1.0 2011-09-21 00:16:57 UTC 2015-07-21 06:57:17 UTC FDB022618 L-Dopachrome The non-decarboxylative tautomerization of L-dopachrome to 5,6-dihydroxyindole-2-carboxylic acid in the melanin biosynthetic pathway is catalyzed by Tyrosinase-related protein-2, a melanocyte-specific enzyme. (PMID 11095412) [HMDB] 2-L-carboxy-2,3-dihydroindole-5,6-quinone L-dopachrome C9H7NO4 193.1562 193.037507717 (2S)-5,6-dioxo-2,4,5,6-tetrahydro-1H-indole-2-carboxylic acid L-dopachrome 89762-39-0 OC(=O)[C@H]1NC2=CC(=O)C(=O)CC2=C1 InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h1,3,6,10H,2H2,(H,13,14)/t6-/m0/s1 CKZOQLKEDKSKJR-LURJTMIESA-N belongs to the class of organic compounds known as l-alpha-amino acids. These are alpha amino acids which have the L-configuration of the alpha-carbon atom. L-alpha-amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic heteropolycyclic compounds Amino acids Azacyclic compounds Carboxylic acids Cyclohexenones Dialkylamines Enamines Hydrocarbon derivatives Indoles and derivatives Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Pyrroline carboxylic acids Vinylogous amides Aliphatic heteropolycyclic compound Amine Amino acid Azacycle Carbonyl group Carboxylic acid Cyclic ketone Cyclohexenone Enamine Hydrocarbon derivative Indole or derivatives Ketone L-alpha-amino acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrroline Pyrroline carboxylic acid Pyrroline carboxylic acid or derivatives Secondary aliphatic amine Secondary amine Vinylogous amide Solid logp 0.16 ALOGPS logs -1.21 ALOGPS solubility 1.19e+01 g/l ALOGPS logp -0.29 ChemAxon pka_strongest_acidic 3.61 ChemAxon pka_strongest_basic -8.8 ChemAxon iupac (2S)-5,6-dioxo-2,4,5,6-tetrahydro-1H-indole-2-carboxylic acid ChemAxon average_mass 193.1562 ChemAxon mono_mass 193.037507717 ChemAxon smiles OC(=O)[C@H]1NC2=CC(=O)C(=O)CC2=C1 ChemAxon formula C9H7NO4 ChemAxon inchi InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h1,3,6,10H,2H2,(H,13,14)/t6-/m0/s1 ChemAxon inchikey CKZOQLKEDKSKJR-LURJTMIESA-N ChemAxon polar_surface_area 83.47 ChemAxon refractivity 47.75 ChemAxon polarizability 17.55 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 5 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Tyrosine Metabolism SMP00006 map00350 Specdb::CMs 15166 Specdb::CMs 38070 Specdb::MsMs 299641 Specdb::MsMs 299642 Specdb::MsMs 299643 Specdb::MsMs 341704 Specdb::MsMs 341705 Specdb::MsMs 341706 HMDB01430 15772 #<Reference:0x000055ac40613888> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Macrophage migration inhibitory factor P14174 MIF