb::MsMs 27068 Specdb::MsMs 27069 Specdb::MsMs 27070 Specdb::MsMs 33626 Specdb::MsMs 33627 Specdb::MsMs 33628 Specdb::MsMs 2226262 Specdb::MsMs 2228661 Specdb::MsMs 2230766 Specdb::MsMs 2664256 Specdb::MsMs 2664257 Specdb::MsMs 2664258 Specdb::MsMs 3017607 Specdb::MsMs 3017608 Specdb::MsMs 3017609 HMDB01147 17475 FGL #<Reference:0x000055ce2da2b678> #<Reference:0x000055ce2da23bd0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823