1.0 2011-09-21 00:19:11 UTC 2025-11-19 02:42:27 UTC FDB022761 3-Hydroxyoctanoic acid 3-Hydroxycaprylic acid is an organic (3-hydroxy dicarboxylic) acid, a metabolite of medium-chain fatty acid oxidation found in human urine. It is believed that urinary 3-hydroxy dicarboxylic acids are derived from the w-oxidation of 3-hydroxy fatty acids and the subsequent b-oxidation of longer-chain 3-hydroxy dicarboxylic acids. (PMID 1870421 ) [HMDB] (+/-)-3-Hydroxyoctanoate (+/-)-3-Hydroxyoctanoic acid 3-hydroxy caprylic acid 3-hydroxy-octanoate 3-hydroxy-octanoic acid 3-Hydroxycaprylate 3-Hydroxycaprylic acid 3-Hydroxyoctanoate 3-Hydroxyoctanoic acid 3-Hydroxyoctanoic acid homopolymer 3-OH Octanoate 3-OH Octanoic acid 3-OH-Caprylate 3-OH-Caprylic acid 3HO 8:0(3-OH) b-Hydroxycaprylate b-Hydroxycaprylic acid B-hydroxyoctanoate B-hydroxyoctanoic acid b-OH-Caprylate b-OH-Caprylic acid b-OH-Octanoate b-OH-Octanoic acid beta-Hydroxycaprylate beta-Hydroxycaprylic acid beta-hydroxyoctanoate beta-hydroxyoctanoic acid beta-OH-Caprylate beta-OH-Caprylic acid beta-OH-Octanoate beta-OH-Octanoic acid Poly-3-hydroxyoctanoate Poly-3-hydroxyoctanoic acid β-hydroxycaprylate β-hydroxycaprylic acid β-hydroxyoctanoate β-hydroxyoctanoic acid β-OH-caprylate β-OH-caprylic acid β-OH-octanoate β-OH-octanoic acid C8H16O3 160.2108 160.109944378 3-hydroxyoctanoic acid (+/-)-3-hydroxyoctanoic acid 14292-27-4 CCCCCC(O)CC(O)=O InChI=1S/C8H16O3/c1-2-3-4-5-7(9)6-8(10)11/h7,9H,2-6H2,1H3,(H,10,11) NDPLAKGOSZHTPH-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain hydroxy acids and derivatives. These are hydroxy acids with a 6 to 12 carbon atoms long side chain. Medium-chain hydroxy acids and derivatives Organic compounds Organic acids and derivatives Hydroxy acids and derivatives Medium-chain hydroxy acids and derivatives Aliphatic acyclic compounds Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Secondary alcohols Alcohol Aliphatic acyclic compound Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Hydrocarbon derivative Hydroxy fatty acid Medium-chain fatty acid Medium-chain hydroxy acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Secondary alcohol 3-hydroxy fatty acid 3-hydroxy monocarboxylic acid Hydroxy fatty acids medium-chain fatty acid Solid logp 1.44 ALOGPS logs -1.07 ALOGPS solubility 1.36e+01 g/l ALOGPS logp 1.47 ChemAxon pka_strongest_acidic 4.84 ChemAxon pka_strongest_basic -2.8 ChemAxon iupac 3-hydroxyoctanoic acid ChemAxon average_mass 160.2108 ChemAxon mono_mass 160.109944378 ChemAxon smiles CCCCCC(O)CC(O)=O ChemAxon formula C8H16O3 ChemAxon inchi InChI=1S/C8H16O3/c1-2-3-4-5-7(9)6-8(10)11/h7,9H,2-6H2,1H3,(H,10,11) ChemAxon inchikey NDPLAKGOSZHTPH-UHFFFAOYSA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 41.79 ChemAxon polarizability 18.14 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 1841 Specdb::CMs 20345 Specdb::CMs 31376 Specdb::CMs 38198 Specdb::MsMs 12377 Specdb::MsMs 12378 Specdb::MsMs 12379 Specdb::MsMs 19049 Specdb::MsMs 19050 Specdb::MsMs 19051 HMDB01954 37098 #<Reference:0x000055ce32032c20> #<Reference:0x000055ce32032a40> #<Reference:0x000055ce32032838> #<Reference:0x000055ce32032680> #<Reference:0x000055ce320324c8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823