1.0 2011-09-21 00:20:07 UTC 2024-11-29 22:27:42 UTC FDB022819 Tiglyl-CoA Tiglyl-CoA, also known as tigloyl-CoA or tiglyl-coenzyme A, belongs to the class of organic compounds known as ortho cresols. These are organic compounds containing an ortho-cresol moiety, which consists of a benzene bearing one hydroxyl group at ring positions 1 and 2, respectively. Tiglyl-CoA is a strong basic compound (based on its pKa). Tiglyl-CoA exists in all living organisms, ranging from bacteria to humans. In humans, tiglyl-CoA is involved in the metabolic disorder called the 2-methyl-3-hydroxybutyryl-coa dehydrogenase deficiency pathway. (E)-2-Methylcrotonoyl-CoA (E)-2-Methylcrotonoyl-Coenzyme A 2-methylbut-2-enoyl-CoA 2-methylbut-2-enoyl-Coenzyme A 2-Methylcrotanoyl-CoA 2-Methylcrotanoyl-Coenzyme A 2-methylcrotonoyl-CoA 2-methylcrotonoyl-Coenzyme A 2-methylcrotonyl-CoA 2-methylcrotonyl-Coenzyme A methylcrotonoyl-CoA methylcrotonoyl-Coenzyme A methylcrotonyl-CoA methylcrotonyl-Coenzyme A tigloyl-CoA tigloyl-Coenzyme A tiglyl-CoA Tiglyl-coenzyme A trans-2-methylbut-2-enoyl-CoA trans-2-methylbut-2-enoyl-Coenzyme A C26H42N7O17P3S 849.635 849.157073179 {[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-({[hydroxy({hydroxy[3-hydroxy-2,2-dimethyl-3-({2-[(2-{[(2E)-2-methylbut-2-enoyl]sulfanyl}ethyl)carbamoyl]ethyl}carbamoyl)propoxy]phosphoryl}oxy)phosphoryl]oxy}methyl)oxolan-3-yl]oxy}phosphonic acid [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-({[hydroxy([hydroxy(3-hydroxy-2,2-dimethyl-3-({2-[(2-{[(2E)-2-methylbut-2-enoyl]sulfanyl}ethyl)carbamoyl]ethyl}carbamoyl)propoxy)phosphoryl]oxy)phosphoryl]oxy}methyl)oxolan-3-yl]oxyphosphonic acid C\C=C(/C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)N1C=NC2=C(N)N=CN=C12 InChI=1S/C26H42N7O17P3S/c1-5-14(2)25(38)54-9-8-28-16(34)6-7-29-23(37)20(36)26(3,4)11-47-53(44,45)50-52(42,43)46-10-15-19(49-51(39,40)41)18(35)24(48-15)33-13-32-17-21(27)30-12-31-22(17)33/h5,12-13,15,18-20,24,35-36H,6-11H2,1-4H3,(H,28,34)(H,29,37)(H,42,43)(H,44,45)(H2,27,30,31)(H2,39,40,41)/b14-5+/t15-,18-,19-,20?,24-/m1/s1 PMWATMXOQQZNBX-APMDNKNFSA-N belongs to the class of organic compounds known as ortho cresols. These are organic compounds containing an ortho-cresol moiety, which consists of a benzene bearing one hydroxyl group at ring positions 1 and 2, respectively. Ortho cresols Organic compounds Benzenoids Phenols Cresols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Hydrocarbon derivatives Organooxygen compounds Toluenes 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aromatic homomonocyclic compound Hydrocarbon derivative Monocyclic benzene moiety O-cresol Organic oxygen compound Organooxygen compound Toluene a methylphenol cresol Solid logp 0.12 ALOGPS logs -2.19 ALOGPS solubility 5.48e+00 g/l ALOGPS logp -4.1 ChemAxon pka_strongest_acidic 0.82 ChemAxon pka_strongest_basic 4.01 ChemAxon iupac {[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-({[hydroxy({hydroxy[3-hydroxy-2,2-dimethyl-3-({2-[(2-{[(2E)-2-methylbut-2-enoyl]sulfanyl}ethyl)carbamoyl]ethyl}carbamoyl)propoxy]phosphoryl}oxy)phosphoryl]oxy}methyl)oxolan-3-yl]oxy}phosphonic acid ChemAxon average_mass 849.635 ChemAxon mono_mass 849.157073179 ChemAxon smiles C\C=C(/C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)N1C=NC2=C(N)N=CN=C12 ChemAxon formula C26H42N7O17P3S ChemAxon inchi InChI=1S/C26H42N7O17P3S/c1-5-14(2)25(38)54-9-8-28-16(34)6-7-29-23(37)20(36)26(3,4)11-47-53(44,45)50-52(42,43)46-10-15-19(49-51(39,40)41)18(35)24(48-15)33-13-32-17-21(27)30-12-31-22(17)33/h5,12-13,15,18-20,24,35-36H,6-11H2,1-4H3,(H,28,34)(H,29,37)(H,42,43)(H,44,45)(H2,27,30,31)(H2,39,40,41)/b14-5+/t15-,18-,19-,20?,24-/m1/s1 ChemAxon inchikey PMWATMXOQQZNBX-APMDNKNFSA-N ChemAxon polar_surface_area 363.63 ChemAxon refractivity 