1.0 2011-09-21 00:15:10 UTC 2015-07-21 06:57:15 UTC FDB022514 5,6-Dihydroxyindole-2-carboxylic acid 5,6-Dihydroxyindole-2-carboxylic acid is an intermediate in the metabolism of Tyrosine. It is a substrate for Dopachrome tautomerase. [HMDB] 5,6-Dhica 5,6-Dihydroxy-1H-indole-2-carboxylate 5,6-Dihydroxy-1H-indole-2-carboxylic acid 5,6-Dihydroxy-2-indolecarboxylate 5,6-Dihydroxy-2-indolecarboxylic acid 5,6-Dihydroxy-2-indolylcarboxylate 5,6-Dihydroxy-2-indolylcarboxylic acid 5,6-Dihydroxyindole-2-carboxylate DHI2C DHICA C9H7NO4 193.1562 193.037507717 5,6-dihydroxy-1H-indole-2-carboxylic acid dhica 4790-08-3 OC(=O)C1=CC2=C(N1)C=C(O)C(O)=C2 InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h1-3,10-12H,(H,13,14) YFTGOBNOJKXZJC-UHFFFAOYSA-N belongs to the class of organic compounds known as indolecarboxylic acids and derivatives. Indolecarboxylic acids and derivatives are compounds containing a carboxylic acid group (or a derivative thereof) linked to an indole. Indolecarboxylic acids and derivatives Organic compounds Organoheterocyclic compounds Indoles and derivatives Indolecarboxylic acids and derivatives Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids Azacyclic compounds Carboxylic acids Heteroaromatic compounds Hydrocarbon derivatives Hydroxyindoles Indoles Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Pyrrole 2-carboxylic acids Substituted pyrroles 1-hydroxy-2-unsubstituted benzenoid Aromatic heteropolycyclic compound Azacycle Benzenoid Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Hydrocarbon derivative Hydroxyindole Indole Indolecarboxylic acid derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrole Pyrrole-2-carboxylic acid Pyrrole-2-carboxylic acid or derivatives Substituted pyrrole dihydroxyindole Solid logp 1.11 ALOGPS logs -1.92 ALOGPS solubility 2.31e+00 g/l ALOGPS logp 1.04 ChemAxon pka_strongest_acidic 5.11 ChemAxon pka_strongest_basic -6.3 ChemAxon iupac 5,6-dihydroxy-1H-indole-2-carboxylic acid ChemAxon average_mass 193.1562 ChemAxon mono_mass 193.037507717 ChemAxon smiles OC(=O)C1=CC2=C(N1)C=C(O)C(O)=C2 ChemAxon formula C9H7NO4 ChemAxon inchi InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h1-3,10-12H,(H,13,14) ChemAxon inchikey YFTGOBNOJKXZJC-UHFFFAOYSA-N ChemAxon polar_surface_area 93.55 ChemAxon refractivity 48.24 ChemAxon polarizability 18.17 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Tyrosine Metabolism SMP00006 map00350 Specdb::MsIr 1156 Specdb::MsIr 1157 Specdb::MsIr 1158 Specdb::CMs 18920 Specdb::CMs 37994 Specdb::CMs 169955 Specdb::NmrOneD 8982 Specdb::NmrOneD 8983 Specdb::NmrOneD 8984 Specdb::NmrOneD 8985 Specdb::NmrOneD 8986 Specdb::NmrOneD 8987 Specdb::NmrOneD 8988 Specdb::NmrOneD 8989 Specdb::NmrOneD 8990 Specdb::NmrOneD 8991 Specdb::NmrOneD 8992 Specdb::NmrOneD 8993 Specdb::NmrOneD 8994 Specdb::NmrOneD 8995 Specdb::NmrOneD 8996 Specdb::NmrOneD 8997 Specdb::NmrOneD 8998 Specdb::NmrOneD 8999 Specdb::NmrOneD 9000 Specdb::NmrOneD 9001 Specdb::MsMs 308026 Specdb::MsMs 308027 Specdb::MsMs 308028 Specdb::MsMs 352108 Specdb::MsMs 352109 Specdb::MsMs 352110 Specdb::MsMs 2329446 Specdb::MsMs 2329447 Specdb::MsMs 2329448 Specdb::MsMs 2636200 Specdb::MsMs 2636201 Specdb::MsMs 2636202 HMDB01253 16875 #<Reference:0x00007f9418f44b98> #<Reference:0x00007f9418f449e0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Macrophage migration inhibitory factor P14174 MIF