1.0 2011-09-21 00:20:05 UTC 2015-07-21 06:57:22 UTC FDB022816 Dihydroxyfumaric acid Dihydroxyfumaric acid is a known generator of superoxide anions and by hydroxyl free radicals. Dihydroxyfumarate exposure can cause insulin inhibitory effects. It can spontaneously convert to hydroxypyruvate or to oxaloglycolate. [HMDB] (2-)dihydroxyfumarate (2E)-2,3-dihydroxybut-2-enedioate (2E)-2,3-dihydroxybut-2-enedioic acid 3,4,4-trihydroxy-2-oxobut-3-enoate 3,4,4-trihydroxy-2-oxobut-3-enoic acid DHF Dihydroxyfumarate Dihydroxyfumaric acid C4H4O6 148.071 148.00078786 3,4,4-trihydroxy-2-oxobut-3-enoic acid dihydroxy-fumaric acid 133-38-0 OC(O)=C(O)C(=O)C(O)=O InChI=1S/C4H4O6/c5-1(3(7)8)2(6)4(9)10/h5,7-8H,(H,9,10) KAPRQAPANAEVOD-UHFFFAOYSA-N belongs to the class of organic compounds known as short-chain keto acids and derivatives. These are keto acids with an alkyl chain the contains less than 6 carbon atoms. Short-chain keto acids and derivatives Organic compounds Organic acids and derivatives Keto acids and derivatives Short-chain keto acids and derivatives Aliphatic acyclic compounds Acryloyl compounds Alpha-branched alpha,beta-unsaturated ketones Alpha-hydroxy ketones Alpha-keto acids and derivatives Carboxylic acids Enones Hydrocarbon derivatives Hydroxy fatty acids Monocarboxylic acids and derivatives Organic oxides Polyols Unsaturated fatty acids Vinylogous acids Acryloyl-group Aliphatic acyclic compound Alpha,beta-unsaturated ketone Alpha-branched alpha,beta-unsaturated-ketone Alpha-hydroxy ketone Alpha-keto acid Carbonyl group Carboxylic acid Carboxylic acid derivative Enone Fatty acyl Hydrocarbon derivative Hydroxy fatty acid Ketone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Polyol Short-chain keto acid Unsaturated fatty acid Vinylogous acid Oxo fatty acids Solid logp -1.37 ALOGPS logs -1.02 ALOGPS solubility 1.41e+01 g/l ALOGPS logp -0.0088 ChemAxon pka_strongest_acidic 2.01 ChemAxon pka_strongest_basic -5.2 ChemAxon iupac 3,4,4-trihydroxy-2-oxobut-3-enoic acid ChemAxon average_mass 148.071 ChemAxon mono_mass 148.00078786 ChemAxon smiles OC(O)=C(O)C(=O)C(O)=O ChemAxon formula C4H4O6 ChemAxon inchi InChI=1S/C4H4O6/c5-1(3(7)8)2(6)4(9)10/h5,7-8H,(H,9,10) ChemAxon inchikey KAPRQAPANAEVOD-UHFFFAOYSA-N ChemAxon polar_surface_area 115.06 ChemAxon refractivity 37.86 ChemAxon polarizability 10.97 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 1574 Specdb::MsIr 1575 Specdb::MsIr 1576 Specdb::MsMs 301321 Specdb::MsMs 301322 Specdb::MsMs 301323 Specdb::MsMs 343816 Specdb::MsMs 343817 Specdb::MsMs 343818 Specdb::MsMs 2409745 Specdb::MsMs 2409746 Specdb::MsMs 2409747 Specdb::MsMs 2555380 Specdb::MsMs 2555381 Specdb::MsMs 2555382 Specdb::CMs 15953 Specdb::CMs 38243 Specdb::CMs 134871 Specdb::CMs 142605 HMDB02050 4593 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823