186.89 ChemAxon polarizability 76.74 ChemAxon rotatable_bond_count 21 ChemAxon acceptor_count 17 ChemAxon donor_count 9 ChemAxon physiological_charge -4 ChemAxon formal_charge 0 ChemAxon Valine, Leucine and Isoleucine Degradation SMP00032 map00280 Metabolism and Physiological Effects of Tiglylglycine SMP0126840 Specdb::EiMs 3988 Specdb::NmrOneD 270338 Specdb::NmrOneD 270339 Specdb::NmrOneD 270340 Specdb::NmrOneD 270341 Specdb::NmrOneD 270342 Specdb::NmrOneD 270343 Specdb::NmrOneD 270344 Specdb::NmrOneD 270345 Specdb::NmrOneD 270346 Specdb::NmrOneD 270347 Specdb::NmrOneD 270348 Specdb::NmrOneD 270349 Specdb::NmrOneD 270350 Specdb::NmrOneD 270351 Specdb::NmrOneD 270352 Specdb::NmrOneD 270353 Specdb::NmrOneD 270354 Specdb::NmrOneD 270355 Specdb::NmrOneD 270356 Specdb::NmrOneD 270357 Specdb::MsMs 29735 Specdb::MsMs 29736 Specdb::MsMs 29737 Specdb::MsMs 36293 Specdb::MsMs 36294 Specdb::MsMs 36295 HMDB02054 15478 #<Reference:0x000055ac40abe018> Abiyuch Type 1 specific Crateva religiosa 202634 Acerola Type 1 specific Malpighia emarginata 151847 Acorn Type 1 specific Quercus 3511 Acorn squash Type 1 Cucurbita pepo var. turbinata Adzuki bean Type 1 specific Vigna angularis 3914 Agave Type 1 specific Agave 39509 Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 Alaska wild rhubarb Type 1 specific Polygonum alpinum 125586 Albizia gummifera Type 1 Albizia gummifera Alfalfa Type 1 specific Medicago sativa 3879 Allium Type 1 specific Allium 4678 Allspice Type 1 specific Pimenta dioica 375272 Almond Type 1 specific Prunus dulcis 3755 Alpine sweetvetch Type 1 specific Hedysarum alpinum 57576 Amaranth Type 1 specific Amaranthus 3564 American cranberry Type 1 specific Vaccinium macrocarpon 13750 American pokeweed Type 1 specific Phytolacca americana 3527 Anatidae Type 1 specific Anatidae 8830 Angelica Type 1 specific Angelica keiskei 357850 Anise Type 1 specific Pimpinella anisum 271192 Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 Apricot Type 1 specific Prunus armeniaca 36596 Arabica coffee Type 1 specific Coffea arabica 13443 Arctic blackberry Type 1 specific Rubus arcticus 70741 Arrowhead Type 1 specific Sagittaria latifolia 15008 Arrowroot Type 1 specific Maranta arundinacea 210060 Asian pear Type 1 specific Pyrus pyrifolia 3767 Asparagus Type 1 specific Asparagus officinalis 4686 Avocado Type 1 specific Persea americana 3435 Babassu palm Type 1 specific Attalea speciosa 145700 Bagel Type 2 specific Bamboo shoots Type 1 specific Phyllostachys edulis 38705 Banana Type 1 specific Musa acuminata 4641 Barley Type 1 specific Hordeum vulgare 4513 Bayberry Type 1 specific Myrica 3509 Bean Type 1 specific Beech nut Type 1 specific Fagus 21024 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bilberry Type 1 specific Vaccinium myrtillus 180763 Bison Type 1 specific Bison bison 9901 Bitter gourd Type 1 specific Momordica charantia 3673 Black cabbage Type 1 specific Brassica oleracea var. viridis 3713 Black chokeberry Type 1 specific Photinia melanocarpa 661339 Black crowberry Type 1 specific Empetrum nigrum 191066 Black elderberry Type 1 specific Sambucus nigra 4202 Black huckleberry Type 1 specific Gaylussacia baccata 128893 Black mulberry Type 1 specific Morus nigra 85232 Black plum Type 1 Syzygium cumini Black radish Type 1 specific Raphanus sativus var. niger 41679 Black raisin Type 1 Black raspberry Type 1 specific Rubus occidentalis 75079 Black salsify Type 1 specific Scorzonera hispanica 114289 Black tea Type 1 Black walnut Type 1 specific Juglans nigra 16719 Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 Blackberry Type 1 specific Rubus Blackcurrant Type 1 specific Ribes nigrum 78511 Bog bilberry Type 1 specific Vaccinium uliginosum 190548 Borage Type 1 specific Borago officinalis 13363 