1.0 2011-09-21 00:20:14 UTC 2025-11-19 02:42:36 UTC FDB022827 N-Acetylputrescine N-Acetylputrescine is a polyamine commonly occurring excreted in normal human urine (PMID 7775374). N-Acetylputrescine is the most abundant of all polyamines both in normal individuals and in patients with leukemia (PMID 9464484). N-Acetylputrescine is the N-acetylated form of the naturally occurring polyamine called putrescine. The N-acetylation is mediated by the enzyme diamine N-acetyltransferase. Putrescine is related to cadaverine (another polyamine). Both are produced by the breakdown of amino acids in living and dead organisms and both are toxic in large doses. Putrescine and cadaverine are largely responsible for the foul odor of putrefying flesh, but also contribute to the odor of such processes as bad breath and bacterial vaginosis. Putrescine is also found in semen. Putrescine attacks s-adenosyl methionine and converts it to spermidine. Spermidine in turn attacks another s-adenosyl methionine and converts it to spermine. Putrescine is synthesized in small quantities by healthy living cells by the action of ornithine decarboxylase. [HMDB] Acetylputrescine Monoacetylputrescine N-(4-aminobutyl)acetamide C6H14N2O 130.1882 130.11061308 N-(4-aminobutyl)acetamide acetylputrescine 18233-70-0 CC(=O)NCCCCN InChI=1S/C6H14N2O/c1-6(9)8-5-3-2-4-7/h2-5,7H2,1H3,(H,8,9) KLZGKIDSEJWEDW-UHFFFAOYSA-N belongs to the class of organic compounds known as carboximidic acids. These are organic acids with the general formula RC(=N)-OH (R=H, organic group). Carboximidic acids Organic compounds Organic acids and derivatives Carboximidic acids and derivatives Carboximidic acids Aliphatic acyclic compounds Hydrocarbon derivatives Monoalkylamines Organooxygen compounds Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Aliphatic acyclic compound Amine Carboximidic acid Hydrocarbon derivative Organic 1,3-dipolar compound Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Propargyl-type 1,3-dipolar organic compound N-monoacetylalkane-alpha,omega-diamine N-substituted putrescine an aliphatic <i>N</i>-acetyl-diamine logp -0.84 ALOGPS logs 0.04 ALOGPS solubility 1.41e+02 g/l ALOGPS logp -1 ChemAxon pka_strongest_acidic 16.48 ChemAxon pka_strongest_basic 9.9 ChemAxon iupac N-(4-aminobutyl)acetamide ChemAxon average_mass 130.1882 ChemAxon mono_mass 130.11061308 ChemAxon smiles CC(=O)NCCCCN ChemAxon formula C6H14N2O ChemAxon inchi InChI=1S/C6H14N2O/c1-6(9)8-5-3-2-4-7/h2-5,7H2,1H3,(H,8,9) ChemAxon inchikey KLZGKIDSEJWEDW-UHFFFAOYSA-N ChemAxon polar_surface_area 55.12 ChemAxon refractivity 36.82 ChemAxon polarizability 15.28 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 1844 Specdb::NmrTwoD 1784 Specdb::MsIr 1580 Specdb::MsIr 1581 Specdb::MsIr 1582 Specdb::CMs 804 Specdb::CMs 805 Specdb::CMs 806 Specdb::CMs 1376 Specdb::CMs 1409 Specdb::CMs 2521 Specdb::CMs 30390 Specdb::CMs 30922 Specdb::CMs 30923 Specdb::CMs 31387 Specdb::CMs 31388 Specdb::CMs 31691 Specdb::CMs 31692 Specdb::CMs 136305 Specdb::CMs 144039 Specdb::MsMs 1975 Specdb::MsMs 1976 Specdb::MsMs 1977 Specdb::MsMs 5694 Specdb::MsMs 5695 Specdb::MsMs 5696 Specdb::MsMs 5697 Specdb::MsMs 5698 Specdb::MsMs 5702 Specdb::MsMs 178338 Specdb::MsMs 178339 Specdb::MsMs 178340 Specdb::MsMs 180654 Specdb::MsMs 180655 Specdb::MsMs 180656 Specdb::MsMs 445591 Specdb::MsMs 445592 Specdb::MsMs 445593 Specdb::MsMs 445594 Specdb::MsMs 445595 Specdb::MsMs 448116 Specdb::MsMs 451940 Specdb::MsMs 2231076 Specdb::MsMs 2233107 Specdb::MsMs 2239726 HMDB60268 17768 #<Reference:0x000055ce3213a7a8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823