1.0 2011-09-21 00:16:39 UTC 2025-11-19 02:42:04 UTC FDB022596 N-Methylphenylethanolamine N-Methylphenylethanolamine is an intermediate in the metabolism of Tyrosine. It is a substrate for Phenylethanolamine N-methyltransferase. [HMDB] (+-)-a-((Methylamino)methyl)benzenemethanol (+-)-alpha-((Methylamino)methyl)benzenemethanol (+-)-Halostachine (+-)-α-((methylamino)methyl)benzenemethanol 2-(Methylamino)-1-phenylethanol 2-Methylamino-1-phenylethanol alpha-((methylamino)methyl)-dl-Benzyl alcohol alpha-(methylaminomethyl)benzyl alcohol dl-alpha-(Methylaminomethyl)benzyl alcohol Halostachine N-Methylphenylethanolamine C9H13NO 151.2056 151.099714043 2-(methylamino)-1-phenylethan-1-ol halostachine 68579-60-2 CNCC(O)C1=CC=CC=C1 InChI=1S/C9H13NO/c1-10-7-9(11)8-5-3-2-4-6-8/h2-6,9-11H,7H2,1H3 ZCTYHONEGJTYQV-UHFFFAOYSA-N belongs to the class of organic compounds known as aralkylamines. These are alkylamines in which the alkyl group is substituted at one carbon atom by an aromatic hydrocarbyl group. Aralkylamines Organic compounds Organic nitrogen compounds Organonitrogen compounds Amines Aromatic homomonocyclic compounds 1,2-aminoalcohols Aromatic alcohols Benzene and substituted derivatives Dialkylamines Hydrocarbon derivatives Organopnictogen compounds Secondary alcohols 1,2-aminoalcohol Alcohol Aralkylamine Aromatic alcohol Aromatic homomonocyclic compound Benzenoid Hydrocarbon derivative Monocyclic benzene moiety Organic oxygen compound Organooxygen compound Organopnictogen compound Secondary alcohol Secondary aliphatic amine Secondary amine alkaloid phenylethanolamines Solid logp 0.73 ALOGPS logs -0.90 ALOGPS solubility 1.91e+01 g/l ALOGPS logp 0.9 ChemAxon pka_strongest_acidic 14.12 ChemAxon pka_strongest_basic 9.43 ChemAxon iupac 2-(methylamino)-1-phenylethan-1-ol ChemAxon average_mass 151.2056 ChemAxon mono_mass 151.099714043 ChemAxon smiles CNCC(O)C1=CC=CC=C1 ChemAxon formula C9H13NO ChemAxon inchi InChI=1S/C9H13NO/c1-10-7-9(11)8-5-3-2-4-6-8/h2-6,9-11H,7H2,1H3 ChemAxon inchikey ZCTYHONEGJTYQV-UHFFFAOYSA-N ChemAxon polar_surface_area 32.26 ChemAxon refractivity 45.27 ChemAxon polarizability 17.26 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 1239 Specdb::MsIr 1240 Specdb::MsIr 1241 Specdb::CMs 22800 Specdb::CMs 32242 Specdb::CMs 32243 Specdb::CMs 38048 Specdb::CMs 99679 Specdb::CMs 99680 Specdb::CMs 175101 Specdb::NmrOneD 297375 Specdb::NmrOneD 297376 Specdb::NmrOneD 297377 Specdb::NmrOneD 297378 Specdb::NmrOneD 297379 Specdb::NmrOneD 297380 Specdb::NmrOneD 297381 Specdb::NmrOneD 297382 Specdb::NmrOneD 297383 Specdb::NmrOneD 297384 Specdb::NmrOneD 297385 Specdb::NmrOneD 297386 Specdb::NmrOneD 297387 Specdb::NmrOneD 297388 Specdb::NmrOneD 297389 Specdb::NmrOneD 297390 Specdb::NmrOneD 297391 Specdb::NmrOneD 297392 Specdb::NmrOneD 297393 Specdb::NmrOneD 297394 Specdb::MsMs 26009 Specdb::MsMs 26010 Specdb::MsMs 26011 Specdb::MsMs 32567 Specdb::MsMs 32568 Specdb::MsMs 32569 Specdb::MsMs 2425519 Specdb::MsMs 2425520 Specdb::MsMs 2425521 Specdb::MsMs 2510635 Specdb::MsMs 2510636 Specdb::MsMs 2510637 HMDB01387 16913 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823