Boysenberry Type 1 specific Rubus ursinus X idaeus Brazil nut Type 1 specific Bertholletia excelsa 3645 Breadfruit Type 1 specific Artocarpus altilis 194251 Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 Broad bean Type 1 specific Vicia faba 3906 Broccoli Type 1 specific Brassica oleracea var. italica 36774 Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 Buffalo Type 1 specific Bubalus bubalis 89462 Buffalo currant Type 1 specific Ribes aureum var. villosum 23283 Bulgur Type 2 specific Burdock Type 1 specific Arctium lappa 4217 Butternut Type 1 specific Juglans cinerea 91214 Butternut squash Type 1 specific Cucurbita moschata 3662 Cabbage Type 1 specific Brassica oleracea var. capitata 3716 Calabash Type 1 specific Lagenaria siceraria 3668 Canada blueberry Type 1 specific Vaccinium myrtilloides 1503870 Cannellini bean Type 1 Canola Type 2 specific 138011 Cantaloupe melon Type 1 Cucumis melo var. cantalupensis Cape gooseberry Type 1 Physalis peruviana Capers Type 1 specific Capparis spinosa 65558 Caraway Type 1 specific Carum carvi 48032 Cardamom Type 1 specific Elettaria cardamomum 105181 Cardoon Type 1 specific Cynara cardunculus 4265 Carob Type 1 specific Ceratonia siliqua 20340 Carrot Type 1 specific Daucus carota ssp. sativus 79200 Cascade huckleberry Type 1 specific Vaccinium deliciosum 190531 Cashew nut Type 1 specific Anacardium occidentale 171929 Cassava Type 1 specific Manihot esculenta 3983 Castanospermum australe Type 1 Castanospermum australe Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 Celery stalks Type 1 specific Apium graveolens var. dulce 117781 Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 Chanterelle Type 1 specific Cantharellus cibarius 36066 Chayote Type 1 specific Sechium edule 184140 Cherimoya Type 1 specific Annona cherimola 49314 Cherry tomato Type 1 specific Solanum lycopersicum var. cerasiforme 195583 Chervil Type 1 specific Anthriscus cerefolium 40888 Chestnut Type 1 specific Castanea 21019 Chia Type 1 specific Salvia hispanica 49212 Chicken Type 1 specific Gallus gallus 9031 Chickpea Type 1 specific Cicer arietinum 3827 Chicory Type 1 specific Cichorium intybus 13427 Chicory leaves Type 1 specific Cichorium intybus var. foliosum 13427 Chicory roots Type 1 specific Cichorium intybus var. sativum 13427 Chinese bayberry Type 1 specific Myrica rubra 262757 Chinese broccoli Type 1 specific Brassica alboglabra 3714 Chinese cabbage Type 1 specific Brassica rapa 3711 Chinese chestnut Type 1 specific Castanea mollissima 60419 Chinese chives Type 1 specific Allium tuberosum 4683 Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 Chinese mustard Type 1 specific Brassica juncea 3707 Chinese plum Type 1 Chinese water chestnut Type 1 specific Eleocharis dulcis 110284 Chives Type 1 specific Allium schoenoprasum 74900 Cinnamon Type 1 specific Cinnamomum 13428 Clementine Type 1 Citrus × clementina Climbing bean Type 1 specific Vigna umbellata 87088 Cloud ear fungus Type 1 specific Auricularia polytricha 29893 Cloudberry Type 1 specific Rubus chamaemorus 57936 Cloves Type 1 specific Syzygium aromaticum 219868 Coconut Type 1 specific Cocos nucifera 13894 Colorado pinyon Type 1 specific Pinus edulis 3340 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Common bean Type 1 specific Phaseolus vulgaris 3885 Common beet Type 1 specific Beta vulgaris 161934 Common buckwheat Type 1 specific Fagopyrum esculentum 3617 Common cabbage Type 1 specific Brassica oleracea 3712 Common chokecherry Type 1 specific Prunus virginiana 133204 Common grape Type 1 specific Vitis vinifera 29760 Common hazelnut Type 1 specific Corylus avellana 13451 Common mushroom Type 1 specific Agaricus bisporus 5341 Common oregano Type 1 specific Origanum vulgare 39352 Common pea Type 