1.0 2011-09-21 00:19:38 UTC 2025-11-19 02:42:30 UTC FDB022788 5-Methoxydimethyltryptamine 5-Methoxydimethyltryptamine, like all Methoxydimethyltryptamines is a compound that contain the biogenic monoamine tryptamine and is substituted with one methoxy group and two methyl groups. Members of this group include several potent serotonergic hallucinogens found in several unrelated plants, skins of certain toads, and in mammalian brains. They are possibly involved in the etiology of schizophrenia. (PubChem) They are formed as metabolites of serotonin (5-hydroxytryptamine) or tryptamine by the enzyme indolethylamine N-methyltransferase (INMT). The physiological significance of the N-methylating pathway of indoleamine metabolism, and of the methylated end products, is unknown. Because of the known psychotropic properties of the dimethylated amines, their possible involvement in the chemical pathogenesis of mental disorders has received wide interest. The hallucinogenic actions of the methylated indoleamines, like those of LSD, are believed to be mediated through the 5HT2 receptor. (PMID 11763413) [HMDB] 3-(2-(N,N-Dimethyl)aminoethyl)-5-methoxyindole 3-(2-Dimethylaminoethyl)-5-methoxyindole 3-[2-(N,N-dimethylamino)Ethyl]-5-methoxy-indole 5-MeO-dmt 5-methoxy-N,N-dimethyl-1H-Indole-3-ethanamine 5-Methoxy-N,N-dimethyl-1H-indole-3-ethylamine 5-Methoxy-N,N-dimethyltryptamine 5-methoxyindole 3-(2-(N,N-Dimethylamino)ethyl) Bufotenine, 5-Methoxydimethyltryptamine MeODMT Methoxybufotenin Methylbufotenine N,N-Dimethyl-5-methoxy tryptamine N,N-Dimethyl-5-methoxytryptamine O-methylbufotenine C13H18N2O 218.2948 218.141913208 [2-(5-methoxy-1H-indol-3-yl)ethyl]dimethylamine 5-MeO-DMT 1019-45-0 COC1=CC2=C(NC=C2CCN(C)C)C=C1 InChI=1S/C13H18N2O/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3 ZSTKHSQDNIGFLM-UHFFFAOYSA-N belongs to the class of organic compounds known as tryptamines and derivatives. Tryptamines and derivatives are compounds containing the tryptamine backbone, which is structurally characterized by an indole ring substituted at the 3-position by an ethanamine. Tryptamines and derivatives Organic compounds Organoheterocyclic compounds Indoles and derivatives Tryptamines and derivatives Aromatic heteropolycyclic compounds 3-alkylindoles Alkaloids and derivatives Alkyl aryl ethers Anisoles Aralkylamines Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Organopnictogen compounds Substituted pyrroles Trialkylamines 3-alkylindole Alkaloid or derivatives Alkyl aryl ether Amine Anisole Aralkylamine Aromatic heteropolycyclic compound Azacycle Benzenoid Ether Heteroaromatic compound Hydrocarbon derivative Indole Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrole Substituted pyrrole Tertiary aliphatic amine Tertiary amine Tryptamine Indole alkaloids aromatic ether tertiary amino compound tryptamine alkaloid Solid logp 2.38 ALOGPS logs -2.48 ALOGPS solubility 7.23e-01 g/l ALOGPS logp 2.14 ChemAxon pka_strongest_acidic 17.44 ChemAxon pka_strongest_basic 9.58 ChemAxon iupac [2-(5-methoxy-1H-indol-3-yl)ethyl]dimethylamine ChemAxon average_mass 218.2948 ChemAxon mono_mass 218.141913208 ChemAxon smiles COC1=CC2=C(NC=C2CCN(C)C)C=C1 ChemAxon formula C13H18N2O ChemAxon inchi InChI=1S/C13H18N2O/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3 ChemAxon inchikey ZSTKHSQDNIGFLM-UHFFFAOYSA-N ChemAxon polar_surface_area 28.26 ChemAxon refractivity 66.91 ChemAxon polarizability 25.47 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1773 Specdb::NmrOneD 1833 Specdb::NmrOneD 166596 Specdb::CMs 19286 Specdb::CMs 137992 Specdb::CMs 145726 Specdb::MsMs 6329 Specdb::MsMs 6330 Specdb::MsMs 6331 Specdb::MsMs 6332 Specdb::MsMs 6333 Specdb::MsMs 6334 Specdb::MsMs 6335 Specdb::MsMs 308845 Specdb::MsMs 308846 Specdb::MsMs 308847 Specdb::MsMs 353128 Specdb::MsMs 353129 Specdb::MsMs 353130 Specdb::MsMs 374760 Specdb::MsMs 446580 Specdb::MsMs 446581 Specdb::MsMs 446582 Specdb::MsMs 446583 Specdb::MsMs 446584 Specdb::MsMs 447241 Specdb::MsMs 451429 Specdb::MsMs 2667280 Specdb::MsMs 2667281 Specdb::MsMs 2667282 Specdb::MsMs 3012086 HMDB02004 #<Reference:0x000055ce3246a928> #<Reference:0x000055ce3246a720> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823