1.0 2011-09-21 00:20:16 UTC 2024-11-29 22:26:13 UTC FDB022830 4-Hydroxy-2-oxoglutaric acid 4-Hydroxy-2-ketoglutaric acid is a substrate for Fructose-bisphosphate aldolase A. [HMDB] (+/-)-2-hydroxy-4-oxopentanedioate (+/-)-2-hydroxy-4-oxopentanedioic acid 2-hydroxy-4-oxopentanedioate 2-hydroxy-4-oxopentanedioic acid 2-keto-4-hydroxyglutarate 2-Oxo-4-hydroxyglutarate 4-hydroxy-2-ketoglutarate 4-hydroxy-2-oxoglutarate D-4-hydroxy-2-ketoglutarate C5H6O6 162.0975 162.016437924 2-hydroxy-4-oxopentanedioic acid 4-hydroxy-2-oxoglutaric acid 1187-99-1 OC(CC(=O)C(O)=O)C(O)=O InChI=1S/C5H6O6/c6-2(4(8)9)1-3(7)5(10)11/h2,6H,1H2,(H,8,9)(H,10,11) WXSKVKPSMAHCSG-UHFFFAOYSA-N belongs to the class of organic compounds known as gamma-keto acids and derivatives. These are organic compounds containing an aldehyde substituted with a keto group on the C4 carbon atom. Gamma-keto acids and derivatives Organic compounds Organic acids and derivatives Keto acids and derivatives Gamma-keto acids and derivatives Aliphatic acyclic compounds Alpha hydroxy acids and derivatives Alpha-hydroxy ketones Alpha-keto acids and derivatives Beta-hydroxy ketones Carboxylic acids Dicarboxylic acids and derivatives Hydrocarbon derivatives Organic oxides Secondary alcohols Short-chain keto acids and derivatives Alcohol Aliphatic acyclic compound Alpha-hydroxy acid Alpha-hydroxy ketone Alpha-keto acid Beta-hydroxy ketone Carbonyl group Carboxylic acid Carboxylic acid derivative Dicarboxylic acid or derivatives Gamma-keto acid Hydrocarbon derivative Hydroxy acid Ketone Organic oxide Organic oxygen compound Organooxygen compound Secondary alcohol Short-chain keto acid oxo dicarboxylic acid Solid logp -1.11 ALOGPS logs -0.37 ALOGPS solubility 6.98e+01 g/l ALOGPS logp -0.82 ChemAxon pka_strongest_acidic 2.45 ChemAxon pka_strongest_basic -3.9 ChemAxon iupac 2-hydroxy-4-oxopentanedioic acid ChemAxon average_mass 162.0975 ChemAxon mono_mass 162.016437924 ChemAxon smiles OC(CC(=O)C(O)=O)C(O)=O ChemAxon formula C5H6O6 ChemAxon inchi InChI=1S/C5H6O6/c6-2(4(8)9)1-3(7)5(10)11/h2,6H,1H2,(H,8,9)(H,10,11) ChemAxon inchikey WXSKVKPSMAHCSG-UHFFFAOYSA-N ChemAxon polar_surface_area 111.9 ChemAxon refractivity 30.22 ChemAxon polarizability 12.76 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 6 ChemAxon donor_count 3 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Arginine and Proline Metabolism SMP00020 map00330 Metabolism and Physiological Effects of Oxalic acid SMP0124875 Specdb::CMs 2837 Specdb::CMs 38254 Specdb::CMs 146213 Specdb::NmrOneD 148900 Specdb::NmrOneD 148901 Specdb::NmrOneD 148902 Specdb::NmrOneD 148903 Specdb::NmrOneD 148904 Specdb::NmrOneD 148905 Specdb::NmrOneD 148906 Specdb::NmrOneD 148907 Specdb::NmrOneD 148908 Specdb::NmrOneD 148909 Specdb::NmrOneD 148910 Specdb::NmrOneD 148911 Specdb::NmrOneD 148912 Specdb::NmrOneD 148913 Specdb::NmrOneD 148914 Specdb::NmrOneD 148915 Specdb::NmrOneD 148916 Specdb::NmrOneD 148917 Specdb::NmrOneD 148918 Specdb::NmrOneD 148919 Specdb::MsMs 28196 Specdb::MsMs 28197 Specdb::MsMs 28198 Specdb::MsMs 34754 Specdb::MsMs 34755 Specdb::MsMs 34756 Specdb::MsMs 2691626 Specdb::MsMs 2691627 Specdb::MsMs 2691628 Specdb::MsMs 2991140 Specdb::MsMs 2991141 Specdb::MsMs 2991142 Specdb::MsIr 1583 Specdb::MsIr 1584 Specdb::MsIr 1585 HMDB02070 30923 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Aspartate aminotransferase, cytoplasmic P17174 GOT1