1 specific Pisum sativum 3888 Common persimmon Type 1 specific Diospyros virginiana 13493 Common sage Type 1 specific Salvia officinalis 38868 Common salsify Type 1 specific Tragopogon porrifolius 13731 Common thyme Type 1 specific Thymus vulgaris 49992 Common verbena Type 1 specific Verbena officinalis 79772 Common walnut Type 1 specific Juglans regia 51240 Common wheat Type 1 specific Triticum aestivum 4565 Coriander Type 1 specific Coriandrum sativum 4047 Corn Type 1 specific Zea mays 4577 Corn salad Type 1 specific Valerianella locusta 59166 Cornbread Type 2 specific Cornmint Type 1 specific Mentha arvensis 292239 Cottonseed Type 1 specific Gossypium 3633 Cowpea Type 1 specific Vigna unguiculata 3917 Crosne Type 1 Stachys affinis Cubanelle pepper Type 1 Cucumber Type 1 specific Cucumis sativus 3659 Cucurbita Type 1 specific Cucurbita 3660 Cumin Type 1 specific Cuminum cyminum 52462 Curry powder Type 2 specific Custard apple Type 1 specific Annona reticulata 301862 Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 Dandelion Type 1 specific Taraxacum officinale 50225 Date Type 1 specific Phoenix dactylifera 42345 Deer Type 1 specific Cervidae 9850 Deerberry Type 1 specific Vaccinium stamineum 176259 Dill Type 1 specific Anethum graveolens 40922 Dock Type 1 specific Rumex 3618 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Durian Type 1 specific Durio zibethinus 66656 Eddoe Type 1 Colocasia antiquorum Eggplant Type 1 specific Solanum melongena 4111 Elderberry Type 1 specific Sambucus 4201 Elk Type 1 specific Cervus canadensis 1574408 Elliott's blueberry Type 1 specific Vaccinium elliottii 283798 Emu Type 1 specific Dromaius novaehollandiae 8790 Endive Type 1 specific Cichorium endivia 114280 Enokitake Type 1 specific Flammulina velutipes 38945 Epazote Type 1 specific Dysphania ambrosioides 330163 European chestnut Type 1 specific Castanea sativa 21020 European cranberry Type 1 specific Vaccinium oxycoccos 516948 European plum Type 1 specific Prunus domestica 3758 European rabbit Type 1 specific Oryctolagus 9984 Evening primrose Type 1 specific Oenothera biennis 3942 Evergreen huckleberry Type 1 specific Vaccinium ovatum 84019 Feijoa Type 1 specific Feijoa sellowiana 260130 Fennel Type 1 specific Foeniculum vulgare 48038 Fenugreek Type 1 specific Trigonella foenum-graecum 78534 Fig Type 1 specific Ficus carica 3494 Fireweed Type 1 specific Chamerion angustifolium 13055 Flaxseed Type 1 specific Linum usitatissimum 4006 Flour Type 2 specific Fox grape Type 1 specific Vitis labrusca 103355 French plantain Type 1 specific Musa X paradisiaca 89151 Garden cress Type 1 specific Lepidium sativum 33125 Garden onion Type 1 specific Allium cepa 4679 Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 Garden tomato Type 1 specific Solanum lycopersicum 4081 Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 Garlic Type 1 specific Allium sativum 4682 Gentiana lutea Type 1 Gentiana lutea German camomile Type 1 specific Matricaria recutita 127986 Giant butterbur Type 1 specific Petasites japonicus 186965 Ginger Type 1 specific Zingiber officinale 94328 Ginkgo nuts Type 1 specific Ginkgo biloba 3311 Ginseng Type 1 specific Panax 4054 Globe artichoke Type 1 specific Cynara scolymus 59895 Goji Type 1 Gooseberry Type 1 specific Ribes uva-crispa 135518 Gram bean Type 1 specific Vigna mungo 3915 Grape Type 1 specific Vitis 3603 Grapefruit Type 1 specific Citrus X paradisi 37656 Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 Grass pea Type 1 specific Lathyrus sativus 3860 Green apple Type 1 Green bean Type 1 specific Phaseolus vulgaris 3885 Green bell pepper Type 1 specific Capsicum annuum 4072 Green cabbage Type 1 Brassica oleracea var. sabauda L. Green grape Type 1 Green lentil Type 1 Lens culinaris Green onion Type 1 Green plum Type 1 Green tea Type 1 Green zucchini Type 1 specific Cucurbita pepo var. cylindrica Greenthread tea Type 1 specific Thelesperma 153159 Greylag goose Type 1 specific Anser anser 8843 Groundcherry Type 1 specific Physalis 24663 Guarana Type 1 Paullinia cupana Guava Type 1 specific Psidium guajava 120290 Guinea hen Type 1 specific Numida meleagris 8996 Half-highbush blueberry Type 1 specific Vaccinium angustifolium X Vaccinium corymbosum 934696 Hard wheat Type 1 specific Triticum durum 4567 Hawthorn Type 1 Crataegus Hazelnut Type 1 specific Corylus 13450 Heart of palm Type 1 specific Hedge mustard Type 1 specific Sisymbrium 3729 Herbal tea Type 1 Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 Hickory nut Type 1 specific Carya 13402 Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 Horned melon Type 2 specific Cucumis metuliferus 61886 Horse Type 1 specific Equus caballus 9796 Horseradish Type 1 specific Armoracia rusticana 3704 Horseradish tree Type 1 specific Moringa oleifera 3735 Hyacinth bean Type 1 specific Lablab purpureus 35936 Hyssop Type 1 specific Hyssopus officinalis 39324 Iceberg lettuce Type 1 Italian oregano Type 1 specific Origanum X majoricum 1384207 Italian sweet red pepper Type 1 specific Capsicum annuum 4072 Jackfruit Type 1 specific Artocarpus heterophyllus 3489 Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' Japanese chestnut Type 1 specific Castanea crenata 103480 Japanese persimmon Type 1 specific Diospyros kaki 35925 Japanese pumpkin Type 1 specific Cucurbita maxima 3661 Japanese walnut Type 1 specific Juglans ailanthifolia 91209 Java plum Type 1 specific Syzygium cumini 260142 Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 Jew's ear Type 1 specific Auricularia auricula-judae 29892 Jicama Type 1 specific Pachyrhizus erosus 109171 Jostaberry Type 1 specific Ribes × nidigrolaria Jujube Type 1 specific Ziziphus zizyphus 48393 Juniperus communis Type 1 Juniperus communis Jute Type 1 specific Corchorus olitorius 93759 Kai-lan Type 1 specific Brassica oleracea var. alboglabra 3714 Kale Type 1 specific Brassica napus var. pabularia Kiwi Type 1 specific Actinidia chinensis 3625 Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 Komatsuna Type 1 specific Brassica rapa var. perviridis 344680 Kumquat Type 1 specific Fortunella 2706 Lambsquarters Type 1 specific Chenopodium album 3559 Lantern fruit Type 1 Physalis alkekengi Leek Type 1 specific Allium porrum Lemon Type 1 specific Citrus limon 2708 Lemon balm Type 1 specific Melissa officinalis 39338 Lemon grass Type 1 specific Cymbopogon citratus 66014 Lemon thyme Type 1 specific Thymus pulegioides 751873 Lemon verbena Type 1 specific Aloysia triphylla 542672 Lentils Type 1 generic Lens culinaris 3864 Lettuce Type 1 specific Lactuca sativa 4236 Lichee Type 1 specific Litchi chinensis 151069 Lima bean Type 1 specific Phaseolus lunatus 3884 Lime Type 1 specific Citrus aurantiifolia 159033 Linden Type 1 specific Tilia 64580 Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 Loganberry Type 1 specific Rubus loganobaccus Longan Type 1 specific Dimocarpus longan 128017 Loquat Type 1 specific Eriobotrya japonica 32224 Lotus Type 1 specific Nelumbo 4430 Lovage Type 1 specific Levisticum officinale 48042 Lowbush blueberry Type 1 specific Vaccinium angustifolium 472369 Lupine Type 1 specific Lupinus 3869 Macadamia nut Type 1 specific Macadamia 4329 Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 Maitake Type 1 specific Grifola frondosa 5627 Malabar plum Type 1 specific Syzygium jambos 334483 Malabar spinach Type 1 specific Basella alba 3589 Mallard duck Type 1 specific Anas platyrhynchos 8839 Malus (Crab apple) Type 1 specific Malus 3749 Mamey sapote Type 1 specific