1.0 2011-09-21 00:15:52 UTC 2015-07-21 06:57:15 UTC FDB022559 2-Amino-3-carboxymuconic acid semialdehyde 2-amino-3-carboxymuconic acid semialdehyde is an intermediate metabolite of the tryptophan-niacin catabolic pathway. Current interest in the degradation of tryptophan is mostly due to the role of quinolinate and other metabolites in several neuropathological conditions. Quinolinate is a neurotoxin formed nonenzymatically from 2-amino-3-carboxymuconic semialdehyde in mammalian tissues. 2-Amino-3-carboxymuconic semialdehyde is enzymatically converted to 2-aminomuconate via 2-aminomuconic semialdehyde. (PMID: 10510494, 16267312, 14275129) [HMDB] 2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioate 2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioic acid 2-Amino-3-(3-oxoprop-1-enyl)-but-2-enedioate 2-Amino-3-(3-oxoprop-1-enyl)-but-2-enedioic acid 2-amino-3-carboxymuconate semialdehyde 2-amino-3-carboxymuconate-6-semialdehyde ACS Amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioate Amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioic acid C7H7NO5 185.1342 185.032422339 2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioic acid 2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioic acid 16597-58-3 NC(C(O)=O)=C(C=CC=O)C(O)=O InChI=1S/C7H7NO5/c8-5(7(12)13)4(6(10)11)2-1-3-9/h1-3H,8H2,(H,10,11)(H,12,13) KACPVQQHDVBVFC-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Aldehydes Amino acids Amino fatty acids Branched fatty acids Carboxylic acids Dicarboxylic acids and derivatives Enals Enamines Hydrocarbon derivatives Medium-chain fatty acids Monoalkylamines Organic oxides Organopnictogen compounds Unsaturated fatty acids Vinylogous amides Aldehyde Aliphatic acyclic compound Alpha,beta-unsaturated aldehyde Alpha-amino acid Amine Amino acid Amino fatty acid Branched fatty acid Carbonyl group Carboxylic acid Dicarboxylic acid or derivatives Enal Enamine Fatty acid Fatty acyl Hydrocarbon derivative Medium-chain fatty acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Unsaturated fatty acid Vinylogous amide amino dicarboxylic acid muconic semialdehyde non-proteinogenic alpha-amino acid oxo dicarboxylic acid Solid logp -0.05 ALOGPS logs -2.05 ALOGPS solubility 1.64e+00 g/l ALOGPS logp -3.7 ChemAxon pka_strongest_acidic 2.38 ChemAxon pka_strongest_basic 6.72 ChemAxon iupac 2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioic acid ChemAxon average_mass 185.1342 ChemAxon mono_mass 185.032422339 ChemAxon smiles NC(C(O)=O)=C(C=CC=O)C(O)=O ChemAxon formula C7H7NO5 ChemAxon inchi InChI=1S/C7H7NO5/c8-5(7(12)13)4(6(10)11)2-1-3-9/h1-3H,8H2,(H,10,11)(H,12,13) ChemAxon inchikey KACPVQQHDVBVFC-UHFFFAOYSA-N ChemAxon polar_surface_area 117.69 ChemAxon refractivity 43.62 ChemAxon polarizability 16.01 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 6 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Tryptophan Metabolism SMP00063 map00380 Specdb::CMs 2420 Specdb::NmrOneD 285615 Specdb::NmrOneD 285616 Specdb::NmrOneD 285617 Specdb::NmrOneD 285618 Specdb::NmrOneD 285619 Specdb::NmrOneD 285620 Specdb::NmrOneD 285621 Specdb::NmrOneD 285622 Specdb::NmrOneD 285623 Specdb::NmrOneD 285624 Specdb::NmrOneD 285625 Specdb::NmrOneD 285626 Specdb::NmrOneD 285627 Specdb::NmrOneD 285628 Specdb::NmrOneD 285629 Specdb::NmrOneD 285630 Specdb::NmrOneD 285631 Specdb::NmrOneD 285632 Specdb::NmrOneD 285633 Specdb::NmrOneD 285634 Specdb::MsMs 178113 Specdb::MsMs 178114 Specdb::MsMs 178115 Specdb::MsMs 180429 Specdb::MsMs 180430 Specdb::MsMs 180431 HMDB01330 29044 #<Reference:0x00005612717dc7b8> #<Reference:0x00005612717dc600> #<Reference:0x00005612717dc448> #<Reference:0x00005612717dc290> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Q8TDX5 ACMSD 3-hydroxyanthranilate 3,4-dioxygenase P46952 HAAO