1.0 2011-09-21 00:17:04 UTC 2025-11-19 02:42:08 UTC FDB022626 Phosphite The phosphite ion (PO3) is a polyatomic ion with a phosphorus central atom. Its geometry is tetrahedral. Many phosphite salts, such as ammonium phosphite, are highly water solubleand is) also organophosphorus compounds with the formula P(OR)3.; The conjugate acid of the phosphite anion is phosphorous acid (H3PO3). Other names for this acid are orthophosphorous acid and dihydroxyphosphine oxide. H3PO3 is also sometimes referred to as phosphorus trihydroxide and trihydroxyphosphine, though these names are misleading. Phosphorous acid is a diprotic acid, since the hydrogen bonded directly to the central phosphorus atom is not ionizable. Thus, a more logical chemical formula for phosphorous acid is HPO(OH)2, since three hydroxy groups are not actually present on the acid. The acid can be synthesized hy treatment of a carboxylic acid, alcohol, or most practically water, with phosphorus tribromide or more commonly phosphorus trichloride. [HMDB] [PO3](3-) Hyopoite Hyopophosphite Hypoorous acid Hypophosphorous acid Inate Inic acid It Ite ITE ion Ite ions OrthoIte Orthophosphite Phosphinate Phosphinic acid Phosphit phosphite Phosphite ion Phosphite ions PO3(3-) Trioxidoate trioxidophosphate Trioxoate trioxophosphate HO3P 79.9799 79.96633041 phosphonate phosphonate 14901-63-4 [O-]P([O-])=O InChI=1S/H3O3P/c1-4(2)3/h4H,(H2,1,2,3)/p-2 ABLZXFCXXLZCGV-UHFFFAOYSA-L belongs to the class of inorganic compounds known as non-metal phosphonates. These are inorganic non-metallic compounds containing a phosphonate as its largest oxoanion. Non-metal phosphonates Inorganic compounds Homogeneous non-metal compounds Non-metal oxoanionic compounds Non-metal phosphonates Inorganic oxides Inorganic oxide Non-metal phosphonate an inorganic phosphorus-containing ion divalent inorganic anion phosphorus oxoanion Solid logp -1.4 ChemAxon pka_strongest_acidic 2.07 ChemAxon iupac phosphonate ChemAxon average_mass 79.9799 ChemAxon mono_mass 79.96633041 ChemAxon smiles [O-]P([O-])=O ChemAxon formula HO3P ChemAxon inchi InChI=1S/H3O3P/c1-4(2)3/h4H,(H2,1,2,3)/p-2 ChemAxon inchikey ABLZXFCXXLZCGV-UHFFFAOYSA-L ChemAxon polar_surface_area 63.19 ChemAxon refractivity 10.33 ChemAxon polarizability 4.45 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 3 ChemAxon donor_count 0 ChemAxon physiological_charge -1 ChemAxon formal_charge -2 ChemAxon HMDB01443 29197 PO3 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Glutathione synthetase P48637 GSS