Pouteria sapota 233744 Mammee apple Type 1 specific Mammea americana 198777 Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 Mango Type 1 specific Mangifera indica 29780 Mate Type 1 Ilex paraguariensis Medlar Type 1 specific Mespilus germanica 36616 Mentha Type 1 specific Mentha 21819 Mexican groundcherry Type 1 specific Physalis philadelphica var. immaculata 374021 Mexican oregano Type 1 specific Lippia graveolens Mikan Type 1 Citrus unshiu Millet Type 1 specific Panicum miliaceum 4540 Miso Type 2 specific Monk fruit Type 1 Siraitia grosvenorii Morchella (Morel) Type 1 specific Morchellaceae 5192 Moth bean Type 1 specific Vigna aconitifolia 3918 Mountain hare Type 1 specific Lepus timidus 62621 Mountain yam Type 1 specific Dioscorea pentaphylla 167592 Mugwort Type 1 specific Artemisia vulgaris 4220 Mulberry Type 1 specific Morus 3497 Mule deer Type 1 specific Odocoileus 9871 Mundu Type 1 Garcinia dulcis Mung bean Type 1 specific Vigna radiata 157791 Muscadine grape Type 1 specific Vitis rotundifolia 103349 Muskmelon Type 1 specific Cucumis melo 3656 Mustard spinach Type 1 specific Brassica perviridis Nance Type 1 specific Byrsonima crassifolia 4270 Nanking cherry Type 1 specific Prunus tomentosa 105667 Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 Naranjilla Type 1 specific Solanum quitoense 227725 Narrowleaf cattail Type 1 specific Typha angustifolia 59011 Natal plum Type 1 specific Carissa macrocarpa 403101 Nectarine Type 1 specific Prunus persica var. nucipersica 323851 New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 Nopal Type 1 specific Opuntia cochenillifera 338184 Nutmeg Type 1 specific Myristica fragrans 51089 Oat Type 1 specific Avena sativa 4498 Oat bread Type 2 specific Ohelo berry Type 1 specific Vaccinium reticulatum 180767 Oil palm Type 1 specific Elaeis 51952 Okra Type 1 specific Abelmoschus esculentus 455045 Olive Type 1 specific Olea europaea 4146 Orange bell pepper Type 1 specific Capsicum annuum 4072 Orange mint Type 1 specific Mentha aquatica 190902 Oregon yampah Type 1 specific Perideridia oregana 234866 Oriental wheat Type 1 specific Triticum turanicum 376534 Ostrich Type 1 specific Struthio camelus 8801 Ostrich fern Type 1 specific Matteuccia struthiopteris 3277 Oval-leaf huckleberry Type 1 specific Vaccinium ovalifolium 190544 Oxheart cabbage Type 1 specific Brassica oleracea var. conica Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 Pak choy Type 1 specific Brassica rapa var. chinensis 93385 Papaya Type 1 specific Carica papaya 3649 Parsley Type 1 specific Petroselinum crispum 4043 Parsnip Type 1 specific Pastinaca sativa 4041 Partridge berry Type 1 Mitchella repens Passion fruit Type 1 specific Passiflora edulis 78168 Pasta Type 2 specific Pea shoots Type 1 Peach Type 1 specific Prunus persica 3760 Peach (var.) Type 1 specific Prunus persica var. persica 323852 Peanut Type 1 specific Arachis hypogaea 3818 Pear Type 1 specific Pyrus communis 23211 Pecan nut Type 1 specific Carya illinoinensis 32201 Pepper Type 1 specific Capsicum annuum 4072 Pepper (C. baccatum) Type 1 specific Capsicum baccatum var. baccatum 165788 Pepper (C. chinense) Type 1 specific Capsicum chinense 80379 Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 Pepper (C. pubescens) Type 1 specific Capsicum pubescens 113210 Pepper (Capsicum) Type 1 specific Capsicum 4071 Pepper (Spice) Type 1 specific Piper nigrum 13216 Peppermint Type 1 specific Mentha X piperita 34256 Persian lime Type 1 specific Citrus latifolia 200541 Persimmon Type 1 specific Diospyros 13492 Pheasant Type 1 specific Phasianus colchicus 9054 Pigeon pea Type 1 specific Cajanus cajan 3821 Piki bread Type 2 specific Pili nut Type 1 specific Canarium ovatum 43691 Pine nut Type 1 specific Pinus 3337 