1.0 2011-09-21 00:20:24 UTC 2015-07-21 06:57:23 UTC FDB022840 N-Ribosylhistidine N tau-ribosylhistidine (His-R) is a histidine derivative found in the urine of histidinemic patients (histidinemia is an autosomal recessive metabolic disorder characterized by increased levels of histidine in blood, urine, and cerebrospinal fluid). The enzymes responsible for the formation of His-R are NAD (P) + nucleosidase [EC 3.2.2.5], nucleotide pyrophosphatase [EC 3.5.1.9] and 5'-nucleotidase [EC 3.1.3.5]. (PMID: 2992472) [HMDB] His-R N(Tau)-ribosylhistidine C11H17N3O6 287.2692 287.111735291 (2S)-2-amino-3-{1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-imidazol-4-yl}propanoic acid his-R 98379-91-0 N[C@@H](CC1=CN(C=N1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)C(O)=O InChI=1S/C11H17N3O6/c12-6(11(18)19)1-5-2-14(4-13-5)10-9(17)8(16)7(3-15)20-10/h2,4,6-10,15-17H,1,3,12H2,(H,18,19)/t6-,7+,8+,9+,10+/m0/s1 TTYCFBAOLXCFAB-VAPHQMJDSA-N belongs to the class of organic compounds known as histidine and derivatives. Histidine and derivatives are compounds containing cysteine or a derivative thereof resulting from reaction of cysteine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Histidine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic heteromonocyclic compounds Amino acids Aralkylamines Azacyclic compounds Carbonyl compounds Carboxylic acids Glycosylamines Heteroaromatic compounds Hydrocarbon derivatives Imidazole ribonucleosides and ribonucleotides Imidazolyl carboxylic acids and derivatives L-alpha-amino acids Monoalkylamines Monocarboxylic acids and derivatives N-substituted imidazoles Organic oxides Organopnictogen compounds Oxacyclic compounds Pentoses Primary alcohols Secondary alcohols Tetrahydrofurans Alcohol Alpha-amino acid Amine Amino acid Aralkylamine Aromatic heteromonocyclic compound Azacycle Azole Carbonyl group Carboxylic acid Glycosyl compound Heteroaromatic compound Histidine or derivatives Hydrocarbon derivative Imidazole Imidazole ribonucleoside Imidazolyl carboxylic acid derivative L-alpha-amino acid Monocarboxylic acid or derivatives Monosaccharide N-glycosyl compound N-substituted imidazole Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Pentose monosaccharide Primary alcohol Primary aliphatic amine Primary amine Secondary alcohol Tetrahydrofuran Solid logp -2.96 ALOGPS logs -1.16 ALOGPS solubility 2.00e+01 g/l ALOGPS logp -4.9 ChemAxon pka_strongest_acidic 1.53 ChemAxon pka_strongest_basic 9.24 ChemAxon iupac (2S)-2-amino-3-{1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-imidazol-4-yl}propanoic acid ChemAxon average_mass 287.2692 ChemAxon mono_mass 287.111735291 ChemAxon smiles N[C@@H](CC1=CN(C=N1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)C(O)=O ChemAxon formula C11H17N3O6 ChemAxon inchi InChI=1S/C11H17N3O6/c12-6(11(18)19)1-5-2-14(4-13-5)10-9(17)8(16)7(3-15)20-10/h2,4,6-10,15-17H,1,3,12H2,(H,18,19)/t6-,7+,8+,9+,10+/m0/s1 ChemAxon inchikey TTYCFBAOLXCFAB-VAPHQMJDSA-N ChemAxon polar_surface_area 151.06 ChemAxon refractivity 64.09 ChemAxon polarizability 27.15 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 8 ChemAxon donor_count 5 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 10289 Specdb::CMs 38261 Specdb::CMs 131114 Specdb::CMs 138848 Specdb::MsMs 65901 Specdb::MsMs 65902 Specdb::MsMs 65903 Specdb::MsMs 123351 Specdb::MsMs 123352 Specdb::MsMs 123353 Specdb::MsMs 2436121 Specdb::MsMs 2436122 Specdb::MsMs 2436123 Specdb::MsMs 2526069 Specdb::MsMs 2526070 Specdb::MsMs 2526071 Specdb::NmrOneD 109298 Specdb::NmrOneD 109299 Specdb::NmrOneD 109300 Specdb::NmrOneD 109301 Specdb::NmrOneD 109302 Specdb::NmrOneD 109303 Specdb::NmrOneD 109304 Specdb::NmrOneD 109305 Specdb::NmrOneD 109306 Specdb::NmrOneD 109307 Specdb::NmrOneD 109308 Specdb::NmrOneD 109309 Specdb::NmrOneD 109310 Specdb::NmrOneD 109311 Specdb::NmrOneD 109312 Specdb::NmrOneD 109313 Specdb::NmrOneD 109314 Specdb::NmrOneD 109315 Specdb::NmrOneD 109316 Specdb::NmrOneD 109317 HMDB02089 #<Reference:0x000055ce320f04a0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823