1.0 2011-09-21 00:20:10 UTC 2025-11-19 02:42:35 UTC FDB022822 12-Hydroxydodecanoic acid 12-hydroxydodecanoic acid is the substrate of the human glutathione-dependent formaldehyde dehydrogenase (EC1.1.1.1) . The enzyme that catalyzes the conversion of alcohols to aldehydes is a zinc-containing dimeric enzyme responsible for the oxidation of long-chain alcohols and omega-hydroxy fatty acids. (OMIM) The human glutathione-dependent formaldehyde dehydrogenase is unique among the structurally studied members of the alcohol dehydrogenase family in that it follows a random bi kinetic mechanism forming a binary complex, and a ternary complex with NAD+. (PMID 12196016) [HMDB] 12-Hydroxy laate 12-Hydroxy laic acid 12-Hydroxy lauric acid 12-Hydroxydodecanoate 12-Hydroxydodecanoic acid 12-Hydroxylaurate 12-Hydroxylauric acid 2-Hydroxy-dodecanoate 2-Hydroxy-dodecanoic acid omega hydroxy dodecanoate omega hydroxy dodecanoic acid Omega-hydroxy laate Omega-hydroxy laic acid Omega-hydroxy lauric acid omega-Hydroxydodecanoate omega-Hydroxydodecanoic acid Omega-OH dodecanoate Omega-OH dodecanoic acid Omega-OH laate Omega-OH laic acid Omega-OH lauric acid C12H24O3 216.3172 216.172544634 12-hydroxydodecanoic acid 12-hydroxydodecanoic acid 505-95-3 OCCCCCCCCCCCC(O)=O InChI=1S/C12H24O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h13H,1-11H2,(H,14,15) ZDHCZVWCTKTBRY-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain hydroxy acids and derivatives. These are hydroxy acids with a 6 to 12 carbon atoms long side chain. Medium-chain hydroxy acids and derivatives Organic compounds Organic acids and derivatives Hydroxy acids and derivatives Medium-chain hydroxy acids and derivatives Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Primary alcohols Straight chain fatty acids Alcohol Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Hydrocarbon derivative Hydroxy fatty acid Medium-chain fatty acid Medium-chain hydroxy acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Primary alcohol Straight chain fatty acid Hydroxy fatty acids Hydroxy fatty acids medium-chain fatty acid omega-hydroxy fatty acid Solid logp 3.50 ALOGPS logs -3.00 ALOGPS solubility 2.14e-01 g/l ALOGPS logp 3.04 ChemAxon pka_strongest_acidic 4.95 ChemAxon pka_strongest_basic -2 ChemAxon iupac 12-hydroxydodecanoic acid ChemAxon average_mass 216.3172 ChemAxon mono_mass 216.172544634 ChemAxon smiles OCCCCCCCCCCCC(O)=O ChemAxon formula C12H24O3 ChemAxon inchi InChI=1S/C12H24O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h13H,1-11H2,(H,14,15) ChemAxon inchikey ZDHCZVWCTKTBRY-UHFFFAOYSA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 60.61 ChemAxon polarizability 26.85 ChemAxon rotatable_bond_count 11 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 1843 Specdb::NmrTwoD 1783 Specdb::CMs 9748 Specdb::CMs 29935 Specdb::CMs 29936 Specdb::CMs 38247 Specdb::CMs 99748 Specdb::CMs 99749 Specdb::CMs 163182 Specdb::MsMs 1974 Specdb::MsMs 10676 Specdb::MsMs 10677 Specdb::MsMs 10678 Specdb::MsMs 17348 Specdb::MsMs 17349 Specdb::MsMs 17350 Specdb::MsMs 2255105 Specdb::MsMs 2255489 Specdb::MsMs 2257148 Specdb::MsMs 2257423 Specdb::MsMs 2259116 Specdb::MsMs 2259468 Specdb::MsMs 2777405 Specdb::MsMs 2777406 Specdb::MsMs 2777407 Specdb::MsMs 2900985 Specdb::MsMs 2900986 Specdb::MsMs 2900987 HMDB02059 10616 12H #<Reference:0x000055ce32507110> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823