Pineapple Type 1 specific Ananas comosus 4615 Pineappple sage Type 1 specific Salvia elegans 888065 Pistachio Type 1 specific Pistacia vera 55513 Pita bread Type 2 specific Pitanga Type 1 specific Eugenia uniflora 119951 Pitaya Type 1 Hylocereus undatus Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 Plantain Type 1 Musa × paradisiaca Pomegranate Type 1 specific Punica granatum 22663 Pot marjoram Type 1 specific Origanum onites 452416 Potato Type 1 specific Solanum tuberosum 4113 Potato bread Type 2 specific Prairie turnip Type 1 specific Pediomelum esculentum 458363 Prickly pear Type 1 specific Opuntia 106975 Prunus (Cherry, Plum) Type 1 specific Prunus 3754 Pummelo Type 1 specific Citrus maxima 37334 Purple mangosteen Type 1 specific Garcinia mangostana 58228 Purslane Type 1 specific Portulaca oleracea 46147 Quail Type 1 specific Phasianidae 9005 Quince Type 1 specific Cydonia oblonga 36610 Quinoa Type 1 specific Chenopodium quinoa 63459 Rabbit Type 1 specific Leporidae 9979 Rabbiteye blueberry Type 1 specific Vaccinium virgatum Radish Type 1 specific Raphanus sativus 3726 Radish (var.) Type 1 specific Raphanus sativus var. sativus 240228 Raisin bread Type 2 specific Rambutan Type 1 specific Nephelium lappaceum 151071 Rape Type 1 specific Brassica napus var. napus 138011 Rapini Type 1 specific Brassica ruvo 1204434 Red beetroot Type 1 specific Beta vulgaris var. rubra Red bell pepper Type 1 specific Capsicum annuum 4072 Red clover Type 1 Trifolium pratense Red grape Type 1 Red huckleberry Type 1 specific Vaccinium parvifolium 180766 Red onion Type 1 Red raspberry Type 1 specific Rubus idaeus 32247 Red rice Type 1 specific Oryza rufipogon 4529 Red tea Type 1 Redcurrant Type 1 specific Ribes rubrum 175228 Rice Type 1 specific Oryza sativa 4530 Rice bread Type 2 specific Robusta coffee Type 1 specific Coffea canephora 49390 Rock ptarmigan Type 1 specific Lagopus muta 64668 Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia Roman camomile Type 1 specific Chamaemelum nobile 99037 Rose hip Type 1 specific Rosa 3764 Roselle Type 1 specific Hibiscus sabdariffa 183260 Rosemary Type 1 specific Rosmarinus officinalis 39367 Rowal Type 1 specific Pangium edule 112823 Rowanberry Type 1 specific Sorbus aucuparia 36599 Rye Type 1 specific Secale cereale 4550 Rye bread Type 2 specific Sacred lotus Type 1 specific Nelumbo nucifera 4432 Safflower Type 1 specific Carthamus tinctorius 4222 Saffron Type 1 specific Crocus sativus 82528 Sago palm Type 1 specific Metroxylon sagu 93297 Salmonberry Type 1 specific Rubus spectabilis 59499 Sapodilla Type 1 specific Manilkara zapota 3741 Saskatoon berry Type 1 specific Amelanchier alnifolia 32219 Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 Scarlet bean Type 1 specific Phaseolus coccineus 3886 Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 Semolina Type 2 specific Sesame Type 1 specific Sesamum orientale 4182 Sesbania flower Type 1 specific Sesbania bispinosa 485725 Shallot Type 1 specific Allium ascalonicum 1476995 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Shiitake Type 1 specific Lentinus edodes 5353 Silver linden Type 1 specific Tilia argentea Skunk currant Type 1 specific Ribes glandulosum 175226 Small-leaf linden Type 1 specific Tilia cordata 172266 Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 Sorghum Type 1 specific Sorghum bicolor 4558 Sorrel Type 1 specific Rumex acetosa 41241 Sour cherry Type 1 specific Prunus cerasus 140311 Sour orange Type 1 Citrus × aurantium Sourdock Type 1 specific Rumex articus 395311 Sourdough Type 2 specific Soursop Type 1 specific Annona muricata 13337 Soy bean Type 1 specific Glycine max 3847 Soy cream Type 2 specific Soy milk Type 2 specific Soy sauce Type 2 specific Sparkleberry Type 1 