1.0 2011-09-21 00:19:56 UTC 2025-11-19 02:42:33 UTC FDB022809 8-Hydroxyguanine Formation of 8-hydroxyguanine (8-OHG), a mutagenic base which is a marker for OH-mediated DNA damage, requires peroxidase and halides and occurs in the presence of transition metal chelators (DTPA +/- desferrioxamine), and is inhibited by catalase, superoxide dismutase (SOD), and scavengers of hypohalous acids. (PMID 10820020) 8-Hydroxyguanine is an oxidative stress marker for diagnosis of Alzheimer's disease (AD). (PMID 15977989) [HMDB] 1H-Purine-6,8-dione, 2-amino-7,9-dihydro-1H-purine-6,8-dione 2-Amino-6,8-dihydroxypurine 2-amino-7,9-dihydro-1H-Purine-6,8-dione 2-amino-Purine-6,8-diol 2-Aminopurine-6,8-diol 7,8-Dihydro-8-oxoguanine 8-Hydroxyguanine 8-Oxoguanine C5H5N5O2 167.1255 167.044324429 2-amino-6,7,8,9-tetrahydro-1H-purine-6,8-dione 8-hydroxyguanine 5614-64-2 NC1=NC2=C(NC(=O)N2)C(=O)N1 InChI=1S/C5H5N5O2/c6-4-8-2-1(3(11)10-4)7-5(12)9-2/h(H5,6,7,8,9,10,11,12) CLGFIVUFZRGQRP-UHFFFAOYSA-N belongs to the class of organic compounds known as purines and purine derivatives. These are aromatic heterocyclic compounds containing a purine moiety, which is formed a pyrimidine-ring ring fused to an imidazole ring. Purines and purine derivatives Organic compounds Organoheterocyclic compounds Imidazopyrimidines Purines and purine derivatives Aromatic heteropolycyclic compounds Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Hydroxypyrimidines Imidazoles Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Aromatic heteropolycyclic compound Azacycle Azole Heteroaromatic compound Hydrocarbon derivative Hydroxypyrimidine Imidazole Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Purine Pyrimidine an aromatic compound oxopurine Solid logp -1.57 ALOGPS logs -1.93 ALOGPS solubility 1.94e+00 g/l ALOGPS logp -1.5 ChemAxon pka_strongest_acidic 7.35 ChemAxon pka_strongest_basic 3.95 ChemAxon iupac 2-amino-6,7,8,9-tetrahydro-1H-purine-6,8-dione ChemAxon average_mass 167.1255 ChemAxon mono_mass 167.044324429 ChemAxon smiles NC1=NC2=C(NC(=O)N2)C(=O)N1 ChemAxon formula C5H5N5O2 ChemAxon inchi InChI=1S/C5H5N5O2/c6-4-8-2-1(3(11)10-4)7-5(12)9-2/h(H5,6,7,8,9,10,11,12) ChemAxon inchikey CLGFIVUFZRGQRP-UHFFFAOYSA-N ChemAxon polar_surface_area 108.61 ChemAxon refractivity 47.81 ChemAxon polarizability 14.26 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 4 ChemAxon donor_count 4 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 19742 Specdb::CMs 136158 Specdb::CMs 143892 Specdb::MsIr 1550 Specdb::MsIr 1551 Specdb::MsIr 1552 Specdb::NmrOneD 327182 Specdb::NmrOneD 327183 Specdb::NmrOneD 327184 Specdb::NmrOneD 327185 Specdb::NmrOneD 327186 Specdb::NmrOneD 327187 Specdb::NmrOneD 327188 Specdb::NmrOneD 327189 Specdb::NmrOneD 327190 Specdb::NmrOneD 327191 Specdb::MsMs 309934 Specdb::MsMs 309935 Specdb::MsMs 309936 Specdb::MsMs 354496 Specdb::MsMs 354497 Specdb::MsMs 354498 Specdb::MsMs 2418016 Specdb::MsMs 2418017 Specdb::MsMs 2418018 Specdb::MsMs 2548231 Specdb::MsMs 2548232 Specdb::MsMs 2548233 HMDB02032 #<Reference:0x000055ce31814408> #<Reference:0x000055ce31814250> #<Reference:0x000055ce31814098> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823