specific Vaccinium arboreum 229201 Spearmint Type 1 specific Mentha spicata 29719 Spelt Type 1 specific Triticum spelta 58933 Spinach Type 1 specific Spinacia oleracea 3562 Squab Type 1 specific Columba 8931 Squashberry Type 1 specific Viburnum edule 237934 Star anise Type 1 specific Illicium verum 124778 Star fruit Type 1 specific Averrhoa carambola 28974 Strawberry Type 1 specific Fragaria X ananassa 3747 Strawberry guava Type 1 specific Psidium cattleianum 375274 Sugar apple Type 1 specific Annona squamosa 301693 Summer grape Type 1 specific Vitis aestivalis 3605 Summer savory Type 1 specific Satureja hortensis 49987 Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata Sunflower Type 1 specific Helianthus annuus 4232 Swamp cabbage Type 1 specific Ipomoea aquatica 89636 Swede Type 1 specific Brassica napus 3708 Sweet basil Type 1 specific Ocimum basilicum 39350 Sweet bay Type 1 specific Laurus nobilis 85223 Sweet cherry Type 1 specific Prunus avium 42229 Sweet marjoram Type 1 specific Origanum majorana 268884 Sweet orange Type 1 specific Citrus sinensis 2711 Sweet potato Type 1 specific Ipomoea batatas 4120 Sweet rowanberry Type 1 specific Grataegosorbus mitschurinii Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 Taco shell Type 2 Tamarind Type 1 specific Tamarindus indica 58860 Taro Type 1 specific Colocasia esculenta 4460 Tarragon Type 1 specific Artemisia dracunculus 72341 Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Tea leaf willow Type 1 specific Salix pulchra 669814 Teff Type 1 specific Eragrostis tef 110835 Thistle Type 1 specific Cirsium 41549 Tinda Type 1 specific Citrullus lanatus var. fistulosus Tofu Type 2 specific Tortilla Type 2 specific Tostada shell Type 2 Towel gourd Type 1 specific Luffa aegyptiaca 3670 Tree fern Type 1 specific Cyathea Triticale Type 1 specific X Triticosecale rimpaui Tronchuda cabbage Type 1 specific Brassica oleracea var. costata 416546 Turkey Type 1 specific Meleagris gallopavo 9103 Turmeric Type 1 specific Curcuma longa 136217 Turnip Type 1 specific Brassica rapa var. rapa 51350 Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 Vanilla Type 1 specific Vanilla 51238 Velvet duck Type 1 specific Melanitta fusca 371864 Walnut Type 1 specific Juglans 16718 Wampee Type 1 Clausena lansium Wasabi Type 1 specific Wasabia japonica 75806 Water spinach Type 1 Ipomoea aquatica Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 Watermelon Type 1 specific Citrullus lanatus 3654 Wax apple Type 1 specific Eugenia javanica 119950 Wax gourd Type 1 specific Benincasa hispida 102211 Welsh onion Type 1 specific Allium fistulosum 35875 Wheat Type 1 specific Triticum 4564 Wheat bread Type 2 specific White bread Type 1 White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. White lupine Type 1 specific Lupinus albus 3870 White mulberry Type 1 Morus alba White mustard Type 1 specific Sinapis alba 3728 Wild boar Type 1 specific Sus scrofa 9823 Wild carrot Type 1 specific Daucus carota 4039 Wild celery Type 1 specific Apium graveolens 4045 Wild leek Type 1 specific Allium ampeloprasum 4681 Wild rice Type 1 specific Zizania 15949 Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 Winter savory Type 1 specific Satureja montana 49988 Winter squash Type 1 specific Cucurbita maxima 3661 Wonton wrapper Type 2 specific Yali pear Type 1 specific Pyrus × bretschneideri Yam Type 1 specific Dioscorea 4672 Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 Yau choy Type 1 Yautia Type 1 specific Xanthosoma sagittifolium 28478 Yellow bell pepper Type 1 specific Capsicum annuum 4072 Yellow pond-lily Type 1 specific Nuphar lutea 77113 Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica Zwieback Type 2 specific Enoyl-CoA hydratase, mitochondrial P30084